@@ -162,6 +162,11 @@
<artifactId>commons-configuration</artifactId>
<scope>compile</scope>
</dependency>
+ <dependency>
+ <groupId>org.apache.commons</groupId>
+ <artifactId>commons-lang3</artifactId>
+ <scope>compile</scope>
+ </dependency>
<dependency>
<groupId>org.slf4j</groupId>
<artifactId>slf4j-api</artifactId>
@@ -134,6 +134,9 @@ case $COMMAND in
echo $CLASSPATH
exit
fi
+ elif [ "$COMMAND" = "s3guard" ] ; then
+ CLASS=org.apache.hadoop.fs.s3a.s3guard.S3GuardTool
+ CLASSPATH=${CLASSPATH}:${TOOL_PATH}
elif [[ "$COMMAND" = -* ]] ; then
# class and package names cannot begin with a -
echo "Error: No command named \`$COMMAND' was found. Perhaps you meant \`hadoop ${COMMAND#-}'"
@@ -20,6 +20,7 @@ package org.apache.hadoop.fs;
import java.io.FileNotFoundException;
import java.io.IOException;
import java.lang.reflect.Constructor;
+import java.lang.reflect.InvocationTargetException;
import java.net.URI;
import java.net.URISyntaxException;
import java.util.ArrayList;
@@ -132,6 +133,13 @@ public abstract class AbstractFileSystem {
CONSTRUCTOR_CACHE.put(theClass, meth);
}
result = meth.newInstance(uri, conf);
+ } catch (InvocationTargetException e) {
+ Throwable cause = e.getCause();
+ if (cause instanceof RuntimeException) {
+ throw (RuntimeException) cause;
+ } else {
+ throw new RuntimeException(cause);
+ }
} catch (Exception e) {
throw new RuntimeException(e);
@@ -342,6 +342,15 @@ public class FileContext {
return AbstractFileSystem.get(uri, conf);
});
+ } catch (RuntimeException ex) {
+ // RTEs can wrap other exceptions; if there is an IOException inner,
+ // throw it direct.
+ Throwable cause = ex.getCause();
+ if (cause instanceof IOException) {
+ throw (IOException) cause;
+ throw ex;
} catch (InterruptedException ex) {
LOG.error(ex.toString());
throw new IOException("Failed to get the AbstractFileSystem for path: "
@@ -1311,12 +1311,120 @@
</description>
</property>
+<property>
+ <name>fs.s3a.metadatastore.authoritative</name>
+ <value>false</value>
+ <description>
+ When true, allow MetadataStore implementations to act as source of
+ truth for getting file status and directory listings. Even if this
+ is set to true, MetadataStore implementations may choose not to
+ return authoritative results. If the configured MetadataStore does
+ not support being authoritative, this setting will have no effect.
+ </description>
+</property>
+
+ <name>fs.s3a.metadatastore.impl</name>
+ <value>org.apache.hadoop.fs.s3a.s3guard.NullMetadataStore</value>
+ Fully-qualified name of the class that implements the MetadataStore
+ to be used by s3a. The default class, NullMetadataStore, has no
+ effect: s3a will continue to treat the backing S3 service as the one
+ and only source of truth for file and directory metadata.
+ <name>fs.s3a.s3guard.cli.prune.age</name>
+ <value>86400000</value>
+ Default age (in milliseconds) after which to prune metadata from the
+ metadatastore when the prune command is run. Can be overridden on the
+ command-line.
<property>
<name>fs.s3a.impl</name>
<value>org.apache.hadoop.fs.s3a.S3AFileSystem</value>
<description>The implementation class of the S3A Filesystem</description>
+ <name>fs.s3a.s3guard.ddb.region</name>
+ <value></value>
+ AWS DynamoDB region to connect to. An up-to-date list is
+ provided in the AWS Documentation: regions and endpoints. Without this
+ property, the S3Guard will operate table in the associated S3 bucket region.
+ <name>fs.s3a.s3guard.ddb.table</name>
+ The DynamoDB table name to operate. Without this property, the respective
+ S3 bucket name will be used.
+ <name>fs.s3a.s3guard.ddb.table.create</name>
+ If true, the S3A client will create the table if it does not already exist.
+ <name>fs.s3a.s3guard.ddb.table.capacity.read</name>
+ <value>500</value>
+ Provisioned throughput requirements for read operations in terms of capacity
+ units for the DynamoDB table. This config value will only be used when
+ creating a new DynamoDB table, though later you can manually provision by
+ increasing or decreasing read capacity as needed for existing tables.
+ See DynamoDB documents for more information.
+ <name>fs.s3a.s3guard.ddb.table.capacity.write</name>
+ <value>100</value>
+ Provisioned throughput requirements for write operations in terms of
+ capacity units for the DynamoDB table. Refer to related config
+ fs.s3a.s3guard.ddb.table.capacity.read before usage.
+ <name>fs.s3a.s3guard.ddb.max.retries</name>
+ <value>9</value>
+ Max retries on batched DynamoDB operations before giving up and
+ throwing an IOException. Each retry is delayed with an exponential
+ backoff timer which starts at 100 milliseconds and approximately
+ doubles each time. The minimum wait before throwing an exception is
+ sum(100, 200, 400, 800, .. 100*2^N-1 ) == 100 * ((2^N)-1)
+ So N = 9 yields at least 51.1 seconds (51,100) milliseconds of blocking
+ before throwing an IOException.
+ <name>fs.s3a.s3guard.ddb.background.sleep</name>
+ <value>25</value>
+ Length (in milliseconds) of pause between each batch of deletes when
+ pruning metadata. Prevents prune operations (which can typically be low
+ priority background operations) from overly interfering with other I/O
+ operations.
<name>fs.AbstractFileSystem.s3a.impl</name>
<value>org.apache.hadoop.fs.s3a.S3A</value>
@@ -222,4 +222,67 @@ public abstract class AbstractContractRenameTest extends
assertPathDoesNotExist("not deleted",
new Path(srcDir, "source.txt"));
+ /**
+ * Test that after renaming, the nested subdirectory is moved along with all
+ * its ancestors.
+ */
+ @Test
+ public void testRenamePopulatesDirectoryAncestors() throws IOException {
+ final FileSystem fs = getFileSystem();
+ final Path src = path("testRenamePopulatesDirectoryAncestors/source");
+ fs.mkdirs(src);
+ final String nestedDir = "/dir1/dir2/dir3/dir4";
+ fs.mkdirs(path(src + nestedDir));
+ Path dst = path("testRenamePopulatesDirectoryAncestorsNew");
+ fs.rename(src, dst);
+ validateAncestorsMoved(src, dst, nestedDir);
+ * Test that after renaming, the nested file is moved along with all its
+ * ancestors. It is similar to {@link #testRenamePopulatesDirectoryAncestors}.
+ public void testRenamePopulatesFileAncestors() throws IOException {
+ final Path src = path("testRenamePopulatesFileAncestors/source");
+ final String nestedFile = "/dir1/dir2/dir3/file4";
+ byte[] srcDataset = dataset(256, 'a', 'z');
+ writeDataset(fs, path(src + nestedFile), srcDataset, srcDataset.length,
+ 1024, false);
+ Path dst = path("testRenamePopulatesFileAncestorsNew");
+ validateAncestorsMoved(src, dst, nestedFile);
+ * Validate that the nested path and its ancestors should have been moved.
+ *
+ * @param src the source root to move
+ * @param dst the destination root to move
+ * @param nestedPath the nested path to move
+ private void validateAncestorsMoved(Path src, Path dst, String nestedPath)
+ throws IOException {
+ assertIsDirectory(dst);
+ assertPathDoesNotExist("src path should not exist", path(src + nestedPath));
+ assertPathExists("dst path should exist", path(dst + nestedPath));
+ Path path = new Path(nestedPath).getParent();
+ while (path != null && !path.isRoot()) {
+ final Path parentSrc = path(src + path.toString());
+ assertPathDoesNotExist(parentSrc + " is not deleted", parentSrc);
+ final Path parentDst = path(dst + path.toString());
+ assertPathExists(parentDst + " should exist after rename", parentDst);
+ assertIsDirectory(parentDst);
+ path = path.getParent();
@@ -277,6 +277,23 @@ public final class LambdaTestUtils {
+ * Variant of {@link #eventually(int, Callable, Callable)} method for
+ * void lambda expressions.
+ * @param timeoutMillis timeout in milliseconds.
+ * Can be zero, in which case only one attempt is made before failing.
+ * @param eval expression to evaluate
+ * @param retry retry interval generator
+ * @throws Exception the last exception thrown before timeout was triggered
+ * @throws FailFastException if raised -without any retry attempt.
+ * @throws InterruptedException if interrupted during the sleep operation.
+ public static void eventually(int timeoutMillis,
+ VoidCallable eval,
+ Callable<Integer> retry) throws Exception {
+ eventually(timeoutMillis, new VoidCaller(eval), retry);
/**
* Simplified {@link #eventually(int, Callable, Callable)} method
* with a fixed interval.
@@ -305,6 +322,25 @@ public final class LambdaTestUtils {
new FixedRetryInterval(intervalMillis));
+ * Variant of {@link #eventually(int, int, Callable)} method for
+ * @param intervalMillis interval in milliseconds
+ int intervalMillis,
+ VoidCallable eval) throws Exception {
+ eventually(timeoutMillis, eval,
+ new FixedRetryInterval(intervalMillis));
* Intercept an exception; throw an {@code AssertionError} if one not raised.
* The caught exception is rethrown if it is of the wrong class or
@@ -347,6 +383,32 @@ public final class LambdaTestUtils {
+ * Variant of {@link #intercept(Class, Callable)} to simplify void
+ * invocations.
+ * @param clazz class of exception; the raised exception must be this class
+ * <i>or a subclass</i>.
+ * @param eval expression to eval
+ * @param <E> exception class
+ * @return the caught exception if it was of the expected type
+ * @throws Exception any other exception raised
+ * @throws AssertionError if the evaluation call didn't raise an exception.
+ public static <E extends Throwable> E intercept(
+ Class<E> clazz,
+ VoidCallable eval)
+ throws Exception {
+ try {
+ eval.call();
+ throw new AssertionError("Expected an exception");
+ } catch (Throwable e) {
+ if (clazz.isAssignableFrom(e.getClass())) {
+ return (E)e;
+ throw e;
@@ -387,6 +449,29 @@ public final class LambdaTestUtils {
return ex;
+ * @param contained string which must be in the {@code toString()} value
+ * of the exception
+ String contained,
+ E ex = intercept(clazz, eval);
+ GenericTestUtils.assertExceptionContains(contained, ex);
+ return ex;
* Robust string converter for exception messages; if the {@code toString()}
* method throws an exception then that exception is caught and logged,
@@ -547,4 +632,31 @@ public final class LambdaTestUtils {
return new FailFastException(String.format(format, args));
+ * A simple interface for lambdas, which returns nothing; this exists
+ * to simplify lambda tests on operations with no return value.
+ public interface VoidCallable {
+ void call() throws Exception;
+ * Bridge class to make {@link VoidCallable} something to use in anything
+ * which takes an {@link Callable}.
+ public static class VoidCaller implements Callable<Void> {
+ private final VoidCallable callback;
+ public VoidCaller(VoidCallable callback) {
+ this.callback = callback;
+ @Override
+ public Void call() throws Exception {
+ callback.call();
+ return null;
@@ -765,6 +765,11 @@
<version>1.6</version>
+ <version>3.4</version>
@@ -1509,4 +1514,12 @@
</build>
</profile>
</profiles>
+ <repositories>
+ <repository>
+ <id>dynamodb-local-oregon</id>
+ <name>DynamoDB Local Release Repository</name>
+ <url>https://s3-us-west-2.amazonaws.com/dynamodb-local/release</url>
+ </repository>
+ </repositories>
</project>
@@ -26,4 +26,10 @@
<Match>
<Class name="org.apache.hadoop.fs.s3.INode" />
</Match>
+ <!-- Redundant null check makes code clearer, future-proof here. -->
+ <Match>
+ <Class name="org.apache.hadoop.fs.s3a.S3AFileSystem" />
+ <Method name="s3Exists" />
+ <Bug pattern="RCN_REDUNDANT_NULLCHECK_OF_NONNULL_VALUE" />
+ </Match>
</FindBugsFilter>
@@ -36,6 +36,7 @@
<downloadSources>true</downloadSources>
<hadoop.tmp.dir>${project.build.directory}/test</hadoop.tmp.dir>
+ <dynamodb.local.version>1.11.86</dynamodb.local.version>
<!-- are scale tests enabled ? -->
<fs.s3a.scale.test.enabled>unset</fs.s3a.scale.test.enabled>
<!-- Size in MB of huge files. -->
@@ -44,6 +45,11 @@
<fs.s3a.scale.test.huge.partitionsize>unset</fs.s3a.scale.test.huge.partitionsize>
<!-- Timeout in seconds for scale tests.-->
<fs.s3a.scale.test.timeout>3600</fs.s3a.scale.test.timeout>
+ <!-- are scale tests enabled ? -->
+ <fs.s3a.s3guard.test.enabled>false</fs.s3a.s3guard.test.enabled>
+ <fs.s3a.s3guard.test.authoritative>false</fs.s3a.s3guard.test.authoritative>
+ <fs.s3a.s3guard.test.implementation>local</fs.s3a.s3guard.test.implementation>
</properties>
<profiles>
@@ -164,6 +170,11 @@
<fs.s3a.scale.test.huge.filesize>${fs.s3a.scale.test.huge.filesize}</fs.s3a.scale.test.huge.filesize>
<fs.s3a.scale.test.huge.huge.partitionsize>${fs.s3a.scale.test.huge.partitionsize}</fs.s3a.scale.test.huge.huge.partitionsize>
<fs.s3a.scale.test.timeout>${fs.s3a.scale.test.timeout}</fs.s3a.scale.test.timeout>
+ <!-- S3Guard -->
+ <fs.s3a.s3guard.test.enabled>${fs.s3a.s3guard.test.enabled}</fs.s3a.s3guard.test.enabled>
+ <fs.s3a.s3guard.test.authoritative>${fs.s3a.s3guard.test.authoritative}</fs.s3a.s3guard.test.authoritative>
+ <fs.s3a.s3guard.test.implementation>${fs.s3a.s3guard.test.implementation}</fs.s3a.s3guard.test.implementation>
</systemPropertyVariables>
<!-- Some tests cannot run in parallel. Tests that cover -->
<!-- access to the root directory must run in isolation -->
@@ -206,6 +217,10 @@
<!-- Do a sequential run for tests that cannot handle -->
<!-- parallel execution. -->
@@ -249,6 +264,10 @@
<fs.s3a.scale.test.enabled>${fs.s3a.scale.test.enabled}</fs.s3a.scale.test.enabled>
<forkedProcessTimeoutInSeconds>${fs.s3a.scale.test.timeout}</forkedProcessTimeoutInSeconds>
</configuration>
@@ -271,6 +290,60 @@
<fs.s3a.scale.test.enabled>true</fs.s3a.scale.test.enabled>
+ <!-- Turn on S3Guard tests-->
+ <profile>
+ <id>s3guard</id>
+ <activation>
+ <property>
+ <name>s3guard</name>
+ </property>
+ </activation>
+ <properties >
+ <fs.s3a.s3guard.test.enabled>true</fs.s3a.s3guard.test.enabled>
+ </properties>
+ </profile>
+ <!-- Switch to DynamoDB for S3Guard. Has no effect unless S3Guard is enabled -->
+ <id>dynamo</id>
+ <name>dynamo</name>
+ <fs.s3a.s3guard.test.implementation>dynamo</fs.s3a.s3guard.test.implementation>
+ <!-- Switch to DynamoDBLocal for S3Guard. Has no effect unless S3Guard is enabled -->
+ <id>dynamodblocal</id>
+ <name>dynamodblocal</name>
+ <properties>
+ <fs.s3a.s3guard.test.implementation>dynamodblocal</fs.s3a.s3guard.test.implementation>
+ <!-- Switch S3Guard from Authoritative=false to true
+ Has no effect unless S3Guard is enabled -->
+ <id>non-auth</id>
+ <name>auth</name>
+ <fs.s3a.s3guard.test.authoritative>true</fs.s3a.s3guard.test.authoritative>
<build>
@@ -301,6 +374,33 @@
<forkedProcessTimeoutInSeconds>3600</forkedProcessTimeoutInSeconds>
</plugin>
+ <plugin>
+ <groupId>org.apache.maven.plugins</groupId>
+ <artifactId>maven-dependency-plugin</artifactId>
+ <executions>
+ <execution>
+ <id>copy</id>
+ <phase>test-compile</phase>
+ <goals>
+ <goal>copy-dependencies</goal>
+ </goals>
+ <configuration>
+ <includeScope>test</includeScope>
+ <includeTypes>so,dll,dylib</includeTypes>
+ <outputDirectory>${project.build.directory}/native-libs</outputDirectory>
+ </configuration>
+ </execution>
+ <phase>package</phase>
+ <outputDirectory>${project.build.directory}/lib</outputDirectory>
+ </executions>
+ </plugin>
</plugins>
@@ -309,18 +409,65 @@
<groupId>org.apache.hadoop</groupId>
<artifactId>hadoop-common</artifactId>
<scope>provided</scope>
+ <exclusions>
+ <exclusion>
+ <artifactId>servlet-api</artifactId>
+ <groupId>javax.servlet</groupId>
+ </exclusion>
+ </exclusions>
<scope>test</scope>
<type>test-jar</type>
<groupId>com.amazonaws</groupId>
<artifactId>aws-java-sdk-bundle</artifactId>
+ <groupId>com.amazonaws</groupId>
+ <artifactId>DynamoDBLocal</artifactId>
+ <version>${dynamodb.local.version}</version>
+ <scope>test</scope>
+ <groupId>org.hamcrest</groupId>
+ <artifactId>hamcrest-core</artifactId>
+<!--
+ <groupId>org.eclipse.jetty</groupId>
+ <artifactId>jetty-http</artifactId>
+-->
<groupId>junit</groupId>
<artifactId>junit</artifactId>
@@ -272,6 +272,11 @@ public final class Constants {
public static final String USER_AGENT_PREFIX = "fs.s3a.user.agent.prefix";
+ /** Whether or not to allow MetadataStore to be source of truth. */
+ public static final String METADATASTORE_AUTHORITATIVE =
+ "fs.s3a.metadatastore.authoritative";
+ public static final boolean DEFAULT_METADATASTORE_AUTHORITATIVE = false;
/** read ahead buffer size to prevent connection re-establishments. */
public static final String READAHEAD_RANGE = "fs.s3a.readahead.range";
public static final long DEFAULT_READAHEAD_RANGE = 64 * 1024;
@@ -317,7 +322,7 @@ public final class Constants {
@InterfaceStability.Unstable
public static final Class<? extends S3ClientFactory>
DEFAULT_S3_CLIENT_FACTORY_IMPL =
- S3ClientFactory.DefaultS3ClientFactory.class;
+ DefaultS3ClientFactory.class;
* Maximum number of partitions in a multipart upload: {@value}.
@@ -325,4 +330,130 @@ public final class Constants {
@InterfaceAudience.Private
public static final int MAX_MULTIPART_COUNT = 10000;
+ * Classname of the S3A-specific output committer factory. This
+ * is what must be declared when attempting to use
+ @InterfaceStability.Unstable
+ public static final String S3A_OUTPUT_COMMITTER_FACTORY =
+ "org.apache.hadoop.fs.s3a.commit.S3AOutputCommitterFactory";
+ /* Constants. */
+ public static final String S3_METADATA_STORE_IMPL =
+ "fs.s3a.metadatastore.impl";
+ /** Minimum period of time (in milliseconds) to keep metadata (may only be
+ * applied when a prune command is manually run).
+ public static final String S3GUARD_CLI_PRUNE_AGE =
+ "fs.s3a.s3guard.cli.prune.age";
+ * The region of the DynamoDB service.
+ * This config has no default value. If the user does not set this, the
+ * S3Guard will operate table in the associated S3 bucket region.
+ public static final String S3GUARD_DDB_REGION_KEY =
+ "fs.s3a.s3guard.ddb.region";
+ * The DynamoDB table name to use.
+ * S3Guard implementation will use the respective S3 bucket name.
+ public static final String S3GUARD_DDB_TABLE_NAME_KEY =
+ "fs.s3a.s3guard.ddb.table";
+ * Whether to create the DynamoDB table if the table does not exist.
+ public static final String S3GUARD_DDB_TABLE_CREATE_KEY =
+ "fs.s3a.s3guard.ddb.table.create";
+ public static final String S3GUARD_DDB_TABLE_CAPACITY_READ_KEY =
+ "fs.s3a.s3guard.ddb.table.capacity.read";
+ public static final long S3GUARD_DDB_TABLE_CAPACITY_READ_DEFAULT = 500;
+ public static final String S3GUARD_DDB_TABLE_CAPACITY_WRITE_KEY =
+ "fs.s3a.s3guard.ddb.table.capacity.write";
+ public static final long S3GUARD_DDB_TABLE_CAPACITY_WRITE_DEFAULT = 100;
+ * The maximum put or delete requests per BatchWriteItem request.
+ * Refer to Amazon API reference for this limit.
+ public static final int S3GUARD_DDB_BATCH_WRITE_REQUEST_LIMIT = 25;
+ public static final String S3GUARD_DDB_MAX_RETRIES =
+ "fs.s3a.s3guard.ddb.max.retries";
+ * Max retries on batched DynamoDB operations before giving up and
+ * throwing an IOException. Default is {@value}. See core-default.xml for
+ * more detail.
+ public static final int S3GUARD_DDB_MAX_RETRIES_DEFAULT = 9;
+ * Period of time (in milliseconds) to sleep between batches of writes.
+ * Currently only applies to prune operations, as they are naturally a
+ * lower priority than other operations.
+ public static final String S3GUARD_DDB_BACKGROUND_SLEEP_MSEC_KEY =
+ "fs.s3a.s3guard.ddb.background.sleep";
+ public static final int S3GUARD_DDB_BACKGROUND_SLEEP_MSEC_DEFAULT = 25;
+ * V1 committer.
+ public static final String S3A_OUTPUT_COMMITTER_MRV1 =
+ "org.apache.hadoop.fs.s3a.commit.S3OutputCommitterMRv1";
+ * The default "Null" metadata store: {@value}.
+ public static final String S3GUARD_METASTORE_NULL
+ = "org.apache.hadoop.fs.s3a.s3guard.NullMetadataStore";
+ * Use Local memory for the metadata: {@value}.
+ * This is not coherent across processes and must be used for testing only.
+ public static final String S3GUARD_METASTORE_LOCAL
+ = "org.apache.hadoop.fs.s3a.s3guard.LocalMetadataStore";
+ * Use DynamoDB for the metadata: {@value}.
+ public static final String S3GUARD_METASTORE_DYNAMO
+ = "org.apache.hadoop.fs.s3a.s3guard.DynamoDBMetadataStore";
+ * Inconsistency (visibility delay) injection settings.
+ public static final String FAIL_INJECT_INCONSISTENCY_KEY =
+ "fs.s3a.failinject.inconsistency.key.substring";
+ public static final String FAIL_INJECT_INCONSISTENCY_MSEC =
+ "fs.s3a.failinject.inconsistency.msec";
+ public static final String FAIL_INJECT_INCONSISTENCY_PROBABILITY =
+ "fs.s3a.failinject.inconsistency.probability";
@@ -0,0 +1,233 @@
+/*
+ * Licensed to the Apache Software Foundation (ASF) under one
+ * or more contributor license agreements. See the NOTICE file
+ * distributed with this work for additional information
+ * regarding copyright ownership. The ASF licenses this file
+ * to you under the Apache License, Version 2.0 (the
+ * "License"); you may not use this file except in compliance
+ * with the License. You may obtain a copy of the License at
+ * http://www.apache.org/licenses/LICENSE-2.0
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+package org.apache.hadoop.fs.s3a;
+import com.amazonaws.ClientConfiguration;
+import com.amazonaws.Protocol;
+import com.amazonaws.auth.AWSCredentialsProvider;
+import com.amazonaws.services.s3.AmazonS3;
+import com.amazonaws.services.s3.AmazonS3Client;
+import com.amazonaws.services.s3.S3ClientOptions;
+import org.apache.hadoop.conf.Configuration;
+import org.apache.hadoop.conf.Configured;
+import org.apache.hadoop.util.VersionInfo;
+import org.slf4j.Logger;
+import java.io.IOException;
+import java.net.URI;
+import static org.apache.hadoop.fs.s3a.Constants.*;
+import static org.apache.hadoop.fs.s3a.S3AUtils.createAWSCredentialProviderSet;
+import static org.apache.hadoop.fs.s3a.S3AUtils.intOption;
+/**
+ * The default factory implementation, which calls the AWS SDK to configure
+ * and create an {@link AmazonS3Client} that communicates with the S3 service.
+public class DefaultS3ClientFactory extends Configured implements
+ S3ClientFactory {
+ protected static final Logger LOG = S3AFileSystem.LOG;
+ public AmazonS3 createS3Client(URI name) throws IOException {
+ Configuration conf = getConf();
+ AWSCredentialsProvider credentials =
+ createAWSCredentialProviderSet(name, conf);
+ final ClientConfiguration awsConf = createAwsConf(getConf());
+ AmazonS3 s3 = newAmazonS3Client(credentials, awsConf);
+ return createAmazonS3Client(s3, conf, credentials, awsConf);
+ * Create a new {@link ClientConfiguration}.
+ * @param conf The Hadoop configuration
+ * @return new AWS client configuration
+ public static ClientConfiguration createAwsConf(Configuration conf) {
+ final ClientConfiguration awsConf = new ClientConfiguration();
+ initConnectionSettings(conf, awsConf);
+ initProxySupport(conf, awsConf);
+ initUserAgent(conf, awsConf);
+ return awsConf;
+ * Wrapper around constructor for {@link AmazonS3} client. Override this to
+ * provide an extended version of the client
+ * @param credentials credentials to use
+ * @param awsConf AWS configuration
+ * @return new AmazonS3 client
+ protected AmazonS3 newAmazonS3Client(
+ AWSCredentialsProvider credentials, ClientConfiguration awsConf) {
+ return new AmazonS3Client(credentials, awsConf);
+ * Initializes all AWS SDK settings related to connection management.
+ * @param conf Hadoop configuration
+ * @param awsConf AWS SDK configuration
+ private static void initConnectionSettings(Configuration conf,
+ ClientConfiguration awsConf) {
+ awsConf.setMaxConnections(intOption(conf, MAXIMUM_CONNECTIONS,
+ DEFAULT_MAXIMUM_CONNECTIONS, 1));
+ boolean secureConnections = conf.getBoolean(SECURE_CONNECTIONS,
+ DEFAULT_SECURE_CONNECTIONS);
+ awsConf.setProtocol(secureConnections ? Protocol.HTTPS : Protocol.HTTP);
+ awsConf.setMaxErrorRetry(intOption(conf, MAX_ERROR_RETRIES,
+ DEFAULT_MAX_ERROR_RETRIES, 0));
+ awsConf.setConnectionTimeout(intOption(conf, ESTABLISH_TIMEOUT,
+ DEFAULT_ESTABLISH_TIMEOUT, 0));
+ awsConf.setSocketTimeout(intOption(conf, SOCKET_TIMEOUT,
+ DEFAULT_SOCKET_TIMEOUT, 0));
+ int sockSendBuffer = intOption(conf, SOCKET_SEND_BUFFER,
+ DEFAULT_SOCKET_SEND_BUFFER, 2048);
+ int sockRecvBuffer = intOption(conf, SOCKET_RECV_BUFFER,
+ DEFAULT_SOCKET_RECV_BUFFER, 2048);
+ awsConf.setSocketBufferSizeHints(sockSendBuffer, sockRecvBuffer);
+ String signerOverride = conf.getTrimmed(SIGNING_ALGORITHM, "");
+ if (!signerOverride.isEmpty()) {
+ LOG.debug("Signer override = {}", signerOverride);
+ awsConf.setSignerOverride(signerOverride);
+ * Initializes AWS SDK proxy support if configured.
+ * @throws IllegalArgumentException if misconfigured
+ private static void initProxySupport(Configuration conf,
+ ClientConfiguration awsConf) throws IllegalArgumentException {
+ String proxyHost = conf.getTrimmed(PROXY_HOST, "");
+ int proxyPort = conf.getInt(PROXY_PORT, -1);
+ if (!proxyHost.isEmpty()) {
+ awsConf.setProxyHost(proxyHost);
+ if (proxyPort >= 0) {
+ awsConf.setProxyPort(proxyPort);
+ if (conf.getBoolean(SECURE_CONNECTIONS, DEFAULT_SECURE_CONNECTIONS)) {
+ LOG.warn("Proxy host set without port. Using HTTPS default 443");
+ awsConf.setProxyPort(443);
+ LOG.warn("Proxy host set without port. Using HTTP default 80");
+ awsConf.setProxyPort(80);
+ String proxyUsername = conf.getTrimmed(PROXY_USERNAME);
+ String proxyPassword = conf.getTrimmed(PROXY_PASSWORD);
+ if ((proxyUsername == null) != (proxyPassword == null)) {
+ String msg = "Proxy error: " + PROXY_USERNAME + " or " +
+ PROXY_PASSWORD + " set without the other.";
+ LOG.error(msg);
+ throw new IllegalArgumentException(msg);
+ awsConf.setProxyUsername(proxyUsername);
+ awsConf.setProxyPassword(proxyPassword);
+ awsConf.setProxyDomain(conf.getTrimmed(PROXY_DOMAIN));
+ awsConf.setProxyWorkstation(conf.getTrimmed(PROXY_WORKSTATION));
+ if (LOG.isDebugEnabled()) {
+ LOG.debug("Using proxy server {}:{} as user {} with password {} on " +
+ "domain {} as workstation {}", awsConf.getProxyHost(),
+ awsConf.getProxyPort(),
+ String.valueOf(awsConf.getProxyUsername()),
+ awsConf.getProxyPassword(), awsConf.getProxyDomain(),
+ awsConf.getProxyWorkstation());
+ } else if (proxyPort >= 0) {
+ String msg =
+ "Proxy error: " + PROXY_PORT + " set without " + PROXY_HOST;
+ * Initializes the User-Agent header to send in HTTP requests to the S3
+ * back-end. We always include the Hadoop version number. The user also
+ * may set an optional custom prefix to put in front of the Hadoop version
+ * number. The AWS SDK interally appends its own information, which seems
+ * to include the AWS SDK version, OS and JVM version.
+ private static void initUserAgent(Configuration conf,
+ String userAgent = "Hadoop " + VersionInfo.getVersion();
+ String userAgentPrefix = conf.getTrimmed(USER_AGENT_PREFIX, "");
+ if (!userAgentPrefix.isEmpty()) {
+ userAgent = userAgentPrefix + ", " + userAgent;
+ LOG.debug("Using User-Agent: {}", userAgent);
+ awsConf.setUserAgentPrefix(userAgent);
+ * Creates an {@link AmazonS3Client} from the established configuration.
+ * @param credentials AWS credentials
+ * @return S3 client
+ private static AmazonS3 createAmazonS3Client(AmazonS3 s3, Configuration conf,
+ AWSCredentialsProvider credentials, ClientConfiguration awsConf)
+ throws IllegalArgumentException {
+ String endPoint = conf.getTrimmed(ENDPOINT, "");
+ if (!endPoint.isEmpty()) {
+ s3.setEndpoint(endPoint);
+ } catch (IllegalArgumentException e) {
+ String msg = "Incorrect endpoint: " + e.getMessage();
+ throw new IllegalArgumentException(msg, e);
+ enablePathStyleAccessIfRequired(s3, conf);
+ return s3;
+ * Enables path-style access to S3 buckets if configured. By default, the
+ * behavior is to use virtual hosted-style access with URIs of the form
+ * http://bucketname.s3.amazonaws.com. Enabling path-style access and a
+ * region-specific endpoint switches the behavior to use URIs of the form
+ * http://s3-eu-west-1.amazonaws.com/bucketname.
+ * @param s3 S3 client
+ private static void enablePathStyleAccessIfRequired(AmazonS3 s3,
+ Configuration conf) {
+ final boolean pathStyleAccess = conf.getBoolean(PATH_STYLE_ACCESS, false);
+ if (pathStyleAccess) {
+ LOG.debug("Enabling path style access!");
+ s3.setS3ClientOptions(S3ClientOptions.builder()
+ .setPathStyleAccess(true)
+ .build());
+}
@@ -0,0 +1,434 @@
+import com.amazonaws.AmazonClientException;
+import com.amazonaws.AmazonServiceException;
+import com.amazonaws.services.s3.model.DeleteObjectRequest;
+import com.amazonaws.services.s3.model.DeleteObjectsRequest;
+import com.amazonaws.services.s3.model.DeleteObjectsResult;
+import com.amazonaws.services.s3.model.ListObjectsRequest;
+import com.amazonaws.services.s3.model.ObjectListing;
+import com.amazonaws.services.s3.model.PutObjectRequest;
+import com.amazonaws.services.s3.model.PutObjectResult;
+import com.amazonaws.services.s3.model.S3ObjectSummary;
+import com.google.common.base.Preconditions;
+import org.apache.hadoop.classification.InterfaceAudience;
+import org.apache.hadoop.classification.InterfaceStability;
+import org.apache.hadoop.fs.Path;
+import org.slf4j.LoggerFactory;
+import java.util.ArrayList;
+import java.util.HashMap;
+import java.util.HashSet;
+import java.util.List;
+import java.util.Map;
+ * A wrapper around {@link com.amazonaws.services.s3.AmazonS3} that injects
+ * inconsistency and/or errors. Used for testing S3Guard.
+ * Currently only delays listing visibility, not affecting GET.
+@InterfaceAudience.Private
+@InterfaceStability.Unstable
+public class InconsistentAmazonS3Client extends AmazonS3Client {
+ * Keys containing this substring will be subject to delayed visibility.
+ public static final String DEFAULT_DELAY_KEY_SUBSTRING = "DELAY_LISTING_ME";
+ * How many seconds affected keys will be delayed from appearing in listing.
+ * This should probably be a config value.
+ public static final long DEFAULT_DELAY_KEY_MSEC = 5 * 1000;
+ public static final float DEFAULT_DELAY_KEY_PROBABILITY = 1.0f;
+ /** Special config value since we can't store empty strings in XML. */
+ public static final String MATCH_ALL_KEYS = "*";
+ private static final Logger LOG =
+ LoggerFactory.getLogger(InconsistentAmazonS3Client.class);
+ /** Empty string matches all keys. */
+ private String delayKeySubstring;
+ /** Probability to delay visibility of a matching key. */
+ private float delayKeyProbability;
+ /** Time in milliseconds to delay visibility of newly modified object. */
+ private long delayKeyMsec;
+ * Composite of data we need to track about recently deleted objects:
+ * when it was deleted (same was with recently put objects) and the object
+ * summary (since we should keep returning it for sometime after its
+ * deletion).
+ private static class Delete {
+ private Long time;
+ private S3ObjectSummary summary;
+ Delete(Long time, S3ObjectSummary summary) {
+ this.time = time;
+ this.summary = summary;
+ public Long time() {
+ return time;
+ public S3ObjectSummary summary() {
+ return summary;
+ /** Map of key to delay -> time it was deleted + object summary (object
+ * summary is null for prefixes. */
+ private Map<String, Delete> delayedDeletes = new HashMap<>();
+ /** Map of key to delay -> time it was created. */
+ private Map<String, Long> delayedPutKeys = new HashMap<>();
+ public InconsistentAmazonS3Client(AWSCredentialsProvider credentials,
+ ClientConfiguration clientConfiguration, Configuration conf) {
+ super(credentials, clientConfiguration);
+ setupConfig(conf);
+ protected void setupConfig(Configuration conf) {
+ delayKeySubstring = conf.get(FAIL_INJECT_INCONSISTENCY_KEY,
+ DEFAULT_DELAY_KEY_SUBSTRING);
+ // "" is a substring of all strings, use it to match all keys.
+ if (delayKeySubstring.equals(MATCH_ALL_KEYS)) {
+ delayKeySubstring = "";
+ delayKeyProbability = conf.getFloat(FAIL_INJECT_INCONSISTENCY_PROBABILITY,
+ DEFAULT_DELAY_KEY_PROBABILITY);
+ delayKeyMsec = conf.getLong(FAIL_INJECT_INCONSISTENCY_MSEC,
+ DEFAULT_DELAY_KEY_MSEC);
+ LOG.info("Enabled with {} msec delay, substring {}, probability {}",
+ delayKeyMsec, delayKeySubstring, delayKeyProbability);
+ * Clear all oustanding inconsistent keys. After calling this function,
+ * listings should behave normally (no failure injection), until additional
+ * keys are matched for delay, e.g. via putObject(), deleteObject().
+ public void clearInconsistency() {
+ LOG.info("clearing all delayed puts / deletes");
+ delayedDeletes.clear();
+ delayedPutKeys.clear();
+ * Convenience function for test code to cast from supertype.
+ * @param c supertype to cast from
+ * @return subtype, not null
+ * @throws Exception on error
+ public static InconsistentAmazonS3Client castFrom(AmazonS3 c) throws
+ Exception {
+ InconsistentAmazonS3Client ic = null;
+ if (c instanceof InconsistentAmazonS3Client) {
+ ic = (InconsistentAmazonS3Client) c;
+ Preconditions.checkNotNull(ic, "Not an instance of " +
+ "InconsistentAmazonS3Client");
+ return ic;
+ public DeleteObjectsResult deleteObjects(DeleteObjectsRequest
+ deleteObjectsRequest)
+ throws AmazonClientException, AmazonServiceException {
+ for (DeleteObjectsRequest.KeyVersion keyVersion :
+ deleteObjectsRequest.getKeys()) {
+ registerDeleteObject(keyVersion.getKey(), deleteObjectsRequest
+ .getBucketName());
+ return super.deleteObjects(deleteObjectsRequest);
+ public void deleteObject(DeleteObjectRequest deleteObjectRequest)
+ String key = deleteObjectRequest.getKey();
+ LOG.debug("key {}", key);
+ registerDeleteObject(key, deleteObjectRequest.getBucketName());
+ super.deleteObject(deleteObjectRequest);
+ /* We should only need to override this version of putObject() */
+ public PutObjectResult putObject(PutObjectRequest putObjectRequest)
+ LOG.debug("key {}", putObjectRequest.getKey());
+ registerPutObject(putObjectRequest);
+ return super.putObject(putObjectRequest);
+ /* We should only need to override this version of listObjects() */
+ public ObjectListing listObjects(ListObjectsRequest listObjectsRequest)
+ LOG.debug("prefix {}", listObjectsRequest.getPrefix());
+ ObjectListing listing = super.listObjects(listObjectsRequest);
+ listing = filterListObjects(listObjectsRequest, listing);
+ listing = restoreListObjects(listObjectsRequest, listing);
+ return listing;
+ private void addSummaryIfNotPresent(List<S3ObjectSummary> list,
+ S3ObjectSummary item) {
+ // Behavior of S3ObjectSummary
+ String key = item.getKey();
+ for (S3ObjectSummary member : list) {
+ if (member.getKey().equals(key)) {
+ return;
+ list.add(item);
+ * Add prefix of child to given list. The added prefix will be equal to
+ * ancestor plus one directory past ancestor. e.g.:
+ * if ancestor is "/a/b/c" and child is "/a/b/c/d/e/file" then "a/b/c/d" is
+ * added to list.
+ * @param prefixes list to add to
+ * @param ancestor path we are listing in
+ * @param child full path to get prefix from
+ private void addPrefixIfNotPresent(List<String> prefixes, String ancestor,
+ String child) {
+ Path prefixCandidate = new Path(child).getParent();
+ Path ancestorPath = new Path(ancestor);
+ Preconditions.checkArgument(child.startsWith(ancestor), "%s does not " +
+ "start with %s", child, ancestor);
+ while (!prefixCandidate.isRoot()) {
+ Path nextParent = prefixCandidate.getParent();
+ if (nextParent.equals(ancestorPath)) {
+ String prefix = prefixCandidate.toString();
+ if (!prefixes.contains(prefix)) {
+ prefixes.add(prefix);
+ prefixCandidate = nextParent;
+ * Checks that the parent key is an ancestor of the child key.
+ * @param parent key that may be the parent.
+ * @param child key that may be the child.
+ * @param recursive if false, only return true for direct children. If
+ * true, any descendant will count.
+ * @return true if parent is an ancestor of child
+ private boolean isDescendant(String parent, String child, boolean recursive) {
+ if (recursive) {
+ if (!parent.endsWith("/")) {
+ parent = parent + "/";
+ return child.startsWith(parent);
+ Path actualParentPath = new Path(child).getParent();
+ Path expectedParentPath = new Path(parent);
+ return actualParentPath.equals(expectedParentPath);
+ * Simulate eventual consistency of delete for this list operation: Any
+ * recently-deleted keys will be added.
+ * @param request List request
+ * @param rawListing listing returned from underlying S3
+ * @return listing with recently-deleted items restored
+ private ObjectListing restoreListObjects(ListObjectsRequest request,
+ ObjectListing rawListing) {
+ List<S3ObjectSummary> outputList = rawListing.getObjectSummaries();
+ List<String> outputPrefixes = rawListing.getCommonPrefixes();
+ // recursive list has no delimiter, returns everything that matches a
+ // prefix.
+ boolean recursiveObjectList = !("/".equals(request.getDelimiter()));
+ // Go through all deleted keys
+ for (String key : new HashSet<>(delayedDeletes.keySet())) {
+ Delete delete = delayedDeletes.get(key);
+ if (isKeyDelayed(delete.time(), key)) {
+ if (isDescendant(request.getPrefix(), key, recursiveObjectList)) {
+ if (delete.summary() != null) {
+ addSummaryIfNotPresent(outputList, delete.summary());
+ // Non-recursive list has delimiter: will return rolled-up prefixes for
+ // all keys that are not direct children
+ if (!recursiveObjectList) {
+ if (isDescendant(request.getPrefix(), key, true)) {
+ addPrefixIfNotPresent(outputPrefixes, request.getPrefix(), key);
+ // Clean up any expired entries
+ delayedDeletes.remove(key);
+ return new CustomObjectListing(rawListing, outputList, outputPrefixes);
+ private ObjectListing filterListObjects(ListObjectsRequest request,
+ // Filter object listing
+ List<S3ObjectSummary> outputList = new ArrayList<>();
+ for (S3ObjectSummary s : rawListing.getObjectSummaries()) {
+ String key = s.getKey();
+ if (!isKeyDelayed(delayedPutKeys.get(key), key)) {
+ outputList.add(s);
+ // Filter prefixes (directories)
+ List<String> outputPrefixes = new ArrayList<>();
+ for (String key : rawListing.getCommonPrefixes()) {
+ outputPrefixes.add(key);
+ private boolean isKeyDelayed(Long enqueueTime, String key) {
+ if (enqueueTime == null) {
+ LOG.debug("no delay for key {}", key);
+ return false;
+ long currentTime = System.currentTimeMillis();
+ long deadline = enqueueTime + delayKeyMsec;
+ if (currentTime >= deadline) {
+ LOG.debug("no longer delaying {}", key);
+ LOG.info("delaying {}", key);
+ return true;
+ private void registerDeleteObject(String key, String bucket) {
+ if (shouldDelay(key)) {
+ // Record summary so we can add it back for some time post-deletion
+ S3ObjectSummary summary = null;
+ ObjectListing list = listObjects(bucket, key);
+ for (S3ObjectSummary result : list.getObjectSummaries()) {
+ if (result.getKey().equals(key)) {
+ summary = result;
+ break;
+ delayedDeletes.put(key, new Delete(System.currentTimeMillis(), summary));
+ private void registerPutObject(PutObjectRequest req) {
+ String key = req.getKey();
+ enqueueDelayedPut(key);
+ * Should we delay listing visibility for this key?
+ * @param key key which is being put
+ * @return true if we should delay
+ private boolean shouldDelay(String key) {
+ boolean delay = key.contains(delayKeySubstring);
+ delay = delay && trueWithProbability(delayKeyProbability);
+ LOG.debug("{} -> {}", key, delay);
+ return delay;
+ private boolean trueWithProbability(float p) {
+ return Math.random() < p;
+ * Record this key as something that should not become visible in
+ * listObject replies for a while, to simulate eventual list consistency.
+ * @param key key to delay visibility of
+ private void enqueueDelayedPut(String key) {
+ LOG.debug("delaying put of {}", key);
+ delayedPutKeys.put(key, System.currentTimeMillis());
+ /** Since ObjectListing is immutable, we just override it with wrapper. */
+ private static class CustomObjectListing extends ObjectListing {
+ private final List<S3ObjectSummary> customListing;
+ private final List<String> customPrefixes;
+ CustomObjectListing(ObjectListing rawListing,
+ List<S3ObjectSummary> customListing,
+ List<String> customPrefixes) {
+ super();
+ this.customListing = customListing;
+ this.customPrefixes = customPrefixes;
+ this.setBucketName(rawListing.getBucketName());
+ this.setCommonPrefixes(rawListing.getCommonPrefixes());
+ this.setDelimiter(rawListing.getDelimiter());
+ this.setEncodingType(rawListing.getEncodingType());
+ this.setMarker(rawListing.getMarker());
+ this.setMaxKeys(rawListing.getMaxKeys());
+ this.setNextMarker(rawListing.getNextMarker());
+ this.setPrefix(rawListing.getPrefix());
+ this.setTruncated(rawListing.isTruncated());
+ public List<S3ObjectSummary> getObjectSummaries() {
+ return customListing;
+ public List<String> getCommonPrefixes() {
+ return customPrefixes;
@@ -0,0 +1,40 @@
+ * S3 Client factory used for testing with eventual consistency fault injection.
+public class InconsistentS3ClientFactory extends DefaultS3ClientFactory {
+ protected AmazonS3 newAmazonS3Client(AWSCredentialsProvider credentials,
+ LOG.warn("** FAILURE INJECTION ENABLED. Do not run in production! **");
+ return new InconsistentAmazonS3Client(credentials, awsConf, getConf());
@@ -22,18 +22,25 @@ import com.amazonaws.AmazonClientException;
import com.amazonaws.services.s3.model.ListObjectsRequest;
import com.amazonaws.services.s3.model.ObjectListing;
import com.amazonaws.services.s3.model.S3ObjectSummary;
+import com.google.common.annotations.VisibleForTesting;
import org.apache.hadoop.fs.FileStatus;
import org.apache.hadoop.fs.LocatedFileStatus;
import org.apache.hadoop.fs.Path;
import org.apache.hadoop.fs.PathFilter;
import org.apache.hadoop.fs.RemoteIterator;
import org.slf4j.Logger;
+import java.util.Collections;
+import java.util.Iterator;
import java.util.List;
import java.util.ListIterator;
import java.util.NoSuchElementException;
+import java.util.Set;
import static org.apache.hadoop.fs.s3a.Constants.S3N_FOLDER_SUFFIX;
import static org.apache.hadoop.fs.s3a.S3AUtils.createFileStatus;
@@ -53,6 +60,43 @@ public class Listing {
this.owner = owner;
+ * Create a FileStatus iterator against a provided list of file status, with
+ * a given status filter.
+ * @param fileStatuses the provided list of file status. NO remote calls.
+ * @param filter file path filter on which paths to accept
+ * @param acceptor the file status acceptor
+ * @return the file status iterator
+ ProvidedFileStatusIterator createProvidedFileStatusIterator(
+ FileStatus[] fileStatuses,
+ PathFilter filter,
+ FileStatusAcceptor acceptor) {
+ return new ProvidedFileStatusIterator(fileStatuses, filter, acceptor);
+ * Create a FileStatus iterator against a path, with a given list object
+ * request.
+ * @param listPath path of the listing
+ * @param request initial request to make
+ * @param filter the filter on which paths to accept
+ * @param acceptor the class/predicate to decide which entries to accept
+ * in the listing based on the full file status.
+ * @return the iterator
+ * @throws IOException IO Problems
+ FileStatusListingIterator createFileStatusListingIterator(
+ Path listPath,
+ ListObjectsRequest request,
+ Listing.FileStatusAcceptor acceptor) throws IOException {
+ return createFileStatusListingIterator(listPath, request, filter, acceptor,
+ null);
* Create a FileStatus iterator against a path, with a given
* list object request.
@@ -61,6 +105,8 @@ public class Listing {
* @param filter the filter on which paths to accept
* @param acceptor the class/predicate to decide which entries to accept
* in the listing based on the full file status.
+ * @param providedStatus the provided list of file status, which may contain
+ * items that are not listed from source.
* @return the iterator
* @throws IOException IO Problems
*/
@@ -68,11 +114,13 @@ public class Listing {
Path listPath,
ListObjectsRequest request,
PathFilter filter,
- Listing.FileStatusAcceptor acceptor) throws IOException {
+ Listing.FileStatusAcceptor acceptor,
+ RemoteIterator<FileStatus> providedStatus) throws IOException {
return new FileStatusListingIterator(
new ObjectListingIterator(listPath, request),
filter,
- acceptor);
+ acceptor,
+ providedStatus);
@@ -80,11 +128,26 @@ public class Listing {
* @param statusIterator an iterator over the remote status entries
* @return a new remote iterator
+ @VisibleForTesting
LocatedFileStatusIterator createLocatedFileStatusIterator(
RemoteIterator<FileStatus> statusIterator) {
return new LocatedFileStatusIterator(statusIterator);
+ * Create an located status iterator that wraps another to filter out a set
+ * of recently deleted items.
+ * @param iterator an iterator over the remote located status entries.
+ * @param tombstones set of paths that are recently deleted and should be
+ * filtered.
+ * @return a new remote iterator.
+ TombstoneReconcilingIterator createTombstoneReconcilingIterator(
+ RemoteIterator<LocatedFileStatus> iterator, Set<Path> tombstones) {
+ return new TombstoneReconcilingIterator(iterator, tombstones);
* Interface to implement by the logic deciding whether to accept a summary
* entry or path as a valid file or directory.
@@ -108,6 +171,13 @@ public class Listing {
* should be generated.)
boolean accept(Path keyPath, String commonPrefix);
+ * Predicate to decide whether or not to accept a file status.
+ * @param status file status containing file path information
+ * @return true if the status is accepted else false
+ boolean accept(FileStatus status);
@@ -115,9 +185,9 @@ public class Listing {
* value.
*
* If the status value is null, the iterator declares that it has no data.
- * This iterator is used to handle {@link listStatus()} calls where the path
- * handed in refers to a file, not a directory: this is the iterator
- * returned.
+ * This iterator is used to handle {@link S3AFileSystem#listStatus} calls
+ * where the path handed in refers to a file, not a directory: this is the
+ * iterator returned.
static final class SingleStatusRemoteIterator
implements RemoteIterator<LocatedFileStatus> {
@@ -168,6 +238,47 @@ public class Listing {
+ * This wraps up a provided non-null list of file status as a remote iterator.
+ * It firstly filters the provided list and later {@link #next} call will get
+ * from the filtered list. This suffers from scalability issues if the
+ * provided list is too large.
+ * There is no remote data to fetch.
+ static class ProvidedFileStatusIterator
+ implements RemoteIterator<FileStatus> {
+ private final ArrayList<FileStatus> filteredStatusList;
+ private int index = 0;
+ ProvidedFileStatusIterator(FileStatus[] fileStatuses, PathFilter filter,
+ Preconditions.checkArgument(fileStatuses != null, "Null status list!");
+ filteredStatusList = new ArrayList<>(fileStatuses.length);
+ for (FileStatus status : fileStatuses) {
+ if (filter.accept(status.getPath()) && acceptor.accept(status)) {
+ filteredStatusList.add(status);
+ filteredStatusList.trimToSize();
+ public boolean hasNext() throws IOException {
+ return index < filteredStatusList.size();
+ public FileStatus next() throws IOException {
+ if (!hasNext()) {
+ throw new NoSuchElementException();
+ return filteredStatusList.get(index++);
* Wraps up object listing into a remote iterator which will ask for more
* listing data if needed.
@@ -179,7 +290,7 @@ public class Listing {
* iterator can declare that there is more data available.
* The need to filter the results precludes the iterator from simply
- * declaring that if the {@link S3AFileSystem.ObjectListingIterator#hasNext()}
+ * declaring that if the {@link ObjectListingIterator#hasNext()}
* is true then there are more results. Instead the next batch of results must
* be retrieved and filtered.
@@ -208,20 +319,33 @@ public class Listing {
/** Iterator over the current set of results. */
private ListIterator<FileStatus> statusBatchIterator;
+ private final Set<FileStatus> providedStatus;
+ private Iterator<FileStatus> providedStatusIterator;
* Create an iterator over file status entries.
* @param source the listing iterator from a listObjects call.
FileStatusListingIterator(ObjectListingIterator source,
- FileStatusAcceptor acceptor) throws IOException {
+ FileStatusAcceptor acceptor,
this.source = source;
this.filter = filter;
this.acceptor = acceptor;
+ this.providedStatus = new HashSet<>();
+ for (; providedStatus != null && providedStatus.hasNext();) {
+ final FileStatus status = providedStatus.next();
+ this.providedStatus.add(status);
// build the first set of results. This will not trigger any
// remote IO, assuming the source iterator is in its initial
// iteration
@@ -233,26 +357,53 @@ public class Listing {
* If there is data in the local filtered list, return true.
* Else: request more data util that condition is met, or there
* is no more remote listing data.
+ * Lastly, return true if the {@code providedStatusIterator}
+ * has left items.
* @return true if a call to {@link #next()} will succeed.
* @throws IOException
@Override
public boolean hasNext() throws IOException {
- return statusBatchIterator.hasNext() || requestNextBatch();
+ return sourceHasNext() || providedStatusIterator.hasNext();
+ private boolean sourceHasNext() throws IOException {
+ if (statusBatchIterator.hasNext() || requestNextBatch()) {
+ // turn to file status that are only in provided list
+ if (providedStatusIterator == null) {
+ LOG.debug("Start iterating the provided status.");
+ providedStatusIterator = providedStatus.iterator();
public FileStatus next() throws IOException {
- if (!hasNext()) {
- throw new NoSuchElementException();
+ final FileStatus status;
+ if (sourceHasNext()) {
+ status = statusBatchIterator.next();
+ // We remove from provided list the file status listed by S3 so that
+ // this does not return duplicate items.
+ LOG.debug("Removing the status from provided file status {}", status);
+ providedStatus.remove(status);
+ if (providedStatusIterator.hasNext()) {
+ status = providedStatusIterator.next();
+ LOG.debug("Returning provided file status {}", status);
- return statusBatchIterator.next();
+ return status;
* Try to retrieve another batch.
* Note that for the initial batch,
- * {@link S3AFileSystem.ObjectListingIterator} does not generate a request;
+ * {@link ObjectListingIterator} does not generate a request;
* it simply returns the initial set.
* @return true if a new batch was created.
@@ -312,7 +463,7 @@ public class Listing {
for (String prefix : objects.getCommonPrefixes()) {
Path keyPath = owner.keyToQualifiedPath(prefix);
if (acceptor.accept(keyPath, prefix) && filter.accept(keyPath)) {
- FileStatus status = new S3AFileStatus(false, keyPath,
+ FileStatus status = new S3AFileStatus(Tristate.FALSE, keyPath,
owner.getUsername());
LOG.debug("Adding directory: {}", status);
added++;
@@ -352,7 +503,7 @@ public class Listing {
* instance.
* 2. Second and later invocations will continue the ongoing listing,
- * calling {@link #continueListObjects(ObjectListing)} to request the next
+ * calling {@link S3AFileSystem#continueListObjects} to request the next
* batch of results.
* 3. The {@link #hasNext()} predicate returns true for the initial call,
@@ -504,6 +655,11 @@ public class Listing {
public boolean accept(Path keyPath, String prefix) {
return false;
+ public boolean accept(FileStatus status) {
+ return (status != null) && status.isFile();
@@ -533,6 +689,80 @@ public class Listing {
+ * Wraps another iterator and filters out files that appear in the provided
+ * set of tombstones. Will read ahead in the iterator when necessary to
+ * ensure that emptiness is detected early enough if only deleted objects
+ * remain in the source iterator.
+ static class TombstoneReconcilingIterator implements
+ RemoteIterator<LocatedFileStatus> {
+ private LocatedFileStatus next = null;
+ private final RemoteIterator<LocatedFileStatus> iterator;
+ private final Set<Path> tombstones;
+ * @param iterator Source iterator to filter
+ * @param tombstones set of tombstone markers to filter out of results
+ TombstoneReconcilingIterator(RemoteIterator<LocatedFileStatus>
+ iterator, Set<Path> tombstones) {
+ this.iterator = iterator;
+ if (tombstones != null) {
+ this.tombstones = tombstones;
+ this.tombstones = Collections.EMPTY_SET;
+ private boolean fetch() throws IOException {
+ while (next == null && iterator.hasNext()) {
+ LocatedFileStatus candidate = iterator.next();
+ if (!tombstones.contains(candidate.getPath())) {
+ next = candidate;
+ if (next != null) {
+ return fetch();
+ public LocatedFileStatus next() throws IOException {
+ if (hasNext()) {
+ LocatedFileStatus result = next;
+ next = null;
+ fetch();
+ return result;
+ * Accept all entries except those which map to S3N pseudo directory markers.
+ static class AcceptAllButS3nDirs implements FileStatusAcceptor {
+ public boolean accept(Path keyPath, S3ObjectSummary summary) {
+ return !summary.getKey().endsWith(S3N_FOLDER_SUFFIX);
+ public boolean accept(Path keyPath, String prefix) {
+ return !keyPath.toString().endsWith(S3N_FOLDER_SUFFIX);
+ return !status.getPath().toString().endsWith(S3N_FOLDER_SUFFIX);
* Accept all entries except the base path and those which map to S3N
* pseudo directory markers.
@@ -575,6 +805,11 @@ public class Listing {
return !keyPath.equals(qualifiedPath);
+ return (status != null) && !status.getPath().equals(qualifiedPath);
@@ -79,6 +79,9 @@ class S3ABlockOutputStream extends OutputStream {
/** Size of all blocks. */
private final int blockSize;
+ /** Total bytes for uploads submitted so far. */
+ private long bytesSubmitted;
/** Callback for progress. */
private final ProgressListener progressListener;
private final ListeningExecutorService executorService;
@@ -302,6 +305,7 @@ class S3ABlockOutputStream extends OutputStream {
try {
multiPartUpload.uploadBlockAsync(getActiveBlock());
+ bytesSubmitted += getActiveBlock().dataSize();
} finally {
// set the block to null, so the next write will create a new block.
clearActiveBlock();
@@ -330,13 +334,14 @@ class S3ABlockOutputStream extends OutputStream {
this,
blockCount,
hasBlock ? block : "(none)");
+ long bytes = 0;
if (multiPartUpload == null) {
if (hasBlock) {
// no uploads of data have taken place, put the single block up.
// This must happen even if there is no data, so that 0 byte files
// are created.
- putObject();
+ bytes = putObject();
} else {
// there has already been at least one block scheduled for upload;
@@ -350,6 +355,7 @@ class S3ABlockOutputStream extends OutputStream {
multiPartUpload.waitForAllPartUploads();
// then complete the operation
multiPartUpload.complete(partETags);
+ bytes = bytesSubmitted;
LOG.debug("Upload complete for {}", writeOperationHelper);
} catch (IOException ioe) {
@@ -362,7 +368,7 @@ class S3ABlockOutputStream extends OutputStream {
// All end of write operations, including deleting fake parent directories
- writeOperationHelper.writeSuccessful();
+ writeOperationHelper.writeSuccessful(bytes);
@@ -370,8 +376,11 @@ class S3ABlockOutputStream extends OutputStream {
* is empty a 0-byte PUT will be invoked, as it is needed to create an
* entry at the far end.
* @throws IOException any problem.
+ * @return number of bytes uploaded. If thread was interrupted while
+ * waiting for upload to complete, returns zero with interrupted flag set
+ * on this thread.
- private void putObject() throws IOException {
+ private int putObject() throws IOException {
LOG.debug("Executing regular upload for {}", writeOperationHelper);
final S3ADataBlocks.DataBlock block = getActiveBlock();
@@ -405,9 +414,11 @@ class S3ABlockOutputStream extends OutputStream {
//wait for completion
putObjectResult.get();
+ return size;
} catch (InterruptedException ie) {
LOG.warn("Interrupted object upload", ie);
Thread.currentThread().interrupt();
+ return 0;
} catch (ExecutionException ee) {
throw extractException("regular upload", key, ee);
@@ -31,7 +31,7 @@ import org.apache.hadoop.fs.Path;
@InterfaceStability.Evolving
public class S3AFileStatus extends FileStatus {
- private boolean isEmptyDirectory;
+ private Tristate isEmptyDirectory;
* Create a directory status.
@@ -42,6 +42,18 @@ public class S3AFileStatus extends FileStatus {
public S3AFileStatus(boolean isemptydir,
Path path,
String owner) {
+ this(Tristate.fromBool(isemptydir), path, owner);
+ * Create a directory status.
+ * @param isemptydir is this an empty directory?
+ * @param path the path
+ * @param owner the owner
+ public S3AFileStatus(Tristate isemptydir,
+ Path path,
+ String owner) {
super(0, true, 1, 0, 0, path);
isEmptyDirectory = isemptydir;
setOwner(owner);
@@ -59,12 +71,37 @@ public class S3AFileStatus extends FileStatus {
public S3AFileStatus(long length, long modification_time, Path path,
long blockSize, String owner) {
super(length, false, 1, blockSize, modification_time, path);
- isEmptyDirectory = false;
+ isEmptyDirectory = Tristate.FALSE;
setGroup(owner);
- public boolean isEmptyDirectory() {
+ * Convenience constructor for creating from a vanilla FileStatus plus
+ * an isEmptyDirectory flag.
+ * @param source FileStatus to convert to S3AFileStatus
+ * @param isEmptyDirectory TRUE/FALSE if known to be / not be an empty
+ * directory, UNKNOWN if that information was not computed.
+ * @return a new S3AFileStatus
+ public static S3AFileStatus fromFileStatus(FileStatus source,
+ Tristate isEmptyDirectory) {
+ if (source.isDirectory()) {
+ return new S3AFileStatus(isEmptyDirectory, source.getPath(),
+ source.getOwner());
+ return new S3AFileStatus(source.getLen(), source.getModificationTime(),
+ source.getPath(), source.getBlockSize(), source.getOwner());
+ * @return FALSE if status is not a directory, or its a dir, but known to
+ * not be empty. TRUE if it is an empty directory. UNKNOWN if it is a
+ * directory, but we have not computed whether or not it is empty.
+ public Tristate isEmptyDirectory() {
return isEmptyDirectory;
@@ -110,7 +147,7 @@ public class S3AFileStatus extends FileStatus {
public String toString() {
return super.toString() +
- String.format(" isEmptyDirectory=%s", isEmptyDirectory());
+ String.format(" isEmptyDirectory=%s", isEmptyDirectory().name());
@@ -23,6 +23,7 @@ import org.slf4j.LoggerFactory;
import org.apache.hadoop.classification.InterfaceAudience;
import org.apache.hadoop.classification.InterfaceStability;
+import org.apache.hadoop.fs.FileSystem.Statistics;
import org.apache.hadoop.metrics2.MetricStringBuilder;
import org.apache.hadoop.metrics2.annotation.Metrics;
import org.apache.hadoop.metrics2.lib.Interns;
@@ -30,6 +31,7 @@ import org.apache.hadoop.metrics2.lib.MetricsRegistry;
import org.apache.hadoop.metrics2.lib.MutableCounterLong;
import org.apache.hadoop.metrics2.lib.MutableGaugeLong;
import org.apache.hadoop.metrics2.lib.MutableMetric;
+import org.apache.hadoop.metrics2.lib.MutableQuantiles;
import java.io.Closeable;
@@ -38,7 +40,6 @@ import java.util.Map;
import java.util.UUID;
import java.util.concurrent.atomic.AtomicInteger;
import java.util.concurrent.atomic.AtomicLong;
-import org.apache.hadoop.fs.FileSystem.Statistics;
import static org.apache.hadoop.fs.s3a.Statistic.*;
@@ -90,6 +91,10 @@ public class S3AInstrumentation {
private final Map<String, MutableCounterLong> streamMetrics =
new HashMap<>(30);
+ /** Instantiate this without caring whether or not S3Guard is enabled. */
+ private final S3GuardInstrumentation s3GuardInstrumentation
+ = new S3GuardInstrumentation();
private static final Statistic[] COUNTERS_TO_CREATE = {
INVOCATION_COPY_FROM_LOCAL_FILE,
INVOCATION_EXISTS,
@@ -117,6 +122,8 @@ public class S3AInstrumentation {
STREAM_WRITE_BLOCK_UPLOADS_ABORTED,
STREAM_WRITE_TOTAL_TIME,
STREAM_WRITE_TOTAL_DATA,
+ S3GUARD_METADATASTORE_PUT_PATH_REQUEST,
+ S3GUARD_METADATASTORE_INITIALIZATION
};
@@ -171,6 +178,9 @@ public class S3AInstrumentation {
for (Statistic statistic : GAUGES_TO_CREATE) {
gauge(statistic.getSymbol(), statistic.getDescription());
+ //todo need a config for the quantiles interval?
+ quantiles(S3GUARD_METADATASTORE_PUT_PATH_LATENCY,
+ "ops", "latency", 1);
@@ -226,6 +236,22 @@ public class S3AInstrumentation {
return registry.newGauge(name, desc, 0L);
+ * Create a quantiles in the registry.
+ * @param op statistic to collect
+ * @param sampleName sample name of the quantiles
+ * @param valueName value name of the quantiles
+ * @param interval interval of the quantiles in seconds
+ * @return the created quantiles metric
+ protected final MutableQuantiles quantiles(Statistic op,
+ String sampleName,
+ String valueName,
+ int interval) {
+ return registry.newQuantiles(op.getSymbol(), op.getDescription(),
+ sampleName, valueName, interval);
* Get the metrics registry.
* @return the registry
@@ -310,6 +336,20 @@ public class S3AInstrumentation {
return (MutableGaugeLong) metric;
+ * Look up a quantiles.
+ * @param name quantiles name
+ * @return the quantiles or null
+ * @throws ClassCastException if the metric is not a Quantiles.
+ public MutableQuantiles lookupQuantiles(String name) {
+ MutableMetric metric = lookupMetric(name);
+ if (metric == null) {
+ LOG.debug("No quantiles {}", name);
+ return (MutableQuantiles) metric;
* Look up a metric from both the registered set and the lighter weight
* stream entries.
@@ -391,6 +431,21 @@ public class S3AInstrumentation {
counter.incr(count);
+ * Add a value to a quantiles statistic. No-op if the quantile
+ * isn't found.
+ * @param op operation to look up.
+ * @param value value to add.
+ public void addValueToQuantiles(Statistic op, long value) {
+ MutableQuantiles quantiles = lookupQuantiles(op.getSymbol());
+ if (quantiles != null) {
+ quantiles.add(value);
* Increment a specific counter.
* No-op if not defined.
@@ -441,6 +496,15 @@ public class S3AInstrumentation {
return new InputStreamStatistics();
+ * Create a S3Guard instrumentation instance.
+ * There's likely to be at most one instance of this per FS instance.
+ * @return the S3Guard instrumentation point.
+ public S3GuardInstrumentation getS3GuardInstrumentation() {
+ return s3GuardInstrumentation;
* Merge in the statistics of a single input stream into
* the filesystem-wide statistics.
@@ -840,4 +904,19 @@ public class S3AInstrumentation {
return sb.toString();
+ * Instrumentation exported to S3Guard.
+ public final class S3GuardInstrumentation {
+ /** Initialized event. */
+ public void initialized() {
+ incrementCounter(S3GUARD_METADATASTORE_INITIALIZATION, 1);
+ public void storeClosed() {
@@ -20,7 +20,6 @@ package org.apache.hadoop.fs.s3a;
import com.amazonaws.AmazonClientException;
import com.amazonaws.services.s3.model.ObjectMetadata;
-import com.amazonaws.services.s3.transfer.Upload;
import org.apache.hadoop.conf.Configuration;
@@ -101,19 +100,20 @@ public class S3AOutputStream extends OutputStream {
final ObjectMetadata om = fs.newObjectMetadata(backupFile.length());
- Upload upload = fs.putObject(
+ UploadInfo info = fs.putObject(
fs.newPutObjectRequest(
key,
om,
backupFile));
ProgressableProgressListener listener =
- new ProgressableProgressListener(fs, key, upload, progress);
- upload.addProgressListener(listener);
+ new ProgressableProgressListener(fs, key, info.getUpload(), progress);
+ info.getUpload().addProgressListener(listener);
- upload.waitForUploadResult();
+ info.getUpload().waitForUploadResult();
listener.uploadCompleted();
- // This will delete unnecessary fake parent directories
- fs.finishedWrite(key);
+ // This will delete unnecessary fake parent directories, update any
+ // MetadataStore
+ fs.finishedWrite(key, info.getLength());
} catch (InterruptedException e) {
throw (InterruptedIOException) new InterruptedIOException(e.toString())
.initCause(e);
@@ -294,12 +294,38 @@ public final class S3AUtils {
S3ObjectSummary summary,
long blockSize,
- if (objectRepresentsDirectory(summary.getKey(), summary.getSize())) {
- return new S3AFileStatus(true, keyPath, owner);
+ long size = summary.getSize();
+ return createFileStatus(keyPath,
+ objectRepresentsDirectory(summary.getKey(), size),
+ size, summary.getLastModified(), blockSize, owner);
+ * Create a file status for object we just uploaded. For files, we use
+ * current time as modification time, since s3a uses S3's service-based
+ * modification time, which will not be available until we do a
+ * getFileStatus() later on.
+ * @param keyPath path for created object
+ * @param isDir true iff directory
+ * @param size file length
+ * @param blockSize block size for file status
+ * @param owner Hadoop username
+ * @return a status entry
+ public static S3AFileStatus createUploadFileStatus(Path keyPath,
+ boolean isDir, long size, long blockSize, String owner) {
+ Date date = isDir ? null : new Date();
+ return createFileStatus(keyPath, isDir, size, date, blockSize, owner);
+ /* Date 'modified' is ignored when isDir is true. */
+ private static S3AFileStatus createFileStatus(Path keyPath, boolean isDir,
+ long size, Date modified, long blockSize, String owner) {
+ if (isDir) {
+ return new S3AFileStatus(Tristate.UNKNOWN, keyPath, owner);
- return new S3AFileStatus(summary.getSize(),
- dateToLong(summary.getLastModified()), keyPath,
- blockSize, owner);
+ return new S3AFileStatus(size, dateToLong(modified), keyPath, blockSize,
+ owner);
@@ -18,33 +18,20 @@
package org.apache.hadoop.fs.s3a;
-import static org.apache.hadoop.fs.s3a.Constants.*;
-import static org.apache.hadoop.fs.s3a.S3AUtils.*;
-
-import com.amazonaws.ClientConfiguration;
-import com.amazonaws.Protocol;
-import com.amazonaws.auth.AWSCredentialsProvider;
import com.amazonaws.services.s3.AmazonS3;
-import com.amazonaws.services.s3.AmazonS3Client;
-import com.amazonaws.services.s3.S3ClientOptions;
-import org.apache.hadoop.conf.Configuration;
-import org.apache.hadoop.conf.Configured;
-import org.apache.hadoop.util.VersionInfo;
-import org.slf4j.Logger;
- * Factory for creation of S3 client instances to be used by {@link S3Store}.
+ * Factory for creation of {@link AmazonS3} client instances.
-interface S3ClientFactory {
+public interface S3ClientFactory {
* Creates a new {@link AmazonS3} client. This method accepts the S3A file
@@ -57,182 +44,4 @@ interface S3ClientFactory {
AmazonS3 createS3Client(URI name) throws IOException;
- /**
- * The default factory implementation, which calls the AWS SDK to configure
- * and create an {@link AmazonS3Client} that communicates with the S3 service.
- */
- static class DefaultS3ClientFactory extends Configured
- implements S3ClientFactory {
- private static final Logger LOG = S3AFileSystem.LOG;
- @Override
- public AmazonS3 createS3Client(URI name) throws IOException {
- Configuration conf = getConf();
- AWSCredentialsProvider credentials =
- createAWSCredentialProviderSet(name, conf);
- ClientConfiguration awsConf = new ClientConfiguration();
- initConnectionSettings(conf, awsConf);
- initProxySupport(conf, awsConf);
- initUserAgent(conf, awsConf);
- return createAmazonS3Client(conf, credentials, awsConf);
- }
- * Initializes all AWS SDK settings related to connection management.
- *
- * @param conf Hadoop configuration
- * @param awsConf AWS SDK configuration
- private static void initConnectionSettings(Configuration conf,
- ClientConfiguration awsConf) {
- awsConf.setMaxConnections(intOption(conf, MAXIMUM_CONNECTIONS,
- DEFAULT_MAXIMUM_CONNECTIONS, 1));
- boolean secureConnections = conf.getBoolean(SECURE_CONNECTIONS,
- DEFAULT_SECURE_CONNECTIONS);
- awsConf.setProtocol(secureConnections ? Protocol.HTTPS : Protocol.HTTP);
- awsConf.setMaxErrorRetry(intOption(conf, MAX_ERROR_RETRIES,
- DEFAULT_MAX_ERROR_RETRIES, 0));
- awsConf.setConnectionTimeout(intOption(conf, ESTABLISH_TIMEOUT,
- DEFAULT_ESTABLISH_TIMEOUT, 0));
- awsConf.setSocketTimeout(intOption(conf, SOCKET_TIMEOUT,
- DEFAULT_SOCKET_TIMEOUT, 0));
- int sockSendBuffer = intOption(conf, SOCKET_SEND_BUFFER,
- DEFAULT_SOCKET_SEND_BUFFER, 2048);
- int sockRecvBuffer = intOption(conf, SOCKET_RECV_BUFFER,
- DEFAULT_SOCKET_RECV_BUFFER, 2048);
- awsConf.setSocketBufferSizeHints(sockSendBuffer, sockRecvBuffer);
- String signerOverride = conf.getTrimmed(SIGNING_ALGORITHM, "");
- if (!signerOverride.isEmpty()) {
- LOG.debug("Signer override = {}", signerOverride);
- awsConf.setSignerOverride(signerOverride);
- * Initializes AWS SDK proxy support if configured.
- * @throws IllegalArgumentException if misconfigured
- private static void initProxySupport(Configuration conf,
- ClientConfiguration awsConf)
- throws IllegalArgumentException, IOException {
- String proxyHost = conf.getTrimmed(PROXY_HOST, "");
- int proxyPort = conf.getInt(PROXY_PORT, -1);
- if (!proxyHost.isEmpty()) {
- awsConf.setProxyHost(proxyHost);
- if (proxyPort >= 0) {
- awsConf.setProxyPort(proxyPort);
- } else {
- if (conf.getBoolean(SECURE_CONNECTIONS, DEFAULT_SECURE_CONNECTIONS)) {
- LOG.warn("Proxy host set without port. Using HTTPS default 443");
- awsConf.setProxyPort(443);
- LOG.warn("Proxy host set without port. Using HTTP default 80");
- awsConf.setProxyPort(80);
- String proxyUsername = conf.getTrimmed(PROXY_USERNAME);
- String proxyPassword = null;
- char[] proxyPass = conf.getPassword(PROXY_PASSWORD);
- if (proxyPass != null) {
- proxyPassword = new String(proxyPass).trim();
- if ((proxyUsername == null) != (proxyPassword == null)) {
- String msg = "Proxy error: " + PROXY_USERNAME + " or " +
- PROXY_PASSWORD + " set without the other.";
- LOG.error(msg);
- throw new IllegalArgumentException(msg);
- awsConf.setProxyUsername(proxyUsername);
- awsConf.setProxyPassword(proxyPassword);
- awsConf.setProxyDomain(conf.getTrimmed(PROXY_DOMAIN));
- awsConf.setProxyWorkstation(conf.getTrimmed(PROXY_WORKSTATION));
- if (LOG.isDebugEnabled()) {
- LOG.debug("Using proxy server {}:{} as user {} on " +
- "domain {} as workstation {}", awsConf.getProxyHost(),
- awsConf.getProxyPort(),
- String.valueOf(awsConf.getProxyUsername()),
- awsConf.getProxyDomain(),
- awsConf.getProxyWorkstation());
- } else if (proxyPort >= 0) {
- String msg =
- "Proxy error: " + PROXY_PORT + " set without " + PROXY_HOST;
- * Initializes the User-Agent header to send in HTTP requests to the S3
- * back-end. We always include the Hadoop version number. The user also
- * may set an optional custom prefix to put in front of the Hadoop version
- * number. The AWS SDK interally appends its own information, which seems
- * to include the AWS SDK version, OS and JVM version.
- private static void initUserAgent(Configuration conf,
- String userAgent = "Hadoop " + VersionInfo.getVersion();
- String userAgentPrefix = conf.getTrimmed(USER_AGENT_PREFIX, "");
- if (!userAgentPrefix.isEmpty()) {
- userAgent = userAgentPrefix + ", " + userAgent;
- LOG.debug("Using User-Agent: {}", userAgent);
- awsConf.setUserAgentPrefix(userAgent);
- * Creates an {@link AmazonS3Client} from the established configuration.
- * @param credentials AWS credentials
- * @return S3 client
- private static AmazonS3 createAmazonS3Client(Configuration conf,
- AWSCredentialsProvider credentials, ClientConfiguration awsConf)
- throws IllegalArgumentException {
- AmazonS3 s3 = new AmazonS3Client(credentials, awsConf);
- String endPoint = conf.getTrimmed(ENDPOINT, "");
- if (!endPoint.isEmpty()) {
- try {
- s3.setEndpoint(endPoint);
- } catch (IllegalArgumentException e) {
- String msg = "Incorrect endpoint: " + e.getMessage();
- throw new IllegalArgumentException(msg, e);
- enablePathStyleAccessIfRequired(s3, conf);
- return s3;
- * Enables path-style access to S3 buckets if configured. By default, the
- * behavior is to use virtual hosted-style access with URIs of the form
- * http://bucketname.s3.amazonaws.com. Enabling path-style access and a
- * region-specific endpoint switches the behavior to use URIs of the form
- * http://s3-eu-west-1.amazonaws.com/bucketname.
- * @param s3 S3 client
- private static void enablePathStyleAccessIfRequired(AmazonS3 s3,
- Configuration conf) {
- final boolean pathStyleAccess = conf.getBoolean(PATH_STYLE_ACCESS, false);
- if (pathStyleAccess) {
- LOG.debug("Enabling path style access!");
- s3.setS3ClientOptions(S3ClientOptions.builder()
- .setPathStyleAccess(true)
- .build());
@@ -140,7 +140,18 @@ public enum Statistic {
STREAM_WRITE_TOTAL_DATA("stream_write_total_data",
"Count of total data uploaded in block output"),
STREAM_WRITE_QUEUE_DURATION("stream_write_queue_duration",
- "Total queue duration of all block uploads");
+ "Total queue duration of all block uploads"),
+ // S3Guard stats
+ S3GUARD_METADATASTORE_PUT_PATH_REQUEST(
+ "s3guard_metadatastore_put_path_request",
+ "s3guard metadata store put one metadata path request"),
+ S3GUARD_METADATASTORE_PUT_PATH_LATENCY(
+ "s3guard_metadatastore_put_path_latency",
+ "s3guard metadata store put one metadata path lantency"),
+ S3GUARD_METADATASTORE_INITIALIZATION("s3guard_metadatastore_initialization",
+ "s3guard metadata store initialization times");
private static final Map<String, Statistic> SYMBOL_MAP =
new HashMap<>(Statistic.values().length);
@@ -0,0 +1,32 @@
+ * Simple enum to express {true, false, don't know}.
+public enum Tristate {
+ // Do not add additional values here. Logic will assume there are exactly
+ // three possibilities.
+ TRUE, FALSE, UNKNOWN;
+ public static Tristate fromBool(boolean v) {
+ return v ? TRUE : FALSE;
@@ -0,0 +1,43 @@
+import com.amazonaws.services.s3.transfer.Upload;
+ * Simple struct that contains information about a S3 upload.
+public class UploadInfo {
+ private final Upload upload;
+ private final long length;
+ public UploadInfo(Upload upload, long length) {
+ this.upload = upload;
+ this.length = length;
+ public Upload getUpload() {
+ return upload;
+ public long getLength() {
+ return length;
@@ -0,0 +1,142 @@
+package org.apache.hadoop.fs.s3a.s3guard;
+import java.util.Collection;
+import java.util.LinkedList;
+import java.util.NoSuchElementException;
+import java.util.Queue;
+import org.apache.hadoop.fs.FileStatus;
+import org.apache.hadoop.fs.RemoteIterator;
+ * {@code DescendantsIterator} is a {@link RemoteIterator} that implements
+ * pre-ordering breadth-first traversal (BFS) of a path and all of its
+ * descendants recursively. After visiting each path, that path's direct
+ * children are discovered by calling {@link MetadataStore#listChildren(Path)}.
+ * Each iteration returns the next direct child, and if that child is a
+ * directory, also pushes it onto a queue to discover its children later.
+ * For example, assume the consistent store contains metadata representing this
+ * file system structure:
+ * <pre>
+ * /dir1
+ * |-- dir2
+ * | |-- file1
+ * | `-- file2
+ * `-- dir3
+ * |-- dir4
+ * | `-- file3
+ * |-- dir5
+ * | `-- file4
+ * `-- dir6
+ * </pre>
+ * Consider this code sample:
+ * final PathMetadata dir1 = get(new Path("/dir1"));
+ * for (DescendantsIterator descendants = new DescendantsIterator(dir1);
+ * descendants.hasNext(); ) {
+ * final FileStatus status = descendants.next().getFileStatus();
+ * System.out.printf("%s %s%n", status.isDirectory() ? 'D' : 'F',
+ * status.getPath());
+ * }
+ * The output is:
+ * D /dir1
+ * D /dir1/dir2
+ * D /dir1/dir3
+ * F /dir1/dir2/file1
+ * F /dir1/dir2/file2
+ * D /dir1/dir3/dir4
+ * D /dir1/dir3/dir5
+ * F /dir1/dir3/dir4/file3
+ * F /dir1/dir3/dir5/file4
+ * D /dir1/dir3/dir6
+@InterfaceStability.Evolving
+public class DescendantsIterator implements RemoteIterator<FileStatus> {
+ private final MetadataStore metadataStore;
+ private final Queue<PathMetadata> queue = new LinkedList<>();
+ * Creates a new {@code DescendantsIterator}.
+ * @param ms the associated {@link MetadataStore}
+ * @param meta base path for descendants iteration, which will be the first
+ * returned during iteration (except root). Null makes empty iterator.
+ * @throws IOException if errors happen during metadata store listing
+ public DescendantsIterator(MetadataStore ms, PathMetadata meta)
+ Preconditions.checkNotNull(ms);
+ this.metadataStore = ms;
+ if (meta != null) {
+ final Path path = meta.getFileStatus().getPath();
+ if (path.isRoot()) {
+ DirListingMetadata rootListing = ms.listChildren(path);
+ if (rootListing != null) {
+ rootListing = rootListing.withoutTombstones();
+ queue.addAll(rootListing.getListing());
+ queue.add(meta);
+ return !queue.isEmpty();
+ throw new NoSuchElementException("No more descendants.");
+ PathMetadata next;
+ next = queue.poll();
+ if (next.getFileStatus().isDirectory()) {
+ final Path path = next.getFileStatus().getPath();
+ DirListingMetadata meta = metadataStore.listChildren(path);
+ Collection<PathMetadata> more = meta.withoutTombstones().getListing();
+ if (!more.isEmpty()) {
+ queue.addAll(more);
+ return next.getFileStatus();
@@ -0,0 +1,322 @@
+import java.net.URISyntaxException;
+import java.util.concurrent.ConcurrentHashMap;
+import org.apache.hadoop.fs.s3a.Tristate;
+ * {@code DirListingMetadata} models a directory listing stored in a
+ * {@link MetadataStore}. Instances of this class are mutable and thread-safe.
+public class DirListingMetadata {
+ * Convenience parameter for passing into constructor.
+ public static final Collection<PathMetadata> EMPTY_DIR =
+ Collections.emptyList();
+ private final Path path;
+ /** Using a map for fast find / remove with large directories. */
+ private Map<Path, PathMetadata> listMap = new ConcurrentHashMap<>();
+ private boolean isAuthoritative;
+ * Create a directory listing metadata container.
+ * @param path Path of the directory. If this path has a host component, then
+ * all paths added later via {@link #put(FileStatus)} must also have
+ * the same host.
+ * @param listing Entries in the directory.
+ * @param isAuthoritative true iff listing is the full contents of the
+ * directory, and the calling client reports that this may be cached as
+ * the full and authoritative listing of all files in the directory.
+ public DirListingMetadata(Path path, Collection<PathMetadata> listing,
+ boolean isAuthoritative) {
+ checkPathAbsolute(path);
+ this.path = path;
+ if (listing != null) {
+ for (PathMetadata entry : listing) {
+ Path childPath = entry.getFileStatus().getPath();
+ checkChildPath(childPath);
+ listMap.put(childPath, entry);
+ this.isAuthoritative = isAuthoritative;
+ * Copy constructor.
+ * @param d the existing {@link DirListingMetadata} object.
+ public DirListingMetadata(DirListingMetadata d) {
+ path = d.path;
+ isAuthoritative = d.isAuthoritative;
+ listMap = new ConcurrentHashMap<>(d.listMap);
+ * @return {@code Path} of the directory that contains this listing.
+ public Path getPath() {
+ return path;
+ * @return entries in the directory
+ public Collection<PathMetadata> getListing() {
+ return Collections.unmodifiableCollection(listMap.values());
+ public Set<Path> listTombstones() {
+ Set<Path> tombstones = new HashSet<>();
+ for (PathMetadata meta : listMap.values()) {
+ if (meta.isDeleted()) {
+ tombstones.add(meta.getFileStatus().getPath());
+ return tombstones;
+ public DirListingMetadata withoutTombstones() {
+ Collection<PathMetadata> filteredList = new ArrayList<>();
+ if (!meta.isDeleted()) {
+ filteredList.add(meta);
+ return new DirListingMetadata(path, filteredList, isAuthoritative);
+ * @return number of entries tracked. This is not the same as the number
+ * of entries in the actual directory unless {@link #isAuthoritative()} is
+ * true.
+ public int numEntries() {
+ return listMap.size();
+ * @return true iff this directory listing is full and authoritative within
+ * the scope of the {@code MetadataStore} that returned it.
+ public boolean isAuthoritative() {
+ return isAuthoritative;
+ * Is the underlying directory known to be empty?
+ * @return FALSE if directory is known to have a child entry, TRUE if
+ * directory is known to be empty, UNKNOWN otherwise.
+ public Tristate isEmpty() {
+ if (getListing().isEmpty()) {
+ if (isAuthoritative()) {
+ return Tristate.TRUE;
+ // This listing is empty, but may not be full list of underlying dir.
+ return Tristate.UNKNOWN;
+ } else { // not empty listing
+ // There exists at least one child, dir not empty.
+ return Tristate.FALSE;
+ * Marks this directory listing as full and authoritative.
+ * @param authoritative see {@link #isAuthoritative()}.
+ public void setAuthoritative(boolean authoritative) {
+ this.isAuthoritative = authoritative;
+ * Lookup entry within this directory listing. This may return null if the
+ * {@code MetadataStore} only tracks a partial set of the directory entries.
+ * In the case where {@link #isAuthoritative()} is true, however, this
+ * function returns null iff the directory is known not to contain the listing
+ * at given path (within the scope of the {@code MetadataStore} that returned
+ * it).
+ * @param childPath path of entry to look for.
+ * @return entry, or null if it is not present or not being tracked.
+ public PathMetadata get(Path childPath) {
+ return listMap.get(childPath);
+ * Replace an entry with a tombstone.
+ * @param childPath path of entry to replace.
+ public void markDeleted(Path childPath) {
+ listMap.put(childPath, PathMetadata.tombstone(childPath));
+ * Remove entry from this directory.
+ * @param childPath path of entry to remove.
+ public void remove(Path childPath) {
+ listMap.remove(childPath);
+ * Add an entry to the directory listing. If this listing already contains a
+ * {@code FileStatus} with the same path, it will be replaced.
+ * @param childFileStatus entry to add to this directory listing.
+ * @return true if the status was added or replaced with a new value. False
+ * if the same FileStatus value was already present.
+ public boolean put(FileStatus childFileStatus) {
+ Preconditions.checkNotNull(childFileStatus,
+ "childFileStatus must be non-null");
+ Path childPath = childStatusToPathKey(childFileStatus);
+ PathMetadata newValue = new PathMetadata(childFileStatus);
+ PathMetadata oldValue = listMap.put(childPath, newValue);
+ return oldValue == null || !oldValue.equals(newValue);
+ public String toString() {
+ return "DirListingMetadata{" +
+ "path=" + path +
+ ", listMap=" + listMap +
+ ", isAuthoritative=" + isAuthoritative +
+ '}';
+ * Log contents to supplied StringBuilder in a pretty fashion.
+ * @param sb target StringBuilder
+ public void prettyPrint(StringBuilder sb) {
+ sb.append(String.format("DirMeta %-20s %-18s",
+ path.toString(),
+ isAuthoritative ? "Authoritative" : "Not Authoritative"));
+ for (Map.Entry<Path, PathMetadata> entry : listMap.entrySet()) {
+ sb.append("\n key: ").append(entry.getKey()).append(": ");
+ entry.getValue().prettyPrint(sb);
+ sb.append("\n");
+ public String prettyPrint() {
+ StringBuilder sb = new StringBuilder();
+ prettyPrint(sb);
+ return sb.toString();
+ * Checks that child path is valid.
+ * @param childPath path to check.
+ private void checkChildPath(Path childPath) {
+ checkPathAbsolute(childPath);
+ // If this dir's path has host (and thus scheme), so must its children
+ URI parentUri = path.toUri();
+ if (parentUri.getHost() != null) {
+ URI childUri = childPath.toUri();
+ Preconditions.checkNotNull(childUri.getHost(), "Expected non-null URI " +
+ "host: %s", childUri);
+ Preconditions.checkArgument(
+ childUri.getHost().equals(parentUri.getHost()),
+ "childUri %s and parentUri %s must have the same host",
+ childUri, parentUri);
+ Preconditions.checkNotNull(childUri.getScheme(), "No scheme in path %s",
+ childUri);
+ Preconditions.checkArgument(!childPath.isRoot(),
+ "childPath cannot be the root path: %s", childPath);
+ Preconditions.checkArgument(childPath.getParent().equals(path),
+ "childPath %s must be a child of %s", childPath, path);
+ * For Paths that are handed in directly, we assert they are in consistent
+ * format with checkPath(). For paths that are supplied embedded in
+ * FileStatus, we attempt to fill in missing scheme and host, when this
+ * DirListingMetadata is associated with one.
+ * @return Path suitable for consistent hashtable lookups
+ * @throws NullPointerException null status argument
+ * @throws IllegalArgumentException bad status values or failure to
+ * create a URI.
+ private Path childStatusToPathKey(FileStatus status) {
+ Path p = status.getPath();
+ Preconditions.checkNotNull(p, "Child status' path cannot be null");
+ Preconditions.checkArgument(!p.isRoot(),
+ "childPath cannot be the root path: %s", p);
+ Preconditions.checkArgument(p.getParent().equals(path),
+ "childPath %s must be a child of %s", p, path);
+ URI uri = p.toUri();
+ // If FileStatus' path is missing host, but should have one, add it.
+ if (uri.getHost() == null && parentUri.getHost() != null) {
+ return new Path(new URI(parentUri.getScheme(), parentUri.getHost(),
+ uri.getPath(), uri.getFragment()));
+ } catch (URISyntaxException e) {
+ throw new IllegalArgumentException("FileStatus path invalid with" +
+ " added " + parentUri.getScheme() + "://" + parentUri.getHost() +
+ " added", e);
+ return p;
+ private void checkPathAbsolute(Path p) {
+ Preconditions.checkNotNull(p, "path must be non-null");
+ Preconditions.checkArgument(p.isAbsolute(), "path must be absolute: %s", p);
@@ -0,0 +1,132 @@
+import com.amazonaws.regions.Regions;
+import com.amazonaws.services.dynamodbv2.AmazonDynamoDB;
+import com.amazonaws.services.dynamodbv2.AmazonDynamoDBClientBuilder;
+import org.apache.commons.lang.StringUtils;
+import org.apache.hadoop.conf.Configurable;
+import org.apache.hadoop.fs.s3a.DefaultS3ClientFactory;
+import static org.apache.hadoop.fs.s3a.Constants.S3GUARD_DDB_REGION_KEY;
+ * Interface to create a DynamoDB client.
+ * Implementation should be configured for setting and getting configuration.
+public interface DynamoDBClientFactory extends Configurable {
+ Logger LOG = LoggerFactory.getLogger(DynamoDBClientFactory.class);
+ * Create a DynamoDB client object from configuration.
+ * The DynamoDB client to create does not have to relate to any S3 buckets.
+ * All information needed to create a DynamoDB client is from the hadoop
+ * configuration. Specially, if the region is not configured, it will use the
+ * provided region parameter. If region is neither configured nor provided,
+ * it will indicate an error.
+ * @param defaultRegion the default region of the AmazonDynamoDB client
+ * @return a new DynamoDB client
+ * @throws IOException if any IO error happens
+ AmazonDynamoDB createDynamoDBClient(String defaultRegion) throws IOException;
+ * The default implementation for creating an AmazonDynamoDB.
+ class DefaultDynamoDBClientFactory extends Configured
+ implements DynamoDBClientFactory {
+ public AmazonDynamoDB createDynamoDBClient(String defaultRegion)
+ Preconditions.checkNotNull(getConf(),
+ "Should have been configured before usage");
+ final Configuration conf = getConf();
+ final AWSCredentialsProvider credentials =
+ createAWSCredentialProviderSet(null, conf);
+ final ClientConfiguration awsConf =
+ DefaultS3ClientFactory.createAwsConf(conf);
+ final String region = getRegion(conf, defaultRegion);
+ LOG.debug("Creating DynamoDB client in region {}", region);
+ return AmazonDynamoDBClientBuilder.standard()
+ .withCredentials(credentials)
+ .withClientConfiguration(awsConf)
+ .withRegion(region)
+ .build();
+ * Helper method to get and validate the AWS region for DynamoDBClient.
+ * @param conf configuration
+ * @param defaultRegion the default region
+ * @return configured region or else the provided default region
+ * @throws IOException if the region is not valid
+ static String getRegion(Configuration conf, String defaultRegion)
+ String region = conf.getTrimmed(S3GUARD_DDB_REGION_KEY);
+ if (StringUtils.isEmpty(region)) {
+ region = defaultRegion;
+ Regions.fromName(region);
+ } catch (IllegalArgumentException | NullPointerException e) {
+ throw new IOException("Invalid region specified: " + region + "; " +
+ "Region can be configured with " + S3GUARD_DDB_REGION_KEY + ": " +
+ validRegionsString());
+ return region;
+ private static String validRegionsString() {
+ final String delimiter = ", ";
+ Regions[] regions = Regions.values();
+ for (int i = 0; i < regions.length; i++) {
+ if (i > 0) {
+ sb.append(delimiter);
+ sb.append(regions[i].getName());
@@ -0,0 +1,1010 @@
+import java.io.FileNotFoundException;
+import java.io.InterruptedIOException;
+import java.util.Arrays;
+import java.util.Date;
+import java.util.concurrent.TimeUnit;
+import com.amazonaws.services.dynamodbv2.document.BatchWriteItemOutcome;
+import com.amazonaws.services.dynamodbv2.document.DynamoDB;
+import com.amazonaws.services.dynamodbv2.document.Item;
+import com.amazonaws.services.dynamodbv2.document.ItemCollection;
+import com.amazonaws.services.dynamodbv2.document.PrimaryKey;
+import com.amazonaws.services.dynamodbv2.document.PutItemOutcome;
+import com.amazonaws.services.dynamodbv2.document.QueryOutcome;
+import com.amazonaws.services.dynamodbv2.document.ScanOutcome;
+import com.amazonaws.services.dynamodbv2.document.Table;
+import com.amazonaws.services.dynamodbv2.document.TableWriteItems;
+import com.amazonaws.services.dynamodbv2.document.spec.GetItemSpec;
+import com.amazonaws.services.dynamodbv2.document.spec.QuerySpec;
+import com.amazonaws.services.dynamodbv2.document.utils.ValueMap;
+import com.amazonaws.services.dynamodbv2.model.CreateTableRequest;
+import com.amazonaws.services.dynamodbv2.model.ProvisionedThroughput;
+import com.amazonaws.services.dynamodbv2.model.ProvisionedThroughputDescription;
+import com.amazonaws.services.dynamodbv2.model.ResourceInUseException;
+import com.amazonaws.services.dynamodbv2.model.ResourceNotFoundException;
+import com.amazonaws.services.dynamodbv2.model.WriteRequest;
+import org.apache.hadoop.fs.FileSystem;
+import org.apache.hadoop.fs.s3a.Constants;
+import org.apache.hadoop.fs.s3a.S3AFileSystem;
+import org.apache.hadoop.fs.s3a.S3AInstrumentation;
+import org.apache.hadoop.io.retry.RetryPolicies;
+import org.apache.hadoop.io.retry.RetryPolicy;
+import org.apache.hadoop.security.UserGroupInformation;
+import org.apache.hadoop.util.ReflectionUtils;
+import static org.apache.hadoop.fs.s3a.S3AUtils.translateException;
+import static org.apache.hadoop.fs.s3a.s3guard.PathMetadataDynamoDBTranslation.*;
+import static org.apache.hadoop.fs.s3a.s3guard.S3Guard.*;
+ * DynamoDBMetadataStore is a {@link MetadataStore} that persists
+ * file system metadata to DynamoDB.
+ * The current implementation uses a schema consisting of a single table. The
+ * name of the table can be configured by config key
+ * {@link org.apache.hadoop.fs.s3a.Constants#S3GUARD_DDB_TABLE_NAME_KEY}.
+ * By default, it matches the name of the S3 bucket. Each item in the table
+ * represents a single directory or file. Its path is split into separate table
+ * attributes:
+ * <ul>
+ * <li> parent (absolute path of the parent, with bucket name inserted as
+ * first path component). </li>
+ * <li> child (path of that specific child, relative to parent). </li>
+ * <li> optional boolean attribute tracking whether the path is a directory.
+ * Absence or a false value indicates the path is a file. </li>
+ * <li> optional long attribute revealing modification time of file.
+ * This attribute is meaningful only to file items.</li>
+ * <li> optional long attribute revealing file length.
+ * <li> optional long attribute revealing block size of the file.
+ * </ul>
+ * The DynamoDB partition key is the parent, and the range key is the child.
+ * To allow multiple buckets to share the same DynamoDB table, the bucket
+ * name is treated as the root directory.
+ * s3a://bucket/dir1
+ * This is persisted to a single DynamoDB table as:
+ * =========================================================================
+ * | parent | child | is_dir | mod_time | len | ... |
+ * | /bucket | dir1 | true | | | |
+ * | /bucket/dir1 | dir2 | true | | | |
+ * | /bucket/dir1 | dir3 | true | | | |
+ * | /bucket/dir1/dir2 | file1 | | 100 | 111 | |
+ * | /bucket/dir1/dir2 | file2 | | 200 | 222 | |
+ * | /bucket/dir1/dir3 | dir4 | true | | | |
+ * | /bucket/dir1/dir3 | dir5 | true | | | |
+ * | /bucket/dir1/dir3/dir4 | file3 | | 300 | 333 | |
+ * | /bucket/dir1/dir3/dir5 | file4 | | 400 | 444 | |
+ * | /bucket/dir1/dir3 | dir6 | true | | | |
+ * This choice of schema is efficient for read access patterns.
+ * {@link #get(Path)} can be served from a single item lookup.
+ * {@link #listChildren(Path)} can be served from a query against all rows
+ * matching the parent (the partition key) and the returned list is guaranteed
+ * to be sorted by child (the range key). Tracking whether or not a path is a
+ * directory helps prevent unnecessary queries during traversal of an entire
+ * sub-tree.
+ * Some mutating operations, notably {@link #deleteSubtree(Path)} and
+ * {@link #move(Collection, Collection)}, are less efficient with this schema.
+ * They require mutating multiple items in the DynamoDB table.
+ * By default, DynamoDB access is performed within the same AWS region as
+ * the S3 bucket that hosts the S3A instance. During initialization, it checks
+ * the location of the S3 bucket and creates a DynamoDB client connected to the
+ * same region. The region may also be set explicitly by setting the config
+ * parameter {@code fs.s3a.s3guard.ddb.region} to the corresponding region.
+public class DynamoDBMetadataStore implements MetadataStore {
+ public static final Logger LOG = LoggerFactory.getLogger(
+ DynamoDBMetadataStore.class);
+ /** parent/child name to use in the version marker. */
+ public static final String VERSION_MARKER = "../VERSION";
+ /** Current version number. */
+ public static final int VERSION = 100;
+ /** Error: version marker not found in table. */
+ public static final String E_NO_VERSION_MARKER
+ = "S3Guard table lacks version marker.";
+ /** Error: version mismatch. */
+ public static final String E_INCOMPATIBLE_VERSION
+ = "Database table is from an incompatible S3Guard version.";
+ /** Initial delay for retries when batched operations get throttled by
+ * DynamoDB. Value is {@value} msec. */
+ public static final long MIN_RETRY_SLEEP_MSEC = 100;
+ private static ValueMap deleteTrackingValueMap =
+ new ValueMap().withBoolean(":false", false);
+ private DynamoDB dynamoDB;
+ private String region;
+ private Table table;
+ private String tableName;
+ private Configuration conf;
+ private String username;
+ private RetryPolicy dataAccessRetryPolicy;
+ private S3AInstrumentation.S3GuardInstrumentation instrumentation;
+ * A utility function to create DynamoDB instance.
+ * @param conf the file system configuration
+ * @param s3Region region of the associated S3 bucket (if any).
+ * @return DynamoDB instance.
+ * @throws IOException I/O error.
+ private static DynamoDB createDynamoDB(Configuration conf, String s3Region)
+ Preconditions.checkNotNull(conf);
+ final Class<? extends DynamoDBClientFactory> cls = conf.getClass(
+ S3GUARD_DDB_CLIENT_FACTORY_IMPL,
+ S3GUARD_DDB_CLIENT_FACTORY_IMPL_DEFAULT,
+ DynamoDBClientFactory.class);
+ LOG.debug("Creating DynamoDB client {} with S3 region {}", cls, s3Region);
+ final AmazonDynamoDB dynamoDBClient = ReflectionUtils.newInstance(cls, conf)
+ .createDynamoDBClient(s3Region);
+ return new DynamoDB(dynamoDBClient);
+ public void initialize(FileSystem fs) throws IOException {
+ Preconditions.checkArgument(fs instanceof S3AFileSystem,
+ "DynamoDBMetadataStore only supports S3A filesystem.");
+ final S3AFileSystem s3afs = (S3AFileSystem) fs;
+ instrumentation = s3afs.getInstrumentation().getS3GuardInstrumentation();
+ final String bucket = s3afs.getBucket();
+ String confRegion = s3afs.getConf().getTrimmed(S3GUARD_DDB_REGION_KEY);
+ if (!StringUtils.isEmpty(confRegion)) {
+ region = confRegion;
+ LOG.debug("Overriding S3 region with configured DynamoDB region: {}",
+ region);
+ region = s3afs.getBucketLocation();
+ LOG.debug("Inferring DynamoDB region from S3 bucket: {}", region);
+ username = s3afs.getUsername();
+ conf = s3afs.getConf();
+ dynamoDB = createDynamoDB(conf, region);
+ // use the bucket as the DynamoDB table name if not specified in config
+ tableName = conf.getTrimmed(S3GUARD_DDB_TABLE_NAME_KEY, bucket);
+ setMaxRetries(conf);
+ initTable();
+ instrumentation.initialized();
+ * Performs one-time initialization of the metadata store via configuration.
+ * This initialization depends on the configuration object to get AWS
+ * credentials, DynamoDBFactory implementation class, DynamoDB endpoints,
+ * DynamoDB table names etc. After initialization, this metadata store does
+ * not explicitly relate to any S3 bucket, which be nonexistent.
+ * This is used to operate the metadata store directly beyond the scope of the
+ * S3AFileSystem integration, e.g. command line tools.
+ * Generally, callers should use {@link #initialize(FileSystem)}
+ * with an initialized {@code S3AFileSystem} instance.
+ * Without a filesystem to act as a reference point, the configuration itself
+ * must declare the table name and region in the
+ * {@link Constants#S3GUARD_DDB_TABLE_NAME_KEY} and
+ * {@link Constants#S3GUARD_DDB_REGION_KEY} respectively.
+ * @see #initialize(FileSystem)
+ * @throws IOException if there is an error
+ * @throws IllegalArgumentException if the configuration is incomplete
+ public void initialize(Configuration config) throws IOException {
+ conf = config;
+ tableName = conf.getTrimmed(S3GUARD_DDB_TABLE_NAME_KEY);
+ Preconditions.checkArgument(!StringUtils.isEmpty(tableName),
+ "No DynamoDB table name configured");
+ region = conf.getTrimmed(S3GUARD_DDB_REGION_KEY);
+ Preconditions.checkArgument(!StringUtils.isEmpty(region),
+ "No DynamoDB region configured");
+ username = UserGroupInformation.getCurrentUser().getShortUserName();
+ * Set retry policy. This is driven by the value of
+ * {@link Constants#S3GUARD_DDB_MAX_RETRIES} with an exponential backoff
+ * between each attempt of {@link #MIN_RETRY_SLEEP_MSEC} milliseconds.
+ * @param config
+ private void setMaxRetries(Configuration config) {
+ int maxRetries = config.getInt(S3GUARD_DDB_MAX_RETRIES,
+ S3GUARD_DDB_MAX_RETRIES_DEFAULT);
+ dataAccessRetryPolicy = RetryPolicies
+ .exponentialBackoffRetry(maxRetries, MIN_RETRY_SLEEP_MSEC,
+ TimeUnit.MILLISECONDS);
+ public void delete(Path path) throws IOException {
+ innerDelete(path, true);
+ public void forgetMetadata(Path path) throws IOException {
+ innerDelete(path, false);
+ * Inner delete option, action based on the {@code tombstone} flag.
+ * No tombstone: delete the entry. Tombstone: create a tombstone entry.
+ * There is no check as to whether the entry exists in the table first.
+ * @param path path to delete
+ * @param tombstone flag to create a tombstone marker
+ private void innerDelete(Path path, boolean tombstone)
+ path = checkPath(path);
+ LOG.debug("Deleting from table {} in region {}: {}",
+ tableName, region, path);
+ // deleting nonexistent item consumes 1 write capacity; skip it
+ LOG.debug("Skip deleting root directory as it does not exist in table");
+ if (tombstone) {
+ Item item = PathMetadataDynamoDBTranslation.pathMetadataToItem(
+ PathMetadata.tombstone(path));
+ table.putItem(item);
+ table.deleteItem(pathToKey(path));
+ } catch (AmazonClientException e) {
+ throw translateException("delete", path, e);
+ public void deleteSubtree(Path path) throws IOException {
+ LOG.debug("Deleting subtree from table {} in region {}: {}",
+ final PathMetadata meta = get(path);
+ if (meta == null || meta.isDeleted()) {
+ LOG.debug("Subtree path {} does not exist; this will be a no-op", path);
+ for (DescendantsIterator desc = new DescendantsIterator(this, meta);
+ desc.hasNext();) {
+ innerDelete(desc.next().getPath(), true);
+ private Item getConsistentItem(PrimaryKey key) {
+ final GetItemSpec spec = new GetItemSpec()
+ .withPrimaryKey(key)
+ .withConsistentRead(true); // strictly consistent read
+ return table.getItem(spec);
+ public PathMetadata get(Path path) throws IOException {
+ return get(path, false);
+ public PathMetadata get(Path path, boolean wantEmptyDirectoryFlag)
+ LOG.debug("Get from table {} in region {}: {}", tableName, region, path);
+ final PathMetadata meta;
+ // Root does not persist in the table
+ meta = new PathMetadata(makeDirStatus(username, path));
+ final Item item = getConsistentItem(pathToKey(path));
+ meta = itemToPathMetadata(item, username);
+ LOG.debug("Get from table {} in region {} returning for {}: {}",
+ tableName, region, path, meta);
+ if (wantEmptyDirectoryFlag && meta != null) {
+ final FileStatus status = meta.getFileStatus();
+ // for directory, we query its direct children to determine isEmpty bit
+ if (status.isDirectory()) {
+ final QuerySpec spec = new QuerySpec()
+ .withHashKey(pathToParentKeyAttribute(path))
+ .withConsistentRead(true)
+ .withFilterExpression(IS_DELETED + " = :false")
+ .withValueMap(deleteTrackingValueMap);
+ final ItemCollection<QueryOutcome> items = table.query(spec);
+ boolean hasChildren = items.iterator().hasNext();
+ // When this class has support for authoritative
+ // (fully-cached) directory listings, we may also be able to answer
+ // TRUE here. Until then, we don't know if we have full listing or
+ // not, thus the UNKNOWN here:
+ meta.setIsEmptyDirectory(
+ hasChildren ? Tristate.FALSE : Tristate.UNKNOWN);
+ return meta;
+ throw translateException("get", path, e);
+ * Make a FileStatus object for a directory at given path. The FileStatus
+ * only contains what S3A needs, and omits mod time since S3A uses its own
+ * implementation which returns current system time.
+ * @param owner username of owner
+ * @param path path to dir
+ * @return new FileStatus
+ private FileStatus makeDirStatus(String owner, Path path) {
+ return new FileStatus(0, true, 1, 0, 0, 0, null,
+ owner, null, path);
+ public DirListingMetadata listChildren(Path path) throws IOException {
+ LOG.debug("Listing table {} in region {}: {}", tableName, region, path);
+ // find the children in the table
+ final List<PathMetadata> metas = new ArrayList<>();
+ for (Item item : items) {
+ PathMetadata meta = itemToPathMetadata(item, username);
+ metas.add(meta);
+ LOG.trace("Listing table {} in region {} for {} returning {}",
+ tableName, region, path, metas);
+ return (metas.isEmpty() && get(path) == null)
+ ? null
+ : new DirListingMetadata(path, metas, false);
+ // failure, including the path not being present
+ throw translateException("listChildren", path, e);
+ // build the list of all parent entries.
+ Collection<PathMetadata> completeAncestry(
+ Collection<PathMetadata> pathsToCreate) {
+ // Key on path to allow fast lookup
+ Map<Path, PathMetadata> ancestry = new HashMap<>();
+ for (PathMetadata meta : pathsToCreate) {
+ Preconditions.checkArgument(meta != null);
+ Path path = meta.getFileStatus().getPath();
+ ancestry.put(path, meta);
+ Path parent = path.getParent();
+ while (!parent.isRoot() && !ancestry.containsKey(parent)) {
+ LOG.debug("auto-create ancestor path {} for child path {}",
+ parent, path);
+ final FileStatus status = makeDirStatus(parent, username);
+ ancestry.put(parent, new PathMetadata(status, Tristate.FALSE, false));
+ parent = parent.getParent();
+ return ancestry.values();
+ public void move(Collection<Path> pathsToDelete,
+ Collection<PathMetadata> pathsToCreate) throws IOException {
+ if (pathsToDelete == null && pathsToCreate == null) {
+ LOG.debug("Moving paths of table {} in region {}: {} paths to delete and {}"
+ + " paths to create", tableName, region,
+ pathsToDelete == null ? 0 : pathsToDelete.size(),
+ pathsToCreate == null ? 0 : pathsToCreate.size());
+ LOG.trace("move: pathsToDelete = {}, pathsToCreate = {}", pathsToDelete,
+ pathsToCreate);
+ // In DynamoDBMetadataStore implementation, we assume that if a path
+ // exists, all its ancestors will also exist in the table.
+ // Following code is to maintain this invariant by putting all ancestor
+ // directories of the paths to create.
+ // ancestor paths that are not explicitly added to paths to create
+ Collection<PathMetadata> newItems = new ArrayList<>();
+ if (pathsToCreate != null) {
+ newItems.addAll(completeAncestry(pathsToCreate));
+ if (pathsToDelete != null) {
+ for (Path meta : pathsToDelete) {
+ newItems.add(PathMetadata.tombstone(meta));
+ processBatchWriteRequest(null, pathMetadataToItem(newItems));
+ throw translateException("move", (String) null, e);
+ * Helper method to issue a batch write request to DynamoDB.
+ * Callers of this method should catch the {@link AmazonClientException} and
+ * translate it for better error report and easier debugging.
+ * @param keysToDelete primary keys to be deleted; can be null
+ * @param itemsToPut new items to be put; can be null
+ private void processBatchWriteRequest(PrimaryKey[] keysToDelete,
+ Item[] itemsToPut) throws IOException {
+ final int totalToDelete = (keysToDelete == null ? 0 : keysToDelete.length);
+ final int totalToPut = (itemsToPut == null ? 0 : itemsToPut.length);
+ int count = 0;
+ while (count < totalToDelete + totalToPut) {
+ final TableWriteItems writeItems = new TableWriteItems(tableName);
+ int numToDelete = 0;
+ if (keysToDelete != null
+ && count < totalToDelete) {
+ numToDelete = Math.min(S3GUARD_DDB_BATCH_WRITE_REQUEST_LIMIT,
+ totalToDelete - count);
+ writeItems.withPrimaryKeysToDelete(
+ Arrays.copyOfRange(keysToDelete, count, count + numToDelete));
+ count += numToDelete;
+ if (numToDelete < S3GUARD_DDB_BATCH_WRITE_REQUEST_LIMIT
+ && itemsToPut != null
+ && count < totalToDelete + totalToPut) {
+ final int numToPut = Math.min(
+ S3GUARD_DDB_BATCH_WRITE_REQUEST_LIMIT - numToDelete,
+ totalToDelete + totalToPut - count);
+ final int index = count - totalToDelete;
+ writeItems.withItemsToPut(
+ Arrays.copyOfRange(itemsToPut, index, index + numToPut));
+ count += numToPut;
+ BatchWriteItemOutcome res = dynamoDB.batchWriteItem(writeItems);
+ // Check for unprocessed keys in case of exceeding provisioned throughput
+ Map<String, List<WriteRequest>> unprocessed = res.getUnprocessedItems();
+ int retryCount = 0;
+ while (unprocessed.size() > 0) {
+ retryBackoff(retryCount++);
+ res = dynamoDB.batchWriteItemUnprocessed(unprocessed);
+ unprocessed = res.getUnprocessedItems();
+ * Put the current thread to sleep to implement exponential backoff
+ * depending on retryCount. If max retries are exceeded, throws an
+ * exception instead.
+ * @param retryCount number of retries so far
+ * @throws IOException when max retryCount is exceeded.
+ private void retryBackoff(int retryCount) throws IOException {
+ // Our RetryPolicy ignores everything but retryCount here.
+ RetryPolicy.RetryAction action = dataAccessRetryPolicy.shouldRetry(null,
+ retryCount, 0, true);
+ if (action.action == RetryPolicy.RetryAction.RetryDecision.FAIL) {
+ throw new IOException(
+ String.format("Max retries exceeded (%d) for DynamoDB",
+ retryCount));
+ LOG.debug("Sleeping {} msec before next retry", action.delayMillis);
+ Thread.sleep(action.delayMillis);
+ } catch (Exception e) {
+ throw new IOException("Unexpected exception", e);
+ public void put(PathMetadata meta) throws IOException {
+ // For a deeply nested path, this method will automatically create the full
+ // ancestry and save respective item in DynamoDB table.
+ // So after put operation, we maintain the invariant that if a path exists,
+ // all its ancestors will also exist in the table.
+ // For performance purpose, we generate the full paths to put and use batch
+ // write item request to save the items.
+ LOG.debug("Saving to table {} in region {}: {}", tableName, region, meta);
+ Collection<PathMetadata> wrapper = new ArrayList<>(1);
+ wrapper.add(meta);
+ put(wrapper);
+ public void put(Collection<PathMetadata> metas) throws IOException {
+ LOG.debug("Saving batch to table {} in region {}", tableName, region);
+ processBatchWriteRequest(null, pathMetadataToItem(completeAncestry(metas)));
+ * Helper method to get full path of ancestors that are nonexistent in table.
+ private Collection<PathMetadata> fullPathsToPut(PathMetadata meta)
+ checkPathMetadata(meta);
+ final Collection<PathMetadata> metasToPut = new ArrayList<>();
+ // root path is not persisted
+ if (!meta.getFileStatus().getPath().isRoot()) {
+ metasToPut.add(meta);
+ // put all its ancestors if not present; as an optimization we return at its
+ // first existent ancestor
+ Path path = meta.getFileStatus().getPath().getParent();
+ if (!itemExists(item)) {
+ final FileStatus status = makeDirStatus(path, username);
+ metasToPut.add(new PathMetadata(status, Tristate.FALSE, false));
+ return metasToPut;
+ private boolean itemExists(Item item) {
+ if (item == null) {
+ if (item.hasAttribute(IS_DELETED) &&
+ item.getBoolean(IS_DELETED)) {
+ /** Create a directory FileStatus using current system time as mod time. */
+ static FileStatus makeDirStatus(Path f, String owner) {
+ return new FileStatus(0, true, 1, 0, System.currentTimeMillis(), 0,
+ null, owner, owner, f);
+ public void put(DirListingMetadata meta) throws IOException {
+ // directory path
+ PathMetadata p = new PathMetadata(makeDirStatus(meta.getPath(), username),
+ meta.isEmpty(), false);
+ // First add any missing ancestors...
+ final Collection<PathMetadata> metasToPut = fullPathsToPut(p);
+ // next add all children of the directory
+ metasToPut.addAll(meta.getListing());
+ processBatchWriteRequest(null, pathMetadataToItem(metasToPut));
+ throw translateException("put", (String) null, e);
+ public synchronized void close() {
+ if (instrumentation != null) {
+ instrumentation.storeClosed();
+ if (dynamoDB != null) {
+ LOG.debug("Shutting down {}", this);
+ dynamoDB.shutdown();
+ dynamoDB = null;
+ public void destroy() throws IOException {
+ if (table == null) {
+ LOG.info("In destroy(): no table to delete");
+ LOG.info("Deleting DynamoDB table {} in region {}", tableName, region);
+ Preconditions.checkNotNull(dynamoDB, "Not connected to DynamoDB");
+ table.delete();
+ table.waitForDelete();
+ } catch (ResourceNotFoundException rnfe) {
+ LOG.info("ResourceNotFoundException while deleting DynamoDB table {} in "
+ + "region {}. This may indicate that the table does not exist, "
+ + "or has been deleted by another concurrent thread or process.",
+ tableName, region);
+ } catch (InterruptedException ie) {
+ Thread.currentThread().interrupt();
+ LOG.warn("Interrupted while waiting for DynamoDB table {} being deleted",
+ tableName, ie);
+ throw new InterruptedIOException("Table " + tableName
+ + " in region " + region + " has not been deleted");
+ throw translateException("destroy", (String) null, e);
+ private ItemCollection<ScanOutcome> expiredFiles(long modTime) {
+ String filterExpression = "mod_time < :mod_time";
+ String projectionExpression = "parent,child";
+ ValueMap map = new ValueMap().withLong(":mod_time", modTime);
+ return table.scan(filterExpression, projectionExpression, null, map);
+ public void prune(long modTime) throws IOException {
+ int itemCount = 0;
+ Collection<Path> deletionBatch =
+ new ArrayList<>(S3GUARD_DDB_BATCH_WRITE_REQUEST_LIMIT);
+ int delay = conf.getInt(S3GUARD_DDB_BACKGROUND_SLEEP_MSEC_KEY,
+ S3GUARD_DDB_BACKGROUND_SLEEP_MSEC_DEFAULT);
+ for (Item item : expiredFiles(modTime)) {
+ PathMetadata md = PathMetadataDynamoDBTranslation
+ .itemToPathMetadata(item, username);
+ Path path = md.getFileStatus().getPath();
+ deletionBatch.add(path);
+ itemCount++;
+ if (deletionBatch.size() == S3GUARD_DDB_BATCH_WRITE_REQUEST_LIMIT) {
+ Thread.sleep(delay);
+ processBatchWriteRequest(pathToKey(deletionBatch), null);
+ deletionBatch.clear();
+ if (deletionBatch.size() > 0) {
+ } catch (InterruptedException e) {
+ throw new InterruptedIOException("Pruning was interrupted");
+ LOG.info("Finished pruning {} items in batches of {}", itemCount,
+ S3GUARD_DDB_BATCH_WRITE_REQUEST_LIMIT);
+ return getClass().getSimpleName() + '{'
+ + "region=" + region
+ + ", tableName=" + tableName
+ + '}';
+ * Create a table if it does not exist and wait for it to become active.
+ * If a table with the intended name already exists, then it uses that table.
+ * Otherwise, it will automatically create the table if the config
+ * {@link org.apache.hadoop.fs.s3a.Constants#S3GUARD_DDB_TABLE_CREATE_KEY} is
+ * enabled. The DynamoDB table creation API is asynchronous. This method wait
+ * for the table to become active after sending the creation request, so
+ * overall, this method is synchronous, and the table is guaranteed to exist
+ * after this method returns successfully.
+ * @throws IOException if table does not exist and auto-creation is disabled;
+ * or table is being deleted, or any other I/O exception occurred.
+ void initTable() throws IOException {
+ table = dynamoDB.getTable(tableName);
+ LOG.debug("Binding to table {}", tableName);
+ final String status = table.describe().getTableStatus();
+ switch (status) {
+ case "CREATING":
+ case "UPDATING":
+ LOG.debug("Table {} in region {} is being created/updated. This may"
+ + " indicate that the table is being operated by another "
+ + "concurrent thread or process. Waiting for active...",
+ waitForTableActive(table);
+ case "DELETING":
+ throw new FileNotFoundException("DynamoDB table "
+ + "'" + tableName + "' is being "
+ + "deleted in region " + region);
+ case "ACTIVE":
+ default:
+ throw new IOException("Unknown DynamoDB table status " + status
+ + ": tableName='" + tableName + "', region=" + region);
+ final Item versionMarker = getVersionMarkerItem();
+ verifyVersionCompatibility(tableName, versionMarker);
+ Long created = extractCreationTimeFromMarker(versionMarker);
+ LOG.debug("Using existing DynamoDB table {} in region {} created {}",
+ tableName, region, (created != null) ? new Date(created) : null);
+ if (conf.getBoolean(S3GUARD_DDB_TABLE_CREATE_KEY, false)) {
+ final ProvisionedThroughput capacity = new ProvisionedThroughput(
+ conf.getLong(S3GUARD_DDB_TABLE_CAPACITY_READ_KEY,
+ S3GUARD_DDB_TABLE_CAPACITY_READ_DEFAULT),
+ conf.getLong(S3GUARD_DDB_TABLE_CAPACITY_WRITE_KEY,
+ S3GUARD_DDB_TABLE_CAPACITY_WRITE_DEFAULT));
+ createTable(capacity);
+ + "'" + tableName + "' does not "
+ + "exist in region " + region + "; auto-creation is turned off");
+ throw translateException("initTable", (String) null, e);
+ * Get the version mark item in the existing DynamoDB table.
+ * As the version marker item may be created by another concurrent thread or
+ * process, we retry a limited times before we fail to get it.
+ private Item getVersionMarkerItem() throws IOException {
+ final PrimaryKey versionMarkerKey =
+ createVersionMarkerPrimaryKey(VERSION_MARKER);
+ Item versionMarker = table.getItem(versionMarkerKey);
+ while (versionMarker == null) {
+ LOG.debug("Sleeping {} ms before next retry", action.delayMillis);
+ throw new IOException("initTable: Unexpected exception", e);
+ retryCount++;
+ versionMarker = table.getItem(versionMarkerKey);
+ return versionMarker;
+ * Verify that a table version is compatible with this S3Guard client.
+ * @param tableName name of the table (for error messages)
+ * @param versionMarker the version marker retrieved from the table
+ * @throws IOException on any incompatibility
+ static void verifyVersionCompatibility(String tableName,
+ Item versionMarker) throws IOException {
+ if (versionMarker == null) {
+ LOG.warn("Table {} contains no version marker", tableName);
+ throw new IOException(E_NO_VERSION_MARKER
+ + " Table: " + tableName);
+ final int version = extractVersionFromMarker(versionMarker);
+ if (VERSION != version) {
+ // version mismatch. Unless/until there is support for
+ // upgrading versions, treat this as an incompatible change
+ // and fail.
+ throw new IOException(E_INCOMPATIBLE_VERSION
+ + " Table "+ tableName
+ + " Expected version " + VERSION + " actual " + version);
+ * Wait for table being active.
+ * @param t table to block on.
+ * @throws IOException IO problems
+ * @throws InterruptedIOException if the wait was interrupted
+ private void waitForTableActive(Table t) throws IOException {
+ t.waitForActive();
+ LOG.warn("Interrupted while waiting for table {} in region {} active",
+ tableName, region, e);
+ throw (IOException) new InterruptedIOException("DynamoDB table '"
+ + tableName + "' is not active yet in region " + region).initCause(e);
+ * Create a table, wait for it to become active, then add the version
+ * marker.
+ * @param capacity capacity to provision
+ * @throws IOException on any failure.
+ private void createTable(ProvisionedThroughput capacity) throws IOException {
+ LOG.info("Creating non-existent DynamoDB table {} in region {}",
+ table = dynamoDB.createTable(new CreateTableRequest()
+ .withTableName(tableName)
+ .withKeySchema(keySchema())
+ .withAttributeDefinitions(attributeDefinitions())
+ .withProvisionedThroughput(capacity));
+ LOG.debug("Awaiting table becoming active");
+ } catch (ResourceInUseException e) {
+ LOG.warn("ResourceInUseException while creating DynamoDB table {} "
+ + "in region {}. This may indicate that the table was "
+ + "created by another concurrent thread or process.",
+ final Item marker = createVersionMarker(VERSION_MARKER, VERSION,
+ System.currentTimeMillis());
+ putItem(marker);
+ * PUT a single item to the table.
+ * @param item item to put
+ * @return the outcome.
+ PutItemOutcome putItem(Item item) {
+ LOG.debug("Putting item {}", item);
+ return table.putItem(item);
+ * Provision the table with given read and write capacity units.
+ void provisionTable(Long readCapacity, Long writeCapacity)
+ final ProvisionedThroughput toProvision = new ProvisionedThroughput()
+ .withReadCapacityUnits(readCapacity)
+ .withWriteCapacityUnits(writeCapacity);
+ final ProvisionedThroughputDescription p =
+ table.updateTable(toProvision).getProvisionedThroughput();
+ LOG.info("Provision table {} in region {}: readCapacityUnits={}, "
+ + "writeCapacityUnits={}",
+ tableName, region, p.getReadCapacityUnits(),
+ p.getWriteCapacityUnits());
+ throw translateException("provisionTable", (String) null, e);
+ Table getTable() {
+ return table;
+ String getRegion() {
+ DynamoDB getDynamoDB() {
+ return dynamoDB;
+ * Validates a path object; it must be absolute, and contain a host
+ * (bucket) component.
+ private Path checkPath(Path path) {
+ Preconditions.checkNotNull(path);
+ Preconditions.checkArgument(path.isAbsolute(), "Path %s is not absolute",
+ path);
+ URI uri = path.toUri();
+ Preconditions.checkNotNull(uri.getScheme(), "Path %s missing scheme", path);
+ Preconditions.checkArgument(uri.getScheme().equals(Constants.FS_S3A),
+ "Path %s scheme must be %s", path, Constants.FS_S3A);
+ Preconditions.checkArgument(!StringUtils.isEmpty(uri.getHost()), "Path %s" +
+ " is missing bucket.", path);
+ * Validates a path meta-data object.
+ private static void checkPathMetadata(PathMetadata meta) {
+ Preconditions.checkNotNull(meta);
+ Preconditions.checkNotNull(meta.getFileStatus());
+ Preconditions.checkNotNull(meta.getFileStatus().getPath());
@@ -0,0 +1,435 @@
+ * This is a local, in-memory, implementation of MetadataStore.
+ * This is <i>not</i> a coherent cache across processes. It is only
+ * locally-coherent.
+ * The purpose of this is for unit and integration testing.
+ * It could also be used to accelerate local-only operations where only one
+ * process is operating on a given object store, or multiple processes are
+ * accessing a read-only storage bucket.
+ * This MetadataStore does not enforce filesystem rules such as disallowing
+ * non-recursive removal of non-empty directories. It is assumed the caller
+ * already has to perform these sorts of checks.
+public class LocalMetadataStore implements MetadataStore {
+ public static final Logger LOG = LoggerFactory.getLogger(MetadataStore.class);
+ // TODO HADOOP-13649: use time instead of capacity for eviction.
+ public static final int DEFAULT_MAX_RECORDS = 128;
+ * Maximum number of records.
+ public static final String CONF_MAX_RECORDS =
+ "fs.metadatastore.local.max_records";
+ /** Contains directories and files. */
+ private LruHashMap<Path, PathMetadata> fileHash;
+ /** Contains directory listings. */
+ private LruHashMap<Path, DirListingMetadata> dirHash;
+ private FileSystem fs;
+ /* Null iff this FS does not have an associated URI host. */
+ private String uriHost;
+ public void initialize(FileSystem fileSystem) throws IOException {
+ Preconditions.checkNotNull(fileSystem);
+ fs = fileSystem;
+ URI fsURI = fs.getUri();
+ uriHost = fsURI.getHost();
+ if (uriHost != null && uriHost.equals("")) {
+ uriHost = null;
+ initialize(fs.getConf());
+ public void initialize(Configuration conf) throws IOException {
+ int maxRecords = conf.getInt(CONF_MAX_RECORDS, DEFAULT_MAX_RECORDS);
+ if (maxRecords < 4) {
+ maxRecords = 4;
+ // Start w/ less than max capacity. Space / time trade off.
+ fileHash = new LruHashMap<>(maxRecords/2, maxRecords);
+ dirHash = new LruHashMap<>(maxRecords/4, maxRecords);
+ final StringBuilder sb = new StringBuilder(
+ "LocalMetadataStore{");
+ sb.append(", uriHost='").append(uriHost).append('\'');
+ sb.append('}');
+ public void delete(Path p) throws IOException {
+ doDelete(p, false, true);
+ public void forgetMetadata(Path p) throws IOException {
+ doDelete(p, false, false);
+ doDelete(path, true, true);
+ private synchronized void doDelete(Path p, boolean recursive, boolean
+ tombstone) {
+ Path path = standardize(p);
+ // Delete entry from file cache, then from cached parent directory, if any
+ deleteHashEntries(path, tombstone);
+ // Remove all entries that have this dir as path prefix.
+ deleteHashByAncestor(path, dirHash, tombstone);
+ deleteHashByAncestor(path, fileHash, tombstone);
+ public synchronized PathMetadata get(Path p) throws IOException {
+ return get(p, false);
+ public PathMetadata get(Path p, boolean wantEmptyDirectoryFlag)
+ synchronized (this) {
+ PathMetadata m = fileHash.mruGet(path);
+ if (wantEmptyDirectoryFlag && m != null &&
+ m.getFileStatus().isDirectory()) {
+ m.setIsEmptyDirectory(isEmptyDirectory(p));
+ LOG.debug("get({}) -> {}", path, m == null ? "null" : m.prettyPrint());
+ return m;
+ * Determine if directory is empty.
+ * Call with lock held.
+ * @param p a Path, already filtered through standardize()
+ * @return TRUE / FALSE if known empty / not-empty, UNKNOWN otherwise.
+ private Tristate isEmptyDirectory(Path p) {
+ DirListingMetadata dirMeta = dirHash.get(p);
+ return dirMeta.withoutTombstones().isEmpty();
+ public synchronized DirListingMetadata listChildren(Path p) throws
+ IOException {
+ DirListingMetadata listing = dirHash.mruGet(path);
+ LOG.debug("listChildren({}) -> {}", path,
+ listing == null ? "null" : listing.prettyPrint());
+ // Make a copy so callers can mutate without affecting our state
+ return listing == null ? null : new DirListingMetadata(listing);
+ Preconditions.checkNotNull(pathsToDelete, "pathsToDelete is null");
+ Preconditions.checkNotNull(pathsToCreate, "pathsToCreate is null");
+ Preconditions.checkArgument(pathsToDelete.size() == pathsToCreate.size(),
+ "Must supply same number of paths to delete/create.");
+ // I feel dirty for using reentrant lock. :-|
+ // 1. Delete pathsToDelete
+ LOG.debug("move: deleting metadata {}", meta);
+ delete(meta);
+ // 2. Create new destination path metadata
+ LOG.debug("move: adding metadata {}", meta);
+ put(meta);
+ // 3. We now know full contents of all dirs in destination subtree
+ FileStatus status = meta.getFileStatus();
+ if (status == null || status.isDirectory()) {
+ continue;
+ DirListingMetadata dir = listChildren(status.getPath());
+ if (dir != null) { // could be evicted already
+ dir.setAuthoritative(true);
+ Path path = standardize(status.getPath());
+ /* Add entry for this file. */
+ LOG.debug("put {} -> {}", path, meta.prettyPrint());
+ fileHash.put(path, meta);
+ /* Directory case:
+ * We also make sure we have an entry in the dirHash, so subsequent
+ * listStatus(path) at least see the directory.
+ * If we had a boolean flag argument "isNew", we would know whether this
+ * is an existing directory the client discovered via getFileStatus(),
+ * or if it is a newly-created directory. In the latter case, we would
+ * be able to mark the directory as authoritative (fully-cached),
+ * saving round trips to underlying store for subsequent listStatus()
+ DirListingMetadata dir = dirHash.mruGet(path);
+ if (dir == null) {
+ dirHash.put(path, new DirListingMetadata(path, DirListingMetadata
+ .EMPTY_DIR, false));
+ /* Update cached parent dir. */
+ Path parentPath = path.getParent();
+ if (parentPath != null) {
+ DirListingMetadata parent = dirHash.mruGet(parentPath);
+ if (parent == null) {
+ /* Track this new file's listing in parent. Parent is not
+ * authoritative, since there may be other items in it we don't know
+ * about. */
+ parent = new DirListingMetadata(parentPath,
+ DirListingMetadata.EMPTY_DIR, false);
+ dirHash.put(parentPath, parent);
+ parent.put(status);
+ public synchronized void put(DirListingMetadata meta) throws IOException {
+ LOG.debug("put dirMeta {}", meta.prettyPrint());
+ dirHash.put(standardize(meta.getPath()), meta);
+ public synchronized void put(Collection<PathMetadata> metas) throws
+ for (PathMetadata meta : metas) {
+ public void close() throws IOException {
+ if (dirHash != null) {
+ dirHash.clear();
+ public synchronized void prune(long modTime) throws IOException {
+ Iterator<Map.Entry<Path, PathMetadata>> files =
+ fileHash.entrySet().iterator();
+ while (files.hasNext()) {
+ Map.Entry<Path, PathMetadata> entry = files.next();
+ if (expired(entry.getValue().getFileStatus(), modTime)) {
+ files.remove();
+ Iterator<Map.Entry<Path, DirListingMetadata>> dirs =
+ dirHash.entrySet().iterator();
+ while (dirs.hasNext()) {
+ Map.Entry<Path, DirListingMetadata> entry = dirs.next();
+ Path path = entry.getKey();
+ DirListingMetadata metadata = entry.getValue();
+ Collection<PathMetadata> oldChildren = metadata.getListing();
+ Collection<PathMetadata> newChildren = new LinkedList<>();
+ for (PathMetadata child : oldChildren) {
+ FileStatus status = child.getFileStatus();
+ if (!expired(status, modTime)) {
+ newChildren.add(child);
+ if (newChildren.size() != oldChildren.size()) {
+ dirHash.put(path, new DirListingMetadata(path, newChildren, false));
+ if (!path.isRoot()) {
+ DirListingMetadata parent = dirHash.get(path.getParent());
+ if (parent != null) {
+ parent.setAuthoritative(false);
+ private boolean expired(FileStatus status, long expiry) {
+ // Note: S3 doesn't track modification time on directories, so for
+ // consistency with the DynamoDB implementation we ignore that here
+ return status.getModificationTime() < expiry && !status.isDirectory();
+ static <T> void deleteHashByAncestor(Path ancestor, Map<Path, T> hash,
+ boolean tombstone) {
+ for (Iterator<Map.Entry<Path, T>> it = hash.entrySet().iterator();
+ it.hasNext();) {
+ Map.Entry<Path, T> entry = it.next();
+ Path f = entry.getKey();
+ T meta = entry.getValue();
+ if (isAncestorOf(ancestor, f)) {
+ if (meta instanceof PathMetadata) {
+ entry.setValue((T) PathMetadata.tombstone(f));
+ } else if (meta instanceof DirListingMetadata) {
+ it.remove();
+ throw new IllegalStateException("Unknown type in hash");
+ * @return true iff 'ancestor' is ancestor dir in path 'f'.
+ * All paths here are absolute. Dir does not count as its own ancestor.
+ private static boolean isAncestorOf(Path ancestor, Path f) {
+ String aStr = ancestor.toString();
+ if (!ancestor.isRoot()) {
+ aStr += "/";
+ String fStr = f.toString();
+ return (fStr.startsWith(aStr));
+ * Update fileHash and dirHash to reflect deletion of file 'f'. Call with
+ * lock held.
+ private void deleteHashEntries(Path path, boolean tombstone) {
+ // Remove target file/dir
+ LOG.debug("delete file entry for {}", path);
+ fileHash.put(path, PathMetadata.tombstone(path));
+ fileHash.remove(path);
+ // Update this and parent dir listing, if any
+ /* If this path is a dir, remove its listing */
+ LOG.debug("removing listing of {}", path);
+ dirHash.remove(path);
+ /* Remove this path from parent's dir listing */
+ DirListingMetadata dir = dirHash.get(parent);
+ if (dir != null) {
+ LOG.debug("removing parent's entry for {} ", path);
+ dir.markDeleted(path);
+ dir.remove(path);
+ * Return a "standardized" version of a path so we always have a consistent
+ * hash value. Also asserts the path is absolute, and contains host
+ * component.
+ * @param p input Path
+ * @return standardized version of Path, suitable for hash key
+ private Path standardize(Path p) {
+ Preconditions.checkArgument(p.isAbsolute(), "Path must be absolute");
+ if (uriHost != null) {
+ Preconditions.checkArgument(!isEmpty(uri.getHost()));
+ private static boolean isEmpty(String s) {
+ return (s == null || s.isEmpty());
@@ -0,0 +1,50 @@
+ * Licensed to the Apache Software Foundation (ASF) under one or more
+ * contributor license agreements. See the NOTICE file distributed with
+ * this work for additional information regarding copyright ownership.
+ * The ASF licenses this file to You under the Apache License, Version 2.0
+ * (the "License"); you may not use this file except in compliance with
+ * the License. You may obtain a copy of the License at
+import java.util.LinkedHashMap;
+ * LinkedHashMap that implements a maximum size and LRU eviction policy.
+public class LruHashMap<K, V> extends LinkedHashMap<K, V> {
+ private final int maxSize;
+ public LruHashMap(int initialCapacity, int maxSize) {
+ super(initialCapacity);
+ this.maxSize = maxSize;
+ protected boolean removeEldestEntry(Map.Entry<K, V> eldest) {
+ return size() > maxSize;
+ * get() plus side-effect of making the element Most Recently Used.
+ * @param key lookup key
+ * @return value
+ public V mruGet(K key) {
+ V val = remove(key);
+ if (val != null) {
+ put(key, val);
+ return val;
@@ -0,0 +1,221 @@
+import java.io.Closeable;
+ * {@code MetadataStore} defines the set of operations that any metadata store
+ * implementation must provide. Note that all {@link Path} objects provided
+ * to methods must be absolute, not relative paths.
+public interface MetadataStore extends Closeable {
+ * Performs one-time initialization of the metadata store.
+ * @param fs {@code FileSystem} associated with the MetadataStore
+ void initialize(FileSystem fs) throws IOException;
+ * @param conf Configuration.
+ void initialize(Configuration conf) throws IOException;
+ * Deletes exactly one path, leaving a tombstone to prevent lingering,
+ * inconsistent copies of it from being listed.
+ * @param path the path to delete
+ void delete(Path path) throws IOException;
+ * Removes the record of exactly one path. Does not leave a tombstone (see
+ * {@link MetadataStore#delete(Path)}. It is currently intended for testing
+ * only, and a need to use it as part of normal FileSystem usage is not
+ * anticipated.
+ void forgetMetadata(Path path) throws IOException;
+ * Deletes the entire sub-tree rooted at the given path, leaving tombstones
+ * to prevent lingering, inconsistent copies of it from being listed.
+ * In addition to affecting future calls to {@link #get(Path)},
+ * implementations must also update any stored {@code DirListingMetadata}
+ * objects which track the parent of this file.
+ * @param path the root of the sub-tree to delete
+ void deleteSubtree(Path path) throws IOException;
+ * Gets metadata for a path.
+ * @param path the path to get
+ * @return metadata for {@code path}, {@code null} if not found
+ PathMetadata get(Path path) throws IOException;
+ * Gets metadata for a path. Alternate method that includes a hint
+ * whether or not the MetadataStore should do work to compute the value for
+ * {@link PathMetadata#isEmptyDirectory()}. Since determining emptiness
+ * may be an expensive operation, this can save wasted work.
+ * @param wantEmptyDirectoryFlag Set to true to give a hint to the
+ * MetadataStore that it should try to compute the empty directory flag.
+ PathMetadata get(Path path, boolean wantEmptyDirectoryFlag)
+ throws IOException;
+ * Lists metadata for all direct children of a path.
+ * @param path the path to list
+ * @return metadata for all direct children of {@code path} which are being
+ * tracked by the MetadataStore, or {@code null} if the path was not found
+ * in the MetadataStore.
+ DirListingMetadata listChildren(Path path) throws IOException;
+ * Record the effects of a {@link FileSystem#rename(Path, Path)} in the
+ * MetadataStore. Clients provide explicit enumeration of the affected
+ * paths (recursively), before and after the rename.
+ * This operation is not atomic, unless specific implementations claim
+ * otherwise.
+ * On the need to provide an enumeration of directory trees instead of just
+ * source and destination paths:
+ * Since a MetadataStore does not have to track all metadata for the
+ * underlying storage system, and a new MetadataStore may be created on an
+ * existing underlying filesystem, this move() may be the first time the
+ * MetadataStore sees the affected paths. Therefore, simply providing src
+ * and destination paths may not be enough to record the deletions (under
+ * src path) and creations (at destination) that are happening during the
+ * rename().
+ * @param pathsToDelete Collection of all paths that were removed from the
+ * source directory tree of the move.
+ * @param pathsToCreate Collection of all PathMetadata for the new paths
+ * that were created at the destination of the rename
+ * ().
+ void move(Collection<Path> pathsToDelete,
+ Collection<PathMetadata> pathsToCreate) throws IOException;
+ * Saves metadata for exactly one path.
+ * Implementations may pre-create all the path's ancestors automatically.
+ * Implementations must update any {@code DirListingMetadata} objects which
+ * track the immediate parent of this file.
+ * @param meta the metadata to save
+ void put(PathMetadata meta) throws IOException;
+ * Saves metadata for any number of paths.
+ * Semantics are otherwise the same as single-path puts.
+ * @param metas the metadata to save
+ void put(Collection<PathMetadata> metas) throws IOException;
+ * Save directory listing metadata. Callers may save a partial directory
+ * listing for a given path, or may store a complete and authoritative copy
+ * of the directory listing. {@code MetadataStore} implementations may
+ * subsequently keep track of all modifications to the directory contents at
+ * this path, and return authoritative results from subsequent calls to
+ * {@link #listChildren(Path)}. See {@link DirListingMetadata}.
+ * Any authoritative results returned are only authoritative for the scope
+ * of the {@code MetadataStore}: A per-process {@code MetadataStore}, for
+ * example, would only show results visible to that process, potentially
+ * missing metadata updates (create, delete) made to the same path by
+ * another process.
+ * @param meta Directory listing metadata.
+ void put(DirListingMetadata meta) throws IOException;
+ * Destroy all resources associated with the metadata store.
+ * The destroyed resources can be DynamoDB tables, MySQL databases/tables, or
+ * HDFS directories. Any operations after calling this method may possibly
+ * fail.
+ * This operation is idempotent.
+ void destroy() throws IOException;
+ * Clear any metadata older than a specified time from the repository.
+ * Implementations MUST clear file metadata, and MAY clear directory metadata
+ * (s3a itself does not track modification time for directories).
+ * Implementations may also choose to throw UnsupportedOperationException
+ * istead. Note that modification times should be in UTC, as returned by
+ * System.currentTimeMillis at the time of modification.
+ * @param modTime Oldest modification time to allow
+ * @throws UnsupportedOperationException if not implemented
+ void prune(long modTime) throws IOException, UnsupportedOperationException;
@@ -0,0 +1,169 @@
+ * {@code MetadataStoreListFilesIterator} is a {@link RemoteIterator} that
+ * is similar to {@code DescendantsIterator} but does not return directories
+ * that have (or may have) children, and will also provide access to the set of
+ * tombstones to allow recently deleted S3 objects to be filtered out from a
+ * corresponding request. In other words, it returns tombstones and the same
+ * set of objects that should exist in S3: empty directories, and files, and not
+ * other directories whose existence is inferred therefrom.
+ * for (MetadataStoreListFilesIterator files =
+ * new MetadataStoreListFilesIterator(dir1); files.hasNext(); ) {
+ * final FileStatus status = files.next().getFileStatus();
+public class MetadataStoreListFilesIterator implements
+ RemoteIterator<FileStatus> {
+ MetadataStoreListFilesIterator.class);
+ private final boolean allowAuthoritative;
+ private final Set<Path> tombstones = new HashSet<>();
+ private Iterator<FileStatus> leafNodesIterator = null;
+ public MetadataStoreListFilesIterator(MetadataStore ms, PathMetadata meta,
+ boolean allowAuthoritative) throws IOException {
+ this.allowAuthoritative = allowAuthoritative;
+ prefetch(meta);
+ private void prefetch(PathMetadata meta) throws IOException {
+ final Queue<PathMetadata> queue = new LinkedList<>();
+ final Collection<FileStatus> leafNodes = new ArrayList<>();
+ DirListingMetadata rootListing = metadataStore.listChildren(path);
+ tombstones.addAll(rootListing.listTombstones());
+ queue.addAll(rootListing.withoutTombstones().getListing());
+ while(!queue.isEmpty()) {
+ PathMetadata nextMetadata = queue.poll();
+ FileStatus nextStatus = nextMetadata.getFileStatus();
+ if (nextStatus.isFile()) {
+ // All files are leaf nodes by definition
+ leafNodes.add(nextStatus);
+ if (nextStatus.isDirectory()) {
+ final Path path = nextStatus.getPath();
+ DirListingMetadata children = metadataStore.listChildren(path);
+ if (children != null) {
+ tombstones.addAll(children.listTombstones());
+ Collection<PathMetadata> liveChildren =
+ children.withoutTombstones().getListing();
+ if (!liveChildren.isEmpty()) {
+ // If it's a directory, has children, not all deleted, then we
+ // add the children to the queue and move on to the next node
+ queue.addAll(liveChildren);
+ } else if (allowAuthoritative && children.isAuthoritative()) {
+ // Directories that *might* be empty are ignored for now, since we
+ // cannot confirm that they are empty without incurring other costs.
+ // Users of this class can still discover empty directories via S3's
+ // fake directories, subject to the same consistency semantics as before.
+ // The only other possibility is a symlink, which is unsupported on S3A.
+ leafNodesIterator = leafNodes.iterator();
+ public boolean hasNext() {
+ return leafNodesIterator.hasNext();
+ public FileStatus next() {
+ return leafNodesIterator.next();
@@ -0,0 +1,104 @@
+ * A no-op implementation of MetadataStore. Clients that use this
+ * implementation should behave the same as they would without any
+ * MetadataStore.
+public class NullMetadataStore implements MetadataStore {
+ public void put(Collection<PathMetadata> meta) throws IOException {
+ public void prune(long modTime) {
+ return "NullMetadataStore";
@@ -0,0 +1,143 @@
+ * {@code PathMetadata} models path metadata stored in the
+ * {@link MetadataStore}.
+public class PathMetadata {
+ private final FileStatus fileStatus;
+ private boolean isDeleted;
+ * Create a tombstone from the current time.
+ * @param path path to tombstone
+ * @return the entry.
+ public static PathMetadata tombstone(Path path) {
+ long now = System.currentTimeMillis();
+ FileStatus status = new FileStatus(0, false, 0, 0, now, path);
+ return new PathMetadata(status, Tristate.UNKNOWN, true);
+ * Creates a new {@code PathMetadata} containing given {@code FileStatus}.
+ * @param fileStatus file status containing an absolute path.
+ public PathMetadata(FileStatus fileStatus) {
+ this(fileStatus, Tristate.UNKNOWN);
+ public PathMetadata(FileStatus fileStatus, Tristate isEmptyDir) {
+ this(fileStatus, isEmptyDir, false);
+ public PathMetadata(FileStatus fileStatus, Tristate isEmptyDir, boolean
+ isDeleted) {
+ Preconditions.checkNotNull(fileStatus, "fileStatus must be non-null");
+ Preconditions.checkNotNull(fileStatus.getPath(), "fileStatus path must be" +
+ " non-null");
+ Preconditions.checkArgument(fileStatus.getPath().isAbsolute(), "path must" +
+ " be absolute");
+ this.fileStatus = fileStatus;
+ this.isEmptyDirectory = isEmptyDir;
+ this.isDeleted = isDeleted;
+ * @return {@code FileStatus} contained in this {@code PathMetadata}.
+ public final FileStatus getFileStatus() {
+ return fileStatus;
+ * Query if a directory is empty.
+ * @return Tristate.TRUE if this is known to be an empty directory,
+ * Tristate.FALSE if known to not be empty, and Tristate.UNKNOWN if the
+ * MetadataStore does have enough information to determine either way.
+ return isEmptyDirectory;
+ void setIsEmptyDirectory(Tristate isEmptyDirectory) {
+ this.isEmptyDirectory = isEmptyDirectory;
+ public boolean isDeleted() {
+ return isDeleted;
+ void setIsDeleted(boolean isDeleted) {
+ public boolean equals(Object o) {
+ if (!(o instanceof PathMetadata)) {
+ return this.fileStatus.equals(((PathMetadata)o).fileStatus);
+ public int hashCode() {
+ return fileStatus.hashCode();
+ return "PathMetadata{" +
+ "fileStatus=" + fileStatus +
+ "; isEmptyDirectory=" + isEmptyDirectory +
+ "; isDeleted=" + isDeleted +
+ sb.append(String.format("%-5s %-20s %-7d %-8s %-6s",
+ fileStatus.isDirectory() ? "dir" : "file",
+ fileStatus.getPath().toString(), fileStatus.getLen(),
+ isEmptyDirectory.name(), isDeleted));
+ sb.append(fileStatus);
@@ -0,0 +1,304 @@
+import com.amazonaws.services.dynamodbv2.document.KeyAttribute;
+import com.amazonaws.services.dynamodbv2.model.AttributeDefinition;
+import com.amazonaws.services.dynamodbv2.model.KeySchemaElement;
+import com.amazonaws.services.dynamodbv2.model.KeyType;
+import com.amazonaws.services.dynamodbv2.model.ScalarAttributeType;
+import org.apache.commons.lang3.StringUtils;
+ * Defines methods for translating between domain model objects and their
+ * representations in the DynamoDB schema.
+final class PathMetadataDynamoDBTranslation {
+ /** The HASH key name of each item. */
+ static final String PARENT = "parent";
+ /** The RANGE key name of each item. */
+ static final String CHILD = "child";
+ static final String IS_DIR = "is_dir";
+ static final String MOD_TIME = "mod_time";
+ static final String FILE_LENGTH = "file_length";
+ static final String BLOCK_SIZE = "block_size";
+ static final String IS_DELETED = "is_deleted";
+ /** Table version field {@value} in version marker item. */
+ static final String TABLE_VERSION = "table_version";
+ /** Table creation timestampfield {@value} in version marker item. */
+ static final String TABLE_CREATED = "table_created";
+ /** The version marker field is invalid. */
+ static final String E_NOT_VERSION_MARKER = "Not a version marker: ";
+ * Returns the key schema for the DynamoDB table.
+ * @return DynamoDB key schema
+ static Collection<KeySchemaElement> keySchema() {
+ return Arrays.asList(
+ new KeySchemaElement(PARENT, KeyType.HASH),
+ new KeySchemaElement(CHILD, KeyType.RANGE));
+ * Returns the attribute definitions for the DynamoDB table.
+ * @return DynamoDB attribute definitions
+ static Collection<AttributeDefinition> attributeDefinitions() {
+ new AttributeDefinition(PARENT, ScalarAttributeType.S),
+ new AttributeDefinition(CHILD, ScalarAttributeType.S));
+ * Converts a DynamoDB item to a {@link PathMetadata}.
+ * @param item DynamoDB item to convert
+ * @return {@code item} converted to a {@link PathMetadata}
+ static PathMetadata itemToPathMetadata(Item item, String username)
+ String parentStr = item.getString(PARENT);
+ Preconditions.checkNotNull(parentStr, "No parent entry in item %s", item);
+ String childStr = item.getString(CHILD);
+ Preconditions.checkNotNull(childStr, "No child entry in item %s", item);
+ // Skip table version markers, which are only non-absolute paths stored.
+ Path rawPath = new Path(parentStr, childStr);
+ if (!rawPath.isAbsoluteAndSchemeAuthorityNull()) {
+ Path parent = new Path(Constants.FS_S3A + ":/" + parentStr + "/");
+ Path path = new Path(parent, childStr);
+ boolean isDir = item.hasAttribute(IS_DIR) && item.getBoolean(IS_DIR);
+ final FileStatus fileStatus;
+ fileStatus = DynamoDBMetadataStore.makeDirStatus(path, username);
+ long len = item.hasAttribute(FILE_LENGTH) ? item.getLong(FILE_LENGTH) : 0;
+ long modTime = item.hasAttribute(MOD_TIME) ? item.getLong(MOD_TIME) : 0;
+ long block = item.hasAttribute(BLOCK_SIZE) ? item.getLong(BLOCK_SIZE) : 0;
+ fileStatus = new FileStatus(len, false, 1, block, modTime, 0, null,
+ username, username, path);
+ boolean isDeleted =
+ item.hasAttribute(IS_DELETED) && item.getBoolean(IS_DELETED);
+ return new PathMetadata(fileStatus, Tristate.UNKNOWN, isDeleted);
+ * Converts a {@link PathMetadata} to a DynamoDB item.
+ * @param meta {@link PathMetadata} to convert
+ * @return {@code meta} converted to DynamoDB item
+ static Item pathMetadataToItem(PathMetadata meta) {
+ final Item item = new Item().withPrimaryKey(pathToKey(status.getPath()));
+ item.withBoolean(IS_DIR, true);
+ item.withLong(FILE_LENGTH, status.getLen())
+ .withLong(MOD_TIME, status.getModificationTime())
+ .withLong(BLOCK_SIZE, status.getBlockSize());
+ item.withBoolean(IS_DELETED, meta.isDeleted());
+ return item;
+ * The version marker has a primary key whose PARENT is {@code name};
+ * this MUST NOT be a value which represents an absolute path.
+ * @param name name of the version marker
+ * @param version version number
+ * @param timestamp creation timestamp
+ * @return an item representing a version marker.
+ static Item createVersionMarker(String name, int version, long timestamp) {
+ return new Item().withPrimaryKey(createVersionMarkerPrimaryKey(name))
+ .withInt(TABLE_VERSION, version)
+ .withLong(TABLE_CREATED, timestamp);
+ * Create the primary key of the version marker.
+ * @param name key name
+ * @return the key to use when registering or resolving version markers
+ static PrimaryKey createVersionMarkerPrimaryKey(String name) {
+ return new PrimaryKey(PARENT, name, CHILD, name);
+ * Extract the version from a version marker item.
+ * @param marker version marker item
+ * @return the extracted version field
+ * @throws IOException if the item is not a version marker
+ static int extractVersionFromMarker(Item marker) throws IOException {
+ if (marker.hasAttribute(TABLE_VERSION)) {
+ return marker.getInt(TABLE_VERSION);
+ throw new IOException(E_NOT_VERSION_MARKER + marker);
+ * Extract the creation time, if present.
+ * @return the creation time, or null
+ static Long extractCreationTimeFromMarker(Item marker) throws IOException {
+ if (marker.hasAttribute(TABLE_CREATED)) {
+ return marker.getLong(TABLE_CREATED);
+ * Converts a collection {@link PathMetadata} to a collection DynamoDB items.
+ * @see #pathMetadataToItem(PathMetadata)
+ static Item[] pathMetadataToItem(Collection<PathMetadata> metas) {
+ if (metas == null) {
+ final Item[] items = new Item[metas.size()];
+ int i = 0;
+ items[i++] = pathMetadataToItem(meta);
+ return items;
+ * Converts a {@link Path} to a DynamoDB equality condition on that path as
+ * parent, suitable for querying all direct children of the path.
+ * @param path the path; can not be null
+ * @return DynamoDB equality condition on {@code path} as parent
+ static KeyAttribute pathToParentKeyAttribute(Path path) {
+ return new KeyAttribute(PARENT, pathToParentKey(path));
+ * e.g. {@code pathToParentKey(s3a://bucket/path/a) -> /bucket/path/a}
+ * @param path path to convert
+ * @return string for parent key
+ static String pathToParentKey(Path path) {
+ Preconditions.checkArgument(path.isUriPathAbsolute(), "Path not absolute");
+ String bucket = uri.getHost();
+ Preconditions.checkArgument(!StringUtils.isEmpty(bucket),
+ "Path missing bucket");
+ String pKey = "/" + bucket + uri.getPath();
+ // Strip trailing slash
+ if (pKey.endsWith("/")) {
+ pKey = pKey.substring(0, pKey.length() - 1);
+ return pKey;
+ * Converts a {@link Path} to a DynamoDB key, suitable for getting the item
+ * matching the path.
+ * @return DynamoDB key for item matching {@code path}
+ static PrimaryKey pathToKey(Path path) {
+ Preconditions.checkArgument(!path.isRoot(),
+ "Root path is not mapped to any PrimaryKey");
+ return new PrimaryKey(PARENT, pathToParentKey(path.getParent()), CHILD,
+ path.getName());
+ * Converts a collection of {@link Path} to a collection of DynamoDB keys.
+ * @see #pathToKey(Path)
+ static PrimaryKey[] pathToKey(Collection<Path> paths) {
+ if (paths == null) {
+ final PrimaryKey[] keys = new PrimaryKey[paths.size()];
+ for (Path p : paths) {
+ keys[i++] = pathToKey(p);
+ return keys;
+ * There is no need to instantiate this class.
+ private PathMetadataDynamoDBTranslation() {
@@ -0,0 +1,463 @@
+import org.apache.hadoop.fs.s3a.S3AFileStatus;
+import static org.apache.hadoop.fs.s3a.Constants.S3_METADATA_STORE_IMPL;
+import static org.apache.hadoop.fs.s3a.Statistic.S3GUARD_METADATASTORE_PUT_PATH_LATENCY;
+import static org.apache.hadoop.fs.s3a.Statistic.S3GUARD_METADATASTORE_PUT_PATH_REQUEST;
+import static org.apache.hadoop.fs.s3a.S3AUtils.createUploadFileStatus;
+ * Logic for integrating MetadataStore with S3A.
+public final class S3Guard {
+ private static final Logger LOG = LoggerFactory.getLogger(S3Guard.class);
+ @InterfaceAudience.Private
+ public static final String S3GUARD_DDB_CLIENT_FACTORY_IMPL =
+ "fs.s3a.s3guard.ddb.client.factory.impl";
+ static final Class<? extends DynamoDBClientFactory>
+ S3GUARD_DDB_CLIENT_FACTORY_IMPL_DEFAULT =
+ DynamoDBClientFactory.DefaultDynamoDBClientFactory.class;
+ private static final FileStatus[] EMPTY_LISTING = new FileStatus[0];
+ // Utility class. All static functions.
+ private S3Guard() { }
+ /* Utility functions. */
+ * Create a new instance of the configured MetadataStore.
+ * The returned MetadataStore will have been initialized via
+ * {@link MetadataStore#initialize(FileSystem)} by this function before
+ * returning it. Callers must clean up by calling
+ * {@link MetadataStore#close()} when done using the MetadataStore.
+ * @param fs FileSystem whose Configuration specifies which
+ * implementation to use.
+ * @return Reference to new MetadataStore.
+ * @throws IOException if the metadata store cannot be instantiated
+ public static MetadataStore getMetadataStore(FileSystem fs)
+ Preconditions.checkNotNull(fs);
+ Configuration conf = fs.getConf();
+ MetadataStore msInstance;
+ Class<? extends MetadataStore> msClass = getMetadataStoreClass(conf);
+ msInstance = ReflectionUtils.newInstance(msClass, conf);
+ LOG.debug("Using {} metadata store for {} filesystem",
+ msClass.getSimpleName(), fs.getScheme());
+ msInstance.initialize(fs);
+ return msInstance;
+ } catch (RuntimeException | IOException e) {
+ String message = "Failed to instantiate metadata store " +
+ conf.get(S3_METADATA_STORE_IMPL)
+ + " defined in " + S3_METADATA_STORE_IMPL
+ + ": " + e;
+ LOG.error(message, e);
+ if (e instanceof IOException) {
+ throw new IOException(message, e);
+ private static Class<? extends MetadataStore> getMetadataStoreClass(
+ if (conf == null) {
+ return NullMetadataStore.class;
+ return conf.getClass(S3_METADATA_STORE_IMPL, NullMetadataStore.class,
+ MetadataStore.class);
+ * Helper function which puts a given S3AFileStatus into the MetadataStore and
+ * returns the same S3AFileStatus. Instrumentation monitors the put operation.
+ * @param ms MetadataStore to {@code put()} into.
+ * @param status status to store
+ * @param instrumentation instrumentation of the s3a file system
+ * @return The same status as passed in
+ * @throws IOException if metadata store update failed
+ public static S3AFileStatus putAndReturn(MetadataStore ms,
+ S3AFileStatus status,
+ S3AInstrumentation instrumentation) throws IOException {
+ long startTimeNano = System.nanoTime();
+ ms.put(new PathMetadata(status));
+ instrumentation.addValueToQuantiles(S3GUARD_METADATASTORE_PUT_PATH_LATENCY,
+ (System.nanoTime() - startTimeNano));
+ instrumentation.incrementCounter(S3GUARD_METADATASTORE_PUT_PATH_REQUEST, 1);
+ * Convert the data of a directory listing to an array of {@link FileStatus}
+ * entries. Tombstones are filtered out at this point. If the listing is null
+ * an empty array is returned.
+ * @param dirMeta directory listing -may be null
+ * @return a possibly-empty array of file status entries
+ public static FileStatus[] dirMetaToStatuses(DirListingMetadata dirMeta) {
+ if (dirMeta == null) {
+ return EMPTY_LISTING;
+ Collection<PathMetadata> listing = dirMeta.getListing();
+ List<FileStatus> statuses = new ArrayList<>();
+ for (PathMetadata pm : listing) {
+ if (!pm.isDeleted()) {
+ statuses.add(pm.getFileStatus());
+ return statuses.toArray(new FileStatus[0]);
+ * Given directory listing metadata from both the backing store and the
+ * MetadataStore, merge the two sources of truth to create a consistent
+ * view of the current directory contents, which can be returned to clients.
+ * Also update the MetadataStore to reflect the resulting directory listing.
+ * @param ms MetadataStore to use.
+ * @param path path to directory
+ * @param backingStatuses Directory listing from the backing store.
+ * @param dirMeta Directory listing from MetadataStore. May be null.
+ * @param isAuthoritative State of authoritative mode
+ * @return Final result of directory listing.
+ public static FileStatus[] dirListingUnion(MetadataStore ms, Path path,
+ List<FileStatus> backingStatuses, DirListingMetadata dirMeta,
+ boolean isAuthoritative) throws IOException {
+ // Fast-path for NullMetadataStore
+ if (isNullMetadataStore(ms)) {
+ return backingStatuses.toArray(new FileStatus[backingStatuses.size()]);
+ assertQualified(path);
+ // The metadataStore had zero state for this directory
+ dirMeta = new DirListingMetadata(path, DirListingMetadata.EMPTY_DIR,
+ false);
+ Set<Path> deleted = dirMeta.listTombstones();
+ // Since we treat the MetadataStore as a "fresher" or "consistent" view
+ // of metadata, we always use its metadata first.
+ // Since the authoritative case is already handled outside this function,
+ // we will basically start with the set of directory entries in the
+ // DirListingMetadata, and add any that only exist in the backingStatuses.
+ boolean changed = false;
+ for (FileStatus s : backingStatuses) {
+ if (deleted.contains(s.getPath())) {
+ // Minor race condition here. Multiple threads could add to this
+ // mutable DirListingMetadata. Since it is backed by a
+ // ConcurrentHashMap, the last put() wins.
+ // More concerning is two threads racing on listStatus() and delete().
+ // Any FileSystem has similar race conditions, but we could persist
+ // a stale entry longer. We could expose an atomic
+ // DirListingMetadata#putIfNotPresent()
+ boolean updated = dirMeta.put(s);
+ changed = changed || updated;
+ if (changed && isAuthoritative) {
+ dirMeta.setAuthoritative(true); // This is the full directory contents
+ ms.put(dirMeta);
+ return dirMetaToStatuses(dirMeta);
+ * Although NullMetadataStore does nothing, callers may wish to avoid work
+ * (fast path) when the NullMetadataStore is in use.
+ * @param ms The MetadataStore to test
+ * @return true iff the MetadataStore is the null, or no-op, implementation.
+ public static boolean isNullMetadataStore(MetadataStore ms) {
+ return (ms instanceof NullMetadataStore);
+ * Update MetadataStore to reflect creation of the given directories.
+ * If an IOException is raised while trying to update the entry, this
+ * operation catches the exception and returns.
+ * @param ms MetadataStore to update.
+ * @param dirs null, or an ordered list of directories from leaf to root.
+ * E.g. if /a/ exists, and mkdirs(/a/b/c/d) is called, this
+ * list will contain [/a/b/c/d, /a/b/c, /a/b]. /a/b/c/d is
+ * an empty, dir, and the other dirs only contain their child
+ * dir.
+ * @param owner Hadoop user name.
+ * @param authoritative Whether to mark new directories as authoritative.
+ public static void makeDirsOrdered(MetadataStore ms, List<Path> dirs,
+ String owner, boolean authoritative) {
+ if (dirs == null) {
+ /* We discussed atomicity of this implementation.
+ * The concern is that multiple clients could race to write different
+ * cached directories to the MetadataStore. Two solutions are proposed:
+ * 1. Move mkdirs() into MetadataStore interface and let implementations
+ * ensure they are atomic.
+ * 2. Specify that the semantics of MetadataStore#putListStatus() is
+ * always additive, That is, if MetadataStore has listStatus() state
+ * for /a/b that contains [/a/b/file0, /a/b/file1], and we then call
+ * putListStatus(/a/b -> [/a/b/file2, /a/b/file3], isAuthoritative=true),
+ * then we will end up with final state of
+ * [/a/b/file0, /a/b/file1, /a/b/file2, /a/b/file3], isAuthoritative =
+ * true
+ FileStatus prevStatus = null;
+ // Use new batched put to reduce round trips.
+ List<PathMetadata> pathMetas = new ArrayList<>(dirs.size());
+ // Iterate from leaf to root
+ for (int i = 0; i < dirs.size(); i++) {
+ boolean isLeaf = (prevStatus == null);
+ Path f = dirs.get(i);
+ assertQualified(f);
+ FileStatus status =
+ createUploadFileStatus(f, true, 0, 0, owner);
+ // We only need to put a DirListingMetadata if we are setting
+ // authoritative bit
+ DirListingMetadata dirMeta = null;
+ if (authoritative) {
+ Collection<PathMetadata> children;
+ if (isLeaf) {
+ children = DirListingMetadata.EMPTY_DIR;
+ children = new ArrayList<>(1);
+ children.add(new PathMetadata(prevStatus));
+ dirMeta = new DirListingMetadata(f, children, authoritative);
+ pathMetas.add(new PathMetadata(status));
+ prevStatus = status;
+ // Batched put
+ ms.put(pathMetas);
+ } catch (IOException ioe) {
+ LOG.error("MetadataStore#put() failure:", ioe);
+ * Helper function that records the move of directory paths, adding
+ * resulting metadata to the supplied lists.
+ * Does not store in MetadataStore.
+ * @param ms MetadataStore, used to make this a no-op, when it is
+ * NullMetadataStore.
+ * @param srcPaths stores the source path here
+ * @param dstMetas stores destination metadata here
+ * @param srcPath source path to store
+ * @param dstPath destination path to store
+ * @param owner file owner to use in created records
+ public static void addMoveDir(MetadataStore ms, Collection<Path> srcPaths,
+ Collection<PathMetadata> dstMetas, Path srcPath, Path dstPath,
+ assertQualified(srcPath, dstPath);
+ FileStatus dstStatus = createUploadFileStatus(dstPath, true, 0, 0, owner);
+ addMoveStatus(srcPaths, dstMetas, srcPath, dstStatus);
+ * Like {@link #addMoveDir(MetadataStore, Collection, Collection, Path,
+ * Path, String)} (), but for files.
+ * @param size length of file moved
+ * @param blockSize blocksize to associate with destination file
+ public static void addMoveFile(MetadataStore ms, Collection<Path> srcPaths,
+ long size, long blockSize, String owner) {
+ FileStatus dstStatus = createUploadFileStatus(dstPath, false,
+ size, blockSize, owner);
+ * Helper method that records the move of all ancestors of a path.
+ * In S3A, an optimization is to delete unnecessary fake directory objects if
+ * the directory is non-empty. In that case, for a nested child to move, S3A
+ * is not listing and thus moving all its ancestors (up to source root). So we
+ * take care of those inferred directories of this path explicitly.
+ * As {@link #addMoveFile} and {@link #addMoveDir}, this method adds resulting
+ * metadata to the supplied lists. It does not store in MetadataStore.
+ * @param ms MetadataStore, no-op if it is NullMetadataStore
+ * @param srcRoot source root up to which (exclusive) should we add ancestors
+ * @param srcPath source path of the child to add ancestors
+ * @param dstPath destination path of the child to add ancestors
+ * @param owner Hadoop user name
+ public static void addMoveAncestors(MetadataStore ms,
+ Collection<Path> srcPaths, Collection<PathMetadata> dstMetas,
+ Path srcRoot, Path srcPath, Path dstPath, String owner) {
+ assertQualified(srcRoot, srcPath, dstPath);
+ if (srcPath.equals(srcRoot)) {
+ LOG.debug("Skip moving ancestors of source root directory {}", srcRoot);
+ Path parentSrc = srcPath.getParent();
+ Path parentDst = dstPath.getParent();
+ while (parentSrc != null
+ && !parentSrc.isRoot()
+ && !parentSrc.equals(srcRoot)
+ && !srcPaths.contains(parentSrc)) {
+ LOG.debug("Renaming non-listed parent {} to {}", parentSrc, parentDst);
+ S3Guard.addMoveDir(ms, srcPaths, dstMetas, parentSrc, parentDst, owner);
+ parentSrc = parentSrc.getParent();
+ parentDst = parentDst.getParent();
+ public static void addAncestors(MetadataStore metadataStore,
+ Path qualifiedPath, String username) throws IOException {
+ Collection<PathMetadata> newDirs = new ArrayList<>();
+ Path parent = qualifiedPath.getParent();
+ while (!parent.isRoot()) {
+ PathMetadata directory = metadataStore.get(parent);
+ if (directory == null || directory.isDeleted()) {
+ FileStatus status = new FileStatus(0, true, 1, 0, 0, 0, null, username,
+ null, parent);
+ PathMetadata meta = new PathMetadata(status, Tristate.FALSE, false);
+ newDirs.add(meta);
+ metadataStore.put(newDirs);
+ private static void addMoveStatus(Collection<Path> srcPaths,
+ Collection<PathMetadata> dstMetas,
+ Path srcPath,
+ FileStatus dstStatus) {
+ srcPaths.add(srcPath);
+ dstMetas.add(new PathMetadata(dstStatus));
+ * Assert that the path is qualified with a host and scheme.
+ * @param p path to check
+ * @throws NullPointerException if either argument does not hold
+ public static void assertQualified(Path p) {
+ // Paths must include bucket in case MetadataStore is shared between
+ // multiple S3AFileSystem instances
+ Preconditions.checkNotNull(uri.getHost(), "Null host in " + uri);
+ // This should never fail, but is retained for completeness.
+ Preconditions.checkNotNull(uri.getScheme(), "Null scheme in " + uri);
+ * Assert that all paths are valid.
+ * @param paths path to check
+ public static void assertQualified(Path...paths) {
+ for (Path path : paths) {
@@ -0,0 +1,924 @@
+ * <p>
+import java.io.PrintStream;
+import java.util.Locale;
+import org.apache.hadoop.fs.LocatedFileStatus;
+import org.apache.hadoop.fs.shell.CommandFormat;
+import org.apache.hadoop.util.GenericOptionsParser;
+import org.apache.hadoop.util.Tool;
+import org.apache.hadoop.util.ToolRunner;
+ * CLI to manage S3Guard Metadata Store.
+public abstract class S3GuardTool extends Configured implements Tool {
+ private static final Logger LOG = LoggerFactory.getLogger(S3GuardTool.class);
+ private static final String NAME = "s3guard";
+ private static final String COMMON_USAGE =
+ "When possible and not overridden by more specific options, metadata\n" +
+ "repository information will be inferred from the S3A URL (if provided)" +
+ "\n\n" +
+ "Generic options supported are:\n" +
+ " -conf <config file> - specify an application configuration file\n" +
+ " -D <property=value> - define a value for a given property\n";
+ private static final String USAGE = NAME +
+ " [command] [OPTIONS] [s3a://BUCKET]\n\n" +
+ "Commands: \n" +
+ "\t" + Init.NAME + " - " + Init.PURPOSE + "\n" +
+ "\t" + Destroy.NAME + " - " + Destroy.PURPOSE + "\n" +
+ "\t" + Import.NAME + " - " + Import.PURPOSE + "\n" +
+ "\t" + Diff.NAME + " - " + Diff.PURPOSE + "\n" +
+ "\t" + Prune.NAME + " - " + Prune.PURPOSE + "\n";
+ private static final String DATA_IN_S3_IS_PRESERVED
+ = "(all data in S3 is preserved";
+ abstract public String getUsage();
+ // Exit codes
+ static final int SUCCESS = 0;
+ static final int INVALID_ARGUMENT = 1;
+ static final int ERROR = 99;
+ private S3AFileSystem filesystem;
+ private MetadataStore store;
+ private final CommandFormat commandFormat;
+ private static final String META_FLAG = "meta";
+ private static final String DAYS_FLAG = "days";
+ private static final String HOURS_FLAG = "hours";
+ private static final String MINUTES_FLAG = "minutes";
+ private static final String SECONDS_FLAG = "seconds";
+ private static final String REGION_FLAG = "region";
+ private static final String READ_FLAG = "read";
+ private static final String WRITE_FLAG = "write";
+ * Constructor a S3Guard tool with HDFS configuration.
+ protected S3GuardTool(Configuration conf) {
+ super(conf);
+ commandFormat = new CommandFormat(0, Integer.MAX_VALUE);
+ // For metadata store URI
+ commandFormat.addOptionWithValue(META_FLAG);
+ // DDB region.
+ commandFormat.addOptionWithValue(REGION_FLAG);
+ * Return sub-command name.
+ abstract String getName();
+ * Parse DynamoDB region from either -m option or a S3 path.
+ * This function should only be called from {@link Init} or
+ * {@link Destroy}.
+ * @param paths remaining parameters from CLI.
+ * @return false for invalid parameters.
+ * @throws IOException on I/O errors.
+ boolean parseDynamoDBRegion(List<String> paths) throws IOException {
+ String fromCli = getCommandFormat().getOptValue(REGION_FLAG);
+ String fromConf = conf.get(S3GUARD_DDB_REGION_KEY);
+ boolean hasS3Path = !paths.isEmpty();
+ if (fromCli != null) {
+ if (fromCli.isEmpty()) {
+ System.err.println("No region provided with -" + REGION_FLAG + " flag");
+ if (hasS3Path) {
+ System.err.println("Providing both an S3 path and the -" + REGION_FLAG
+ + " flag is not supported. If you need to specify a different "
+ + "region than the S3 bucket, configure " + S3GUARD_DDB_REGION_KEY);
+ conf.set(S3GUARD_DDB_REGION_KEY, fromCli);
+ if (fromConf != null) {
+ if (fromConf.isEmpty()) {
+ System.err.printf("No region provided with config %s, %n",
+ S3GUARD_DDB_REGION_KEY);
+ String s3Path = paths.get(0);
+ initS3AFileSystem(s3Path);
+ System.err.println("No region found from -" + REGION_FLAG + " flag, " +
+ "config, or S3 bucket");
+ * Parse metadata store from command line option or HDFS configuration.
+ * @param forceCreate override the auto-creation setting to true.
+ * @return a initialized metadata store.
+ MetadataStore initMetadataStore(boolean forceCreate) throws IOException {
+ if (getStore() != null) {
+ return getStore();
+ Configuration conf;
+ if (filesystem == null) {
+ conf = getConf();
+ conf = filesystem.getConf();
+ String metaURI = getCommandFormat().getOptValue(META_FLAG);
+ if (metaURI != null && !metaURI.isEmpty()) {
+ URI uri = URI.create(metaURI);
+ LOG.info("create metadata store: {}", uri + " scheme: "
+ + uri.getScheme());
+ switch (uri.getScheme().toLowerCase(Locale.ENGLISH)) {
+ case "local":
+ setStore(new LocalMetadataStore());
+ case "dynamodb":
+ setStore(new DynamoDBMetadataStore());
+ conf.set(S3GUARD_DDB_TABLE_NAME_KEY, uri.getAuthority());
+ if (forceCreate) {
+ conf.setBoolean(S3GUARD_DDB_TABLE_CREATE_KEY, true);
+ String.format("Metadata store %s is not supported", uri));
+ // CLI does not specify metadata store URI, it uses default metadata store
+ // DynamoDB instead.
+ getStore().initialize(conf);
+ getStore().initialize(filesystem);
+ LOG.info("Metadata store {} is initialized.", getStore());
+ * Initialize S3A FileSystem instance.
+ * @param path s3a URI
+ * @throws IOException
+ void initS3AFileSystem(String path) throws IOException {
+ URI uri;
+ uri = new URI(path);
+ throw new IOException(e);
+ // Make sure that S3AFileSystem does not hold an actual MetadataStore
+ // implementation.
+ conf.setClass(S3_METADATA_STORE_IMPL, NullMetadataStore.class,
+ FileSystem fs = FileSystem.get(uri, getConf());
+ if (!(fs instanceof S3AFileSystem)) {
+ String.format("URI %s is not a S3A file system: %s", uri,
+ fs.getClass().getName()));
+ filesystem = (S3AFileSystem) fs;
+ * Parse CLI arguments and returns the position arguments.
+ * The options are stored in {@link #commandFormat}
+ * @param args command line arguments.
+ * @return the position arguments from CLI.
+ List<String> parseArgs(String[] args) {
+ return getCommandFormat().parse(args, 1);
+ protected S3AFileSystem getFilesystem() {
+ return filesystem;
+ protected void setFilesystem(S3AFileSystem filesystem) {
+ this.filesystem = filesystem;
+ public MetadataStore getStore() {
+ return store;
+ protected void setStore(MetadataStore store) {
+ Preconditions.checkNotNull(store);
+ this.store = store;
+ protected CommandFormat getCommandFormat() {
+ return commandFormat;
+ * Create the metadata store.
+ static class Init extends S3GuardTool {
+ private static final String NAME = "init";
+ public static final String PURPOSE = "initialize metadata repository";
+ private static final String USAGE = NAME + " [OPTIONS] [s3a://BUCKET]\n" +
+ "\t" + PURPOSE + "\n\n" +
+ "Common options:\n" +
+ " -" + META_FLAG + " URL - Metadata repository details " +
+ "(implementation-specific)\n" +
+ "\n" +
+ "Amazon DynamoDB-specific options:\n" +
+ " -" + REGION_FLAG + " REGION - Service region for connections\n" +
+ " -" + READ_FLAG + " UNIT - Provisioned read throughput units\n" +
+ " -" + WRITE_FLAG + " UNIT - Provisioned write through put units\n" +
+ " URLs for Amazon DynamoDB are of the form dynamodb://TABLE_NAME.\n" +
+ " Specifying both the -" + REGION_FLAG + " option and an S3A path\n" +
+ " is not supported.";
+ Init(Configuration conf) {
+ // read capacity.
+ getCommandFormat().addOptionWithValue(READ_FLAG);
+ // write capacity.
+ getCommandFormat().addOptionWithValue(WRITE_FLAG);
+ String getName() {
+ return NAME;
+ public String getUsage() {
+ return USAGE;
+ public int run(String[] args) throws IOException {
+ List<String> paths = parseArgs(args);
+ String readCap = getCommandFormat().getOptValue(READ_FLAG);
+ if (readCap != null && !readCap.isEmpty()) {
+ int readCapacity = Integer.parseInt(readCap);
+ getConf().setInt(S3GUARD_DDB_TABLE_CAPACITY_READ_KEY, readCapacity);
+ String writeCap = getCommandFormat().getOptValue(WRITE_FLAG);
+ if (writeCap != null && !writeCap.isEmpty()) {
+ int writeCapacity = Integer.parseInt(writeCap);
+ getConf().setInt(S3GUARD_DDB_TABLE_CAPACITY_WRITE_KEY, writeCapacity);
+ // Validate parameters.
+ if (!parseDynamoDBRegion(paths)) {
+ System.err.println(USAGE);
+ return INVALID_ARGUMENT;
+ initMetadataStore(true);
+ return SUCCESS;
+ * Destroy a metadata store.
+ static class Destroy extends S3GuardTool {
+ private static final String NAME = "destroy";
+ public static final String PURPOSE = "destroy Metadata Store data "
+ + DATA_IN_S3_IS_PRESERVED;
+ Destroy(Configuration conf) {
+ initMetadataStore(false);
+ } catch (FileNotFoundException e) {
+ // indication that the table was not found
+ LOG.debug("Failed to bind to store to be destroyed", e);
+ LOG.info("Metadata Store does not exist.");
+ Preconditions.checkState(getStore() != null,
+ "Metadata Store is not initialized");
+ getStore().destroy();
+ LOG.info("Metadata store is deleted.");
+ * Import s3 metadata to the metadata store.
+ static class Import extends S3GuardTool {
+ private static final String NAME = "import";
+ public static final String PURPOSE = "import metadata from existing S3 " +
+ "data";
+ private final Set<Path> dirCache = new HashSet<>();
+ Import(Configuration conf) {
+ * Put parents into MS and cache if the parents are not presented.
+ * @param f the file or an empty directory.
+ private void putParentsIfNotPresent(FileStatus f) throws IOException {
+ Preconditions.checkNotNull(f);
+ Path parent = f.getPath().getParent();
+ while (parent != null) {
+ if (dirCache.contains(parent)) {
+ FileStatus dir = DynamoDBMetadataStore.makeDirStatus(parent,
+ f.getOwner());
+ getStore().put(new PathMetadata(dir));
+ dirCache.add(parent);
+ * Recursively import every path under path.
+ * @return number of items inserted into MetadataStore
+ private long importDir(FileStatus status) throws IOException {
+ Preconditions.checkArgument(status.isDirectory());
+ RemoteIterator<LocatedFileStatus> it = getFilesystem()
+ .listFilesAndEmptyDirectories(status.getPath(), true);
+ long items = 0;
+ while (it.hasNext()) {
+ LocatedFileStatus located = it.next();
+ FileStatus child;
+ if (located.isDirectory()) {
+ child = DynamoDBMetadataStore.makeDirStatus(located.getPath(),
+ located.getOwner());
+ dirCache.add(child.getPath());
+ child = new S3AFileStatus(located.getLen(),
+ located.getModificationTime(),
+ located.getPath(),
+ located.getBlockSize(),
+ putParentsIfNotPresent(child);
+ getStore().put(new PathMetadata(child));
+ items++;
+ if (paths.isEmpty()) {
+ System.err.println(getUsage());
+ uri = new URI(s3Path);
+ String filePath = uri.getPath();
+ if (filePath.isEmpty()) {
+ // If they specify a naked S3 URI (e.g. s3a://bucket), we'll consider
+ // root to be the path
+ filePath = "/";
+ Path path = new Path(filePath);
+ FileStatus status = getFilesystem().getFileStatus(path);
+ long items = 1;
+ if (status.isFile()) {
+ PathMetadata meta = new PathMetadata(status);
+ getStore().put(meta);
+ items = importDir(status);
+ System.out.printf("Inserted %d items into Metadata Store%n", items);
+ * Show diffs between the s3 and metadata store.
+ static class Diff extends S3GuardTool {
+ private static final String NAME = "diff";
+ public static final String PURPOSE = "report on delta between S3 and " +
+ "repository";
+ private static final String USAGE = NAME + " [OPTIONS] s3a://BUCKET\n" +
+ private static final String SEP = "\t";
+ static final String S3_PREFIX = "S3";
+ static final String MS_PREFIX = "MS";
+ Diff(Configuration conf) {
+ * Formats the output of printing a FileStatus in S3guard diff tool.
+ * @param status the status to print.
+ * @return the string of output.
+ private static String formatFileStatus(FileStatus status) {
+ return String.format("%s%s%d%s%s",
+ status.isDirectory() ? "D" : "F",
+ SEP,
+ status.getLen(),
+ status.getPath().toString());
+ * Compares metadata from 2 S3 FileStatus's to see if they differ.
+ * @param thisOne
+ * @param thatOne
+ * @return true if the metadata is not identical
+ private static boolean differ(FileStatus thisOne, FileStatus thatOne) {
+ Preconditions.checkArgument(!(thisOne == null && thatOne == null));
+ return (thisOne == null || thatOne == null) ||
+ (thisOne.getLen() != thatOne.getLen()) ||
+ (thisOne.isDirectory() != thatOne.isDirectory()) ||
+ (!thisOne.isDirectory() &&
+ thisOne.getModificationTime() != thatOne.getModificationTime());
+ * Print difference, if any, between two file statuses to the output stream.
+ * @param msStatus file status from metadata store.
+ * @param s3Status file status from S3.
+ * @param out output stream.
+ private static void printDiff(FileStatus msStatus,
+ FileStatus s3Status,
+ PrintStream out) {
+ Preconditions.checkArgument(!(msStatus == null && s3Status == null));
+ if (msStatus != null && s3Status != null) {
+ msStatus.getPath().equals(s3Status.getPath()),
+ String.format("The path from metadata store and s3 are different:" +
+ " ms=%s s3=%s", msStatus.getPath(), s3Status.getPath()));
+ if (differ(msStatus, s3Status)) {
+ if (s3Status != null) {
+ out.printf("%s%s%s%n", S3_PREFIX, SEP, formatFileStatus(s3Status));
+ if (msStatus != null) {
+ out.printf("%s%s%s%n", MS_PREFIX, SEP, formatFileStatus(msStatus));
+ * Compare the metadata of the directory with the same path, on S3 and
+ * the metadata store, respectively. If one of them is null, consider the
+ * metadata of the directory and all its subdirectories are missing from
+ * the source.
+ * Pass the FileStatus obtained from s3 and metadata store to avoid one
+ * round trip to fetch the same metadata twice, because the FileStatus
+ * hve already been obtained from listStatus() / listChildren operations.
+ * @param msDir the directory FileStatus obtained from the metadata store.
+ * @param s3Dir the directory FileStatus obtained from S3.
+ * @param out the output stream to generate diff results.
+ private void compareDir(FileStatus msDir, FileStatus s3Dir,
+ PrintStream out) throws IOException {
+ Preconditions.checkArgument(!(msDir == null && s3Dir == null));
+ if (msDir != null && s3Dir != null) {
+ Preconditions.checkArgument(msDir.getPath().equals(s3Dir.getPath()),
+ " ms=%s s3=%s", msDir.getPath(), s3Dir.getPath()));
+ Map<Path, FileStatus> s3Children = new HashMap<>();
+ if (s3Dir != null && s3Dir.isDirectory()) {
+ for (FileStatus status : getFilesystem().listStatus(s3Dir.getPath())) {
+ s3Children.put(status.getPath(), status);
+ Map<Path, FileStatus> msChildren = new HashMap<>();
+ if (msDir != null && msDir.isDirectory()) {
+ DirListingMetadata dirMeta =
+ getStore().listChildren(msDir.getPath());
+ if (dirMeta != null) {
+ for (PathMetadata meta : dirMeta.getListing()) {
+ msChildren.put(status.getPath(), status);
+ Set<Path> allPaths = new HashSet<>(s3Children.keySet());
+ allPaths.addAll(msChildren.keySet());
+ for (Path path : allPaths) {
+ FileStatus s3Status = s3Children.get(path);
+ FileStatus msStatus = msChildren.get(path);
+ printDiff(msStatus, s3Status, out);
+ if ((s3Status != null && s3Status.isDirectory()) ||
+ (msStatus != null && msStatus.isDirectory())) {
+ compareDir(msStatus, s3Status, out);
+ out.flush();
+ * Compare both metadata store and S3 on the same path.
+ * @param path the path to be compared.
+ * @param out the output stream to display results.
+ private void compareRoot(Path path, PrintStream out) throws IOException {
+ Path qualified = getFilesystem().qualify(path);
+ FileStatus s3Status = null;
+ s3Status = getFilesystem().getFileStatus(qualified);
+ PathMetadata meta = getStore().get(qualified);
+ FileStatus msStatus = (meta != null && !meta.isDeleted()) ?
+ meta.getFileStatus() : null;
+ public int run(String[] args, PrintStream out) throws IOException {
+ out.println(USAGE);
+ Path root;
+ if (uri.getPath().isEmpty()) {
+ root = new Path("/");
+ root = new Path(uri.getPath());
+ root = getFilesystem().qualify(root);
+ compareRoot(root, out);
+ return run(args, System.out);
+ * Prune metadata that has not been modified recently.
+ static class Prune extends S3GuardTool {
+ private static final String NAME = "prune";
+ public static final String PURPOSE = "truncate older metadata from " +
+ "repository "
+ + DATA_IN_S3_IS_PRESERVED;;
+ Prune(Configuration conf) {
+ CommandFormat format = getCommandFormat();
+ format.addOptionWithValue(DAYS_FLAG);
+ format.addOptionWithValue(HOURS_FLAG);
+ format.addOptionWithValue(MINUTES_FLAG);
+ format.addOptionWithValue(SECONDS_FLAG);
+ void setMetadataStore(MetadataStore ms) {
+ this.setStore(ms);
+ private long getDeltaComponent(TimeUnit unit, String arg) {
+ String raw = getCommandFormat().getOptValue(arg);
+ if (raw == null || raw.isEmpty()) {
+ Long parsed = Long.parseLong(raw);
+ return unit.toMillis(parsed);
+ public int run(String[] args, PrintStream out) throws
+ InterruptedException, IOException {
+ long confDelta = conf.getLong(Constants.S3GUARD_CLI_PRUNE_AGE, 0);
+ long cliDelta = 0;
+ cliDelta += getDeltaComponent(TimeUnit.DAYS, "days");
+ cliDelta += getDeltaComponent(TimeUnit.HOURS, "hours");
+ cliDelta += getDeltaComponent(TimeUnit.MINUTES, "minutes");
+ cliDelta += getDeltaComponent(TimeUnit.SECONDS, "seconds");
+ if (confDelta <= 0 && cliDelta <= 0) {
+ System.err.println(
+ "You must specify a positive age for metadata to prune.");
+ // A delta provided on the CLI overrides if one is configured
+ long delta = confDelta;
+ if (cliDelta > 0) {
+ delta = cliDelta;
+ long divide = now - delta;
+ getStore().prune(divide);
+ public int run(String[] args) throws InterruptedException, IOException {
+ private static S3GuardTool command;
+ private static void printHelp() {
+ if (command == null) {
+ System.err.println("Usage: hadoop " + USAGE);
+ System.err.println("\tperform S3Guard metadata store " +
+ "administrative commands.");
+ System.err.println("Usage: hadoop " + command.getUsage());
+ System.err.println();
+ System.err.println(COMMON_USAGE);
+ * Execute the command with the given arguments.
+ * @param args command specific arguments.
+ * @param conf Hadoop configuration.
+ * @return exit code.
+ * @throws Exception on I/O errors.
+ public static int run(String[] args, Configuration conf) throws
+ /* ToolRunner.run does this too, but we must do it before looking at
+ subCommand or instantiating the cmd object below */
+ String[] otherArgs = new GenericOptionsParser(conf, args)
+ .getRemainingArgs();
+ if (otherArgs.length == 0) {
+ printHelp();
+ final String subCommand = otherArgs[0];
+ switch (subCommand) {
+ case Init.NAME:
+ command = new Init(conf);
+ case Destroy.NAME:
+ command = new Destroy(conf);
+ case Import.NAME:
+ command = new Import(conf);
+ case Diff.NAME:
+ command = new Diff(conf);
+ case Prune.NAME:
+ command = new Prune(conf);
+ return ToolRunner.run(conf, command, otherArgs);
+ * Main entry point. Calls {@code System.exit()} on all execution paths.
+ * @param args argument list
+ public static void main(String[] args) {
+ int ret = run(args, new Configuration());
+ System.exit(ret);
+ } catch (CommandFormat.UnknownOptionException e) {
+ System.err.println(e.getMessage());
+ System.exit(INVALID_ARGUMENT);
+ e.printStackTrace(System.err);
+ System.exit(ERROR);
@@ -0,0 +1,30 @@
+ * This package contains classes related to S3Guard: a feature of S3A to mask
+ * the eventual consistency behavior of S3 and optimize access patterns by
+ * coordinating with a strongly consistent external store for file system
+ * metadata.
@@ -105,6 +105,10 @@ public final class S3xLoginHelper {
* @return a login tuple, possibly empty.
public static Login extractLoginDetails(URI name) {
+ if (name == null) {
+ return Login.EMPTY;
String authority = name.getAuthority();
if (authority == null) {
@@ -41,6 +41,7 @@ See also:
* [Testing](testing.html)
* [Troubleshooting S3a](troubleshooting_s3a.html)
+* [S3Guard](s3guard.html)
### Warning #1: Object Stores are not filesystems
@@ -1595,7 +1596,7 @@ for `fs.s3a.server-side-encryption-algorithm` is `AES256`.
SSE-KMS is where the user specifies a Customer Master Key(CMK) that is used to
encrypt the objects. The user may specify a specific CMK or leave the
-`fs.s3a.server-side-encryption-key` empty to use the default auto-generated key
+`fs.s3a.server-side-encryption.key` empty to use the default auto-generated key
in AWS IAM. Each CMK configured in AWS IAM is region specific, and cannot be
used in a in a S3 bucket in a different region. There is can also be policies
assigned to the CMK that prohibit or restrict its use for users causing S3A
@@ -0,0 +1,610 @@
+<!---
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+ http://www.apache.org/licenses/LICENSE-2.0
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License. See accompanying LICENSE file.
+# S3Guard: Consistency and Metadata Caching for S3A
+**Experimental Feature**
+<!-- MACRO{toc|fromDepth=0|toDepth=5} -->
+## Overview
+*S3Guard* is an experimental feature for the S3A client of the S3 object store,
+which can use a (consistent) database as the store of metadata about objects
+in an S3 bucket.
+S3Guard
+1. May improve performance on directory listing/scanning operations,
+including those which take place during the partitioning period of query
+execution, the process where files are listed and the work divided up amongst
+processes.
+1. Permits a consistent view of the object store. Without this, changes in
+objects may not be immediately visible, especially in listing operations.
+1. Offers a platform for future performance improvements for running Hadoop
+workloads on top of object stores
+The basic idea is that, for each operation in the Hadoop S3 client (s3a) that
+reads or modifies metadata, a shadow copy of that metadata is stored in a
+separate MetadataStore implementation. Each MetadataStore implementation
+offers HDFS-like consistency for the metadata, and may also provide faster
+lookups for things like file status or directory listings.
+For links to early design documents and related patches, see
+[HADOOP-13345](https://issues.apache.org/jira/browse/HADOOP-13345).
+*Important*
+* S3Guard is experimental and should be considered unstable.
+* While all underlying data is persisted in S3, if, for some reason,
+the S3Guard-cached metadata becomes inconsistent with that in S3,
+queries on the data may become incorrect.
+For example, new datasets may be omitted, objects may be overwritten,
+or clients may not be aware that some data has been deleted.
+It is essential for all clients writing to an S3Guard-enabled
+S3 Repository to use the feature. Clients reading the data may work directly
+with the S3A data, in which case the normal S3 consistency guarantees apply.
+## Setting up S3Guard
+The latest configuration parameters are defined in `core-default.xml`. You
+should consult that file for full information, but a summary is provided here.
+### 1. Choose the Database
+A core concept of S3Guard is that the directory listing data of the object
+store, *the metadata* is replicated in a higher-performance, consistent,
+database. In S3Guard, this database is called *The Metadata Store*
+By default, S3Guard is not enabled.
+The Metadata Store to use in production is bonded to Amazon's DynamoDB
+database service. The following setting will enable this Metadata Store:
+```xml
+ <value>org.apache.hadoop.fs.s3a.s3guard.DynamoDBMetadataStore</value>
+```
+Note that the `NullMetadataStore` store can be explicitly requested if desired.
+This offers no metadata storage, and effectively disables S3Guard.
+### 2. Configure S3Guard Settings
+More settings will may be added in the future.
+Currently the only Metadata Store-independent setting, besides the
+implementation class above, is the *allow authoritative* flag.
+It is recommended that you leave the default setting here:
+Setting this to `true` is currently an experimental feature. When true, the
+S3A client will avoid round-trips to S3 when getting directory listings, if
+there is a fully-cached version of the directory stored in the Metadata Store.
+Note that if this is set to true, it may exacerbate or persist existing race
+conditions around multiple concurrent modifications and listings of a given
+directory tree.
+In particular: **If the Metadata Store is declared as authoritative,
+all interactions with the S3 bucket(s) must be through S3A clients sharing
+the same Metadata Store**
+### 3. Configure the Metadata Store.
+Here are the `DynamoDBMetadataStore` settings. Other Metadata Store
+implementations will have their own configuration parameters.
+### 4. Name Your Table
+First, choose the name of the table you wish to use for the S3Guard metadata
+storage in your DynamoDB instance. If you leave it unset/empty, a
+separate table will be created for each S3 bucket you access, and that
+bucket's name will be used for the name of the DynamoDB table. For example,
+this sets the table name to `my-ddb-table-name`
+ <value>my-ddb-table-name</value>
+ S3 bucket names will be used.
+It is good to share a table across multiple buckets for multiple reasons.
+1. You are billed for the I/O capacity allocated to the table,
+*even when the table is not used*. Sharing capacity can reduce costs.
+1. You can share the "provision burden" across the buckets. That is, rather
+than allocating for the peak load on a single bucket, you can allocate for
+the peak load *across all the buckets*, which is likely to be significantly
+lower.
+1. It's easier to measure and tune the load requirements and cost of
+S3Guard, because there is only one table to review and configure in the
+AWS management console.
+When wouldn't you want to share a table?
+1. When you do explicitly want to provision I/O capacity to a specific bucket
+and table, isolated from others.
+1. When you are using separate billing for specific buckets allocated
+to specific projects.
+1. When different users/roles have different access rights to different buckets.
+As S3Guard requires all users to have R/W access to the table, all users will
+be able to list the metadata in all buckets, even those to which they lack
+read access.
+### 5. Locate your Table
+You may also wish to specify the region to use for DynamoDB. If a region
+is not configured, S3A will assume that it is in the same region as the S3
+bucket. A list of regions for the DynamoDB service can be found in
+[Amazon's documentation](http://docs.aws.amazon.com/general/latest/gr/rande.html#ddb_region).
+In this example, to use the US West 2 region:
+ <value>us-west-2</value>
+When working with S3Guard-managed buckets from EC2 VMs running in AWS
+infrastructure, using a local DynamoDB region ensures the lowest latency
+and highest reliability, as well as avoiding all long-haul network charges.
+The S3Guard tables, and indeed, the S3 buckets, should all be in the same
+region as the VMs.
+### 6. Optional: Create your Table
+Next, you can choose whether or not the table will be automatically created
+(if it doesn't already exist). If you want this feature, set the
+`fs.s3a.s3guard.ddb.table.create` option to `true`.
+ <value>true</value>
+### 7. If creating a table: Set your DynamoDB IO Capacity
+Next, you need to set the DynamoDB read and write throughput requirements you
+expect to need for your cluster. Setting higher values will cost you more
+money. *Note* that these settings only affect table creation when
+`fs.s3a.s3guard.ddb.table.create` is enabled. To change the throughput for
+an existing table, use the AWS console or CLI tool.
+For more details on DynamoDB capacity units, see the AWS page on [Capacity
+Unit Calculations](http://docs.aws.amazon.com/amazondynamodb/latest/developerguide/WorkingWithTables.html#CapacityUnitCalculations).
+The charges are incurred per hour for the life of the table, *even when the
+table and the underlying S3 buckets are not being used*.
+There are also charges incurred for data storage and for data IO outside of the
+region of the DynamoDB instance. S3Guard only stores metadata in DynamoDB: path names
+and summary details of objects —the actual data is stored in S3, so billed at S3
+rates.
+Attempting to perform more IO than the capacity requested simply throttles the
+IO; small capacity numbers are recommended when initially experimenting
+with S3Guard.
+## Authenticating with S3Guard
+The DynamoDB metadata store takes advantage of the fact that the DynamoDB
+service uses the same authentication mechanisms as S3. S3Guard
+gets all its credentials from the S3A client that is using it.
+All existing S3 authentication mechanisms can be used, except for one
+exception. Credentials placed in URIs are not supported for S3Guard, for security
+reasons.
+## Per-bucket S3Guard configuration
+In production, it is likely only some buckets will have S3Guard enabled;
+those which are read-only may have disabled, for example. Equally importantly,
+buckets in different regions should have different tables, each
+in the relevant region.
+These options can be managed through S3A's [per-bucket configuration
+mechanism](./index.html#Configuring_different_S3_buckets).
+All options with the under `fs.s3a.bucket.BUCKETNAME.KEY` are propagated
+to the options `fs.s3a.KEY` *for that bucket only*.
+As an example, here is a configuration to use different metadata stores
+and tables for different buckets
+First, we define shortcuts for the metadata store classnames
+ <name>s3guard.null</name>
+ <name>s3guard.dynamo</name>
+Next, Amazon's public landsat database is configured with no
+metadata store
+ <name>fs.s3a.bucket.landsat-pds.metadatastore.impl</name>
+ <value>${s3guard.null}</value>
+ <description>The read-only landsat-pds repository isn't
+ managed by S3Guard</description>
+Next the `ireland-2` and `ireland-offline` buckets are configured with
+DynamoDB as the store, and a shared table `production-table`
+ <name>fs.s3a.bucket.ireland-2.metadatastore.impl</name>
+ <value>${s3guard.dynamo}</value>
+ <name>fs.s3a.bucket.ireland-offline.metadatastore.impl</name>
+ <name>fs.s3a.bucket.ireland-2.s3guard.ddb.table</name>
+ <value>production-table</value>
+The region of this table is automatically set to be that of the buckets,
+here `eu-west-1`; the same table name may actually be used in different
+regions.
+Together then, this configuration enables the DynamoDB Metadata Store
+for two buckets with a shared table, while disabling it for the public
+bucket.
+## S3Guard Command Line Interface (CLI)
+Note that in some cases an AWS region or `s3a://` URI can be provided.
+Metadata store URIs include a scheme that designates the backing store. For
+example (e.g. `dynamodb://table_name`;). As documented above, the
+AWS region can be inferred if the URI to an existing bucket is provided.
+The S3A URI must also be provided for per-bucket configuration options
+to be picked up. That is: when an s3a URL is provided on the command line,
+all its "resolved" per-bucket settings are used to connect to, authenticate
+with and configure the S3Guard table. If no such URL is provided, then
+the base settings are picked up.
+### Create a table: `s3guard init`
+```bash
+hadoop s3guard init -meta URI ( -region REGION | s3a://BUCKET )
+Creates and initializes an empty metadata store.
+A DynamoDB metadata store can be initialized with additional parameters
+pertaining to [Provisioned Throughput](http://docs.aws.amazon.com/amazondynamodb/latest/developerguide/HowItWorks.ProvisionedThroughput.html):
+[-write PROVISIONED_WRITES] [-read PROVISIONED_READS]
+Example 1
+hadoop s3guard init -meta dynamodb://ireland-team -write 5 -read 10 s3a://ireland-1
+Creates a table "ireland-team" with a capacity of 5 for writes, 10 for reads,
+in the same location as the bucket "ireland-1".
+Example 2
+hadoop s3guard init -meta dynamodb://ireland-team -region eu-west-1
+Creates a table "ireland-team" in the same region "s3-eu-west-1.amazonaws.com"
+### Import a bucket: `s3guard import`
+hadoop s3guard import [-meta URI] s3a://BUCKET
+Pre-populates a metadata store according to the current contents of an S3
+bucket. If the `-meta` option is omitted, the binding information is taken
+from the `core-site.xml` configuration.
+Example
+hadoop s3guard import s3a://ireland-1
+### Audit a table: `s3guard diff`
+hadoop s3guard diff [-meta URI] s3a://BUCKET
+Lists discrepancies between a metadata store and bucket. Note that depending on
+how S3Guard is used, certain discrepancies are to be expected.
+hadoop s3guard diff s3a://ireland-1
+### Delete a table: `s3guard destroy`
+Deletes a metadata store. With DynamoDB as the store, this means
+the specific DynamoDB table use to store the metadata.
+hadoop s3guard destroy [-meta URI] ( -region REGION | s3a://BUCKET )
+This *does not* delete the bucket, only the S3Guard table which it is bound
+to.
+Examples
+hadoop s3guard destroy s3a://ireland-1
+Deletes the table which the bucket ireland-1 is configured to use
+as its MetadataStore.
+hadoop s3guard destroy -meta dynamodb://ireland-team -region eu-west-1
+### Clean up a table, `s3guard prune`
+Delete all file entries in the MetadataStore table whose object "modification
+time" is older than the specified age.
+hadoop s3guard prune [-days DAYS] [-hours HOURS] [-minutes MINUTES]
+ [-seconds SECONDS] [-m URI] ( -region REGION | s3a://BUCKET )
+A time value must be supplied.
+1. This does not delete the entries in the bucket itself.
+1. The modification time is effectively the creation time of the objects
+in the S3 Bucket.
+1. Even when an S3A URI is supplied, all entries in the table older than
+a specific age are deleted — even those from other buckets.
+hadoop s3guard prune -days 7 s3a://ireland-1
+Deletes all entries in the S3Guard table for files older than seven days from
+the table associated with `s3a://ireland-1`.
+hadoop s3guard prune -hours 1 -minutes 30 -meta dynamodb://ireland-team -region eu-west-1
+Delete all entries more than 90 minutes old from the table "ireland-team" in
+the region "eu-west-1".
+## Debugging and Error Handling
+If you run into network connectivity issues, or have a machine failure in the
+middle of an operation, you may end up with your metadata store having state
+that differs from S3. The S3Guard CLI commands, covered in the CLI section
+above, can be used to diagnose and repair these issues.
+There are some logs whose log level can be increased to provide more
+information.
+```properties
+# Log S3Guard classes
+log4j.logger.org.apache.hadoop.fs.s3a.s3guard=DEBUG
+# Log all S3A classes
+log4j.logger.org.apache.hadoop.fs.s3a=DEBUG
+# Enable debug logging of AWS DynamoDB client
+log4j.logger.com.amazonaws.services.dynamodbv2.AmazonDynamoDB
+# Log all HTTP requests made; includes S3 interaction. This may
+# include sensitive information such as account IDs in HTTP headers.
+log4j.logger.com.amazonaws.request=DEBUG
+If all else fails, S3Guard is designed to allow for easy recovery by deleting
+the metadata store data. In DynamoDB, this can be accomplished by simply
+deleting the table, and allowing S3Guard to recreate it from scratch. Note
+that S3Guard tracks recent changes to file metadata to implement consistency.
+Deleting the metadata store table will simply result in a period of eventual
+consistency for any file modifications that were made right before the table
+was deleted.
+### Failure Semantics
+Operations which modify metadata will make changes to S3 first. If, and only
+if, those operations succeed, the equivalent changes will be made to the
+Metadata Store.
+These changes to S3 and Metadata Store are not fully-transactional: If the S3
+operations succeed, and the subsequent Metadata Store updates fail, the S3
+changes will *not* be rolled back. In this case, an error message will be
+logged.
+### Versioning
+S3Guard tables are created with a version marker, an entry with the primary
+key and child entry of `../VERSION`; the use of a relative path guarantees
+that it will not be resolved.
+#### Versioning policy.
+1. The version number of an S3Guard table will only be incremented when
+an incompatible change is made to the table structure —that is, the structure
+has changed so that it is no longer readable by older versions, or because
+it has added new mandatory fields which older versions do not create.
+1. The version number of S3Guard tables will only be changed by incrementing
+the value.
+1. Updated versions of S3Guard MAY continue to support older version tables.
+1. If an incompatible change is made such that existing tables are not compatible,
+then a means shall be provided to update existing tables. For example:
+an option in the Command Line Interface, or an option to upgrade tables
+during S3Guard initialization.
+*Note*: this policy does not indicate any intent to upgrade table structures
+in an incompatible manner. The version marker in tables exists to support
+such an option if it ever becomes necessary, by ensuring that all S3Guard
+client can recognise any version mismatch.
+### Security
+All users of the DynamoDB table must have write access to it. This
+effectively means they must have write access to the entire object store.
+There's not been much testing of using a S3Guard Metadata Store
+with a read-only S3 Bucket. It *should* work, provided all users
+have write access to the DynamoDB table. And, as updates to the Metadata Store
+are only made after successful file creation, deletion and rename, the
+store is *unlikely* to get out of sync, it is still something which
+merits more testing before it could be considered reliable.
+### Troubleshooting
+#### Error: `S3Guard table lacks version marker.`
+The table which was intended to be used as a S3guard metadata store
+does not have any version marker indicating that it is a S3Guard table.
+It may be that this is not a S3Guard table.
+* Make sure that this is the correct table name.
+* Delete the table, so it can be rebuilt.
+#### Error: `Database table is from an incompatible S3Guard version`
+This indicates that the version of S3Guard which created (or possibly updated)
+the database table is from a different version that that expected by the S3A
+client.
+This error will also include the expected and actual version numbers.
+If the expected version is lower than the actual version, then the version
+of the S3A client library is too old to interact with this S3Guard-managed
+bucket. Upgrade the application/library.
+If the expected version is higher than the actual version, then the table
+itself will need upgrading.
+#### Error `"DynamoDB table TABLE does not exist in region REGION; auto-creation is turned off"`
+S3Guard could not find the DynamoDB table for the Metadata Store,
+and it was not configured to create it. Either the table was missing,
+or the configuration is preventing S3Guard from finding the table.
+1. Verify that the value of `fs.s3a.s3guard.ddb.table` is correct.
+1. If the region for an existing table has been set in
+`fs.s3a.s3guard.ddb.region`, verify that the value is correct.
+1. If the region is not set, verify that the table exists in the same
+region as the bucket being used.
+1. Create the table if necessary.
@@ -108,6 +108,10 @@ each filesystem for its testing.
1. `fs.contract.test.fs.s3n` : the URL of the bucket for S3n filesystem contract tests
1. `fs.contract.test.fs.s3a` : the URL of the bucket for S3a filesystem contract tests
+*Note* that running s3a and s3n tests in parallel mode, against the same bucket
+is unreliable. We recommend using separate buckets or testing one connector
+at a time.
The contents of each bucket will be destroyed during the test process:
do not use the bucket for any purpose other than testing. Furthermore, for
s3a, all in-progress multi-part uploads to the bucket will be aborted at the
@@ -601,7 +605,7 @@ use requires the presence of secret credentials, where tests may be slow,
and where finding out why something failed from nothing but the test output
is critical.
-#### Subclasses Existing Shared Base Blasses
+#### Subclasses Existing Shared Base Classes
Extend `AbstractS3ATestBase` or `AbstractSTestS3AHugeFiles` unless justifiable.
These set things up for testing against the object stores, provide good threadnames,
@@ -745,7 +749,7 @@ Example:
### How to keep your credentials really safe
-Although the `auth-keys.xml` file is marged as ignored in git and subversion,
+Although the `auth-keys.xml` file is marked as ignored in git and subversion,
it is still in your source tree, and there's always that risk that it may
creep out.
@@ -760,3 +764,283 @@ using an absolute XInclude reference to it.
```
+# Failure Injection
+**Warning do not enable any type of failure injection in production. The
+following settings are for testing only.**
+One of the challenges with S3A integration tests is the fact that S3 is an
+eventually-consistent storage system. In practice, we rarely see delays in
+visibility of recently created objects both in listings (`listStatus()`) and
+when getting a single file's metadata (`getFileStatus()`). Since this behavior
+is rare and non-deterministic, thorough integration testing is challenging.
+To address this, S3A supports a shim layer on top of the `AmazonS3Client`
+class which artificially delays certain paths from appearing in listings.
+This is implemented in the class `InconsistentAmazonS3Client`.
+## Simulating List Inconsistencies
+### Enabling the InconsistentAmazonS3CClient
+There are two ways of enabling the `InconsistentAmazonS3Client`: at
+config-time, or programmatically. For an example of programmatic test usage,
+see `ITestS3GuardListConsistency`.
+To enable the fault-injecting client via configuration, switch the
+S3A client to use the "Inconsistent S3 Client Factory" when connecting to
+S3:
+ <name>fs.s3a.s3.client.factory.impl</name>
+ <value>org.apache.hadoop.fs.s3a.InconsistentS3ClientFactory</value>
+The inconsistent client works by:
+1. Choosing which objects will be "inconsistent" at the time the object is
+created or deleted.
+2. When `listObjects()` is called, any keys that we have marked as
+inconsistent above will not be returned in the results (until the
+configured delay has elapsed). Similarly, deleted items may be *added* to
+missing results to delay the visibility of the delete.
+There are two ways of choosing which keys (filenames) will be affected: By
+substring, and by random probability.
+ <name>fs.s3a.failinject.inconsistency.key.substring</name>
+ <value>DELAY_LISTING_ME</value>
+ <name>fs.s3a.failinject.inconsistency.probability</name>
+ <value>1.0</value>
+By default, any object which has the substring "DELAY_LISTING_ME" in its key
+will subject to delayed visibility. For example, the path
+`s3a://my-bucket/test/DELAY_LISTING_ME/file.txt` would match this condition.
+To match all keys use the value "\*" (a single asterisk). This is a special
+value: *We don't support arbitrary wildcards.*
+The default probability of delaying an object is 1.0. This means that *all*
+keys that match the substring will get delayed visibility. Note that we take
+the logical *and* of the two conditions (substring matches *and* probability
+random chance occurs). Here are some example configurations:
+| substring | probability | behavior |
+|-----------|-------------|--------------------------------------------|
+| | 0.001 | An empty <value> tag in .xml config will |
+| | | be interpreted as unset and revert to the |
+| | | default value, "DELAY_LISTING_ME" |
+| | | |
+| * | 0.001 | 1/1000 chance of *any* key being delayed. |
+| delay | 0.01 | 1/100 chance of any key containing "delay" |
+| delay | 1.0 | All keys containing substring "delay" .. |
+You can also configure how long you want the delay in visibility to last.
+The default is 5000 milliseconds (five seconds).
+ <name>fs.s3a.failinject.inconsistency.msec</name>
+ <value>5000</value>
+Future versions of this client will introduce new failure modes,
+with simulation of S3 throttling exceptions the next feature under
+development.
+### Limitations of Inconsistency Injection
+Although `InconsistentAmazonS3Client` can delay the visibility of an object
+or parent directory, it does not prevent the key of that object from
+appearing in all prefix searches. For example, if we create the following
+object with the default configuration above, in an otherwise empty bucket:
+s3a://bucket/a/b/c/DELAY_LISTING_ME
+Then the following paths will still be visible as directories (ignoring
+possible real-world inconsistencies):
+s3a://bucket/a
+s3a://bucket/a/b
+Whereas `getFileStatus()` on the following *will* be subject to delayed
+visibility (`FileNotFoundException` until delay has elapsed):
+s3a://bucket/a/b/c
+In real-life S3 inconsistency, however, we expect that all the above paths
+(including `a` and `b`) will be subject to delayed visiblity.
+### Using the `InconsistentAmazonS3CClient` in downstream integration tests
+The inconsistent client is shipped in the `hadoop-aws` JAR, so it can
+be used in applications which work with S3 to see how they handle
+inconsistent directory listings.
+## Testing S3Guard
+The basic strategy for testing S3Guard correctness consists of:
+1. MetadataStore Contract tests.
+ The MetadataStore contract tests are inspired by the Hadoop FileSystem and
+ `FileContext` contract tests. Each implementation of the `MetadataStore` interface
+ subclasses the `MetadataStoreTestBase` class and customizes it to initialize
+ their MetadataStore. This test ensures that the different implementations
+ all satisfy the semantics of the MetadataStore API.
+2. Running existing S3A unit and integration tests with S3Guard enabled.
+ You can run the S3A integration tests on top of S3Guard by configuring your
+ `MetadataStore` in your
+ `hadoop-tools/hadoop-aws/src/test/resources/core-site.xml` or
+ `hadoop-tools/hadoop-aws/src/test/resources/auth-keys.xml` files.
+ Next run the S3A integration tests as outlined in the *Running the Tests* section
+ of the [S3A documentation](./index.html)
+3. Running fault-injection tests that test S3Guard's consistency features.
+ The `ITestS3GuardListConsistency` uses failure injection to ensure
+ that list consistency logic is correct even when the underlying storage is
+ eventually consistent.
+ The integration test adds a shim above the Amazon S3 Client layer that injects
+ delays in object visibility.
+ All of these tests will be run if you follow the steps listed in step 2 above.
+ No charges are incurred for using this store, and its consistency
+ guarantees are that of the underlying object store instance. <!-- :) -->
+## Testing S3A with S3Guard Enabled
+All the S3A tests which work with a private repository can be configured to
+run with S3Guard by using the `s3guard` profile. When set, this will run
+all the tests with local memory for the metadata set to "non-authoritative" mode.
+mvn -T 1C verify -Dparallel-tests -DtestsThreadCount=6 -Ds3guard
+When the `s3guard` profile is enabled, following profiles can be specified:
+* `dynamo`: use an AWS-hosted DynamoDB table; creating the table if it does
+ not exist. You will have to pay the bills for DynamoDB web service.
+* `dynamodblocal`: use an in-memory DynamoDBLocal server instead of real AWS
+ DynamoDB web service; launch the server and creating the table.
+ You won't be charged bills for using DynamoDB in test. As it runs in-JVM,
+ the table isn't shared across other tests running in parallel.
+* `non-auth`: treat the S3Guard metadata as authorative.
+mvn -T 1C verify -Dparallel-tests -DtestsThreadCount=6 -Ds3guard -Ddynamo -Dauth
+When experimenting with options, it is usually best to run a single test suite
+at a time until the operations appear to be working.
+mvn -T 1C verify -Dtest=skip -Dit.test=ITestS3AMiscOperations -Ds3guard -Ddynamo
+### Notes
+1. If the `s3guard` profile is not set, then the S3Guard properties are those
+of the test configuration set in `contract-test-options.xml` or `auth-keys.xml`
+If the `s3guard` profile *is* set,
+1. The S3Guard options from maven (the dynamo and authoritative flags)
+ overwrite any previously set in the configuration files.
+1. DynamoDB will be configured to create any missing tables.
+### Warning About Concurrent Tests
+You must not run S3A and S3N tests in parallel on the same bucket. This is
+especially true when S3Guard is enabled. S3Guard requires that all clients
+that are modifying the bucket have S3Guard enabled, so having S3N
+integration tests running in parallel with S3A tests will cause strange
+failures.
+### Scale Testing MetadataStore Directly
+There are some scale tests that exercise Metadata Store implementations
+directly. These ensure that S3Guard is are robust to things like DynamoDB
+throttling, and compare performance for different implementations. These
+are included in the scale tests executed when `-Dscale` is passed to
+the maven command line.
+The two S3Guard scale testse are `ITestDynamoDBMetadataStoreScale` and
+`ITestLocalMetadataStoreScale`. To run the DynamoDB test, you will need to
+define your table name and region in your test configuration. For example,
+the following settings allow us to run `ITestDynamoDBMetadataStoreScale` with
+artificially low read and write capacity provisioned, so we can judge the
+effects of being throttled by the DynamoDB service:
+ <name>scale.test.operation.count</name>
+ <value>10</value>
+ <name>scale.test.directory.count</name>
+ <value>3</value>
+ <name>fs.s3a.scale.test.enabled</name>
+ <value>my-scale-test</value>
+### Testing only: Local Metadata Store
+There is an in-memory Metadata Store for testing.
+ <value>org.apache.hadoop.fs.s3a.s3guard.LocalMetadataStore</value>
+This is not for use in production.
@@ -22,11 +22,25 @@ import org.apache.hadoop.conf.Configuration;
import org.apache.hadoop.fs.contract.AbstractContractCreateTest;
import org.apache.hadoop.fs.contract.AbstractFSContract;
+import static org.apache.hadoop.fs.s3a.S3ATestUtils.maybeEnableS3Guard;
* S3A contract tests creating files.
public class ITestS3AContractCreate extends AbstractContractCreateTest {
+ * Create a configuration, possibly patching in S3Guard options.
+ * @return a configuration
+ protected Configuration createConfiguration() {
+ Configuration conf = super.createConfiguration();
+ // patch in S3Guard options
+ maybeEnableS3Guard(conf);
+ return conf;
protected AbstractFSContract createContract(Configuration conf) {
return new S3AContract(conf);
import org.apache.hadoop.fs.contract.AbstractContractDeleteTest;
* S3A contract tests covering deletes.
public class ITestS3AContractDelete extends AbstractContractDeleteTest {
@@ -20,6 +20,7 @@ package org.apache.hadoop.fs.contract.s3a;
import static org.apache.hadoop.fs.s3a.Constants.*;
import static org.apache.hadoop.fs.s3a.S3ATestConstants.SCALE_TEST_TIMEOUT_MILLIS;
import org.apache.hadoop.tools.contract.AbstractContractDistCpTest;
@@ -38,12 +39,18 @@ public class ITestS3AContractDistCp extends AbstractContractDistCpTest {
return SCALE_TEST_TIMEOUT_MILLIS;
protected Configuration createConfiguration() {
Configuration newConf = super.createConfiguration();
newConf.setLong(MULTIPART_SIZE, MULTIPART_SETTING);
newConf.setBoolean(FAST_UPLOAD, true);
newConf.set(FAST_UPLOAD_BUFFER, FAST_UPLOAD_BUFFER_DISK);
+ maybeEnableS3Guard(newConf);
return newConf;
@@ -23,6 +23,8 @@ import org.apache.hadoop.fs.contract.AbstractContractGetFileStatusTest;
import org.apache.hadoop.fs.s3a.Constants;
import org.apache.hadoop.fs.s3a.S3ATestUtils;
* S3A contract tests covering getFileStatus.
@@ -46,6 +48,8 @@ public class ITestS3AContractGetFileStatus
S3ATestUtils.disableFilesystemCaching(conf);
// aggressively low page size forces tests to go multipage
conf.setInt(Constants.MAX_PAGING_KEYS, 2);
return conf;
import org.apache.hadoop.fs.contract.AbstractContractMkdirTest;
* Test dir operations on S3A.
public class ITestS3AContractMkdir extends AbstractContractMkdirTest {
import org.apache.hadoop.fs.contract.AbstractContractOpenTest;
* S3A contract tests opening files.
public class ITestS3AContractOpen extends AbstractContractOpenTest {
@@ -26,12 +26,25 @@ import org.apache.hadoop.fs.Path;
import static org.apache.hadoop.fs.contract.ContractTestUtils.dataset;
import static org.apache.hadoop.fs.contract.ContractTestUtils.writeDataset;
* S3A contract tests covering rename.
public class ITestS3AContractRename extends AbstractContractRenameTest {
@@ -28,6 +28,8 @@ import org.apache.hadoop.fs.contract.AbstractFSContract;
import org.slf4j.LoggerFactory;
* root dir operations against an S3 bucket.
@@ -37,6 +39,18 @@ public class ITestS3AContractRootDir extends
private static final Logger LOG =
LoggerFactory.getLogger(ITestS3AContractRootDir.class);
import org.apache.hadoop.fs.contract.AbstractContractSeekTest;
* S3A contract tests covering file seek.
public class ITestS3AContractSeek extends AbstractContractSeekTest {
@@ -26,6 +26,8 @@ import com.amazonaws.services.s3.AmazonS3;
+import org.apache.hadoop.fs.s3a.s3guard.MetadataStore;
+import org.apache.hadoop.fs.s3a.s3guard.NullMetadataStore;
import org.junit.After;
import org.junit.Before;
@@ -33,7 +35,8 @@ import org.junit.Rule;
import org.junit.rules.ExpectedException;
- * Abstract base class for S3A unit tests using a mock S3 client.
+ * Abstract base class for S3A unit tests using a mock S3 client and a null
+ * metadata store.
public abstract class AbstractS3AMockTest {
@@ -55,6 +58,10 @@ public abstract class AbstractS3AMockTest {
Configuration conf = new Configuration();
conf.setClass(S3_CLIENT_FACTORY_IMPL, MockS3ClientFactory.class,
S3ClientFactory.class);
+ // We explicitly disable MetadataStore even if it's configured. For unit
+ // test we don't issue request to AWS DynamoDB service.
fs = new S3AFileSystem();
URI uri = URI.create(FS_S3A + "://" + BUCKET);
fs.initialize(uri, conf);
@@ -33,6 +33,7 @@ import java.io.IOException;
* An extension of the contract test base set up for S3A tests.
@@ -65,6 +66,18 @@ public abstract class AbstractS3ATestBase extends AbstractFSContractTestBase
return S3A_TEST_TIMEOUT;
protected Configuration getConfiguration() {
return getContract().getConf();
@@ -99,10 +112,21 @@ public abstract class AbstractS3ATestBase extends AbstractFSContractTestBase
protected Path writeThenReadFile(String name, int len) throws IOException {
Path path = path(name);
+ writeThenReadFile(path, len);
+ * Write a file, read it back, validate the dataset. Overwrites the file
+ * if it is present
+ * @param path path to file
+ * @param len length of file
+ * @throws IOException any IO problem
+ protected void writeThenReadFile(Path path, int len) throws IOException {
byte[] data = dataset(len, 'a', 'z');
writeDataset(getFileSystem(), path, data, data.length, 1024 * 1024, true);
ContractTestUtils.verifyFileContents(getFileSystem(), path, data);
- return path;
@@ -140,6 +140,10 @@ public class ITestS3AAWSCredentialsProvider {
createFailingFS(conf);
} catch (AccessDeniedException e) {
// expected
+ } catch (AWSServiceIOException e) {
+ GenericTestUtils.assertExceptionContains(
+ "UnrecognizedClientException", e);
+ // expected
@@ -25,6 +25,7 @@ import com.amazonaws.services.s3.S3ClientOptions;
import org.apache.commons.lang.StringUtils;
import org.apache.commons.lang.reflect.FieldUtils;
import org.apache.hadoop.fs.contract.ContractTestUtils;
import org.apache.hadoop.fs.s3native.S3xLoginHelper;
@@ -516,7 +517,7 @@ public class ITestS3AConfiguration {
assertEquals("username", alice, fs.getUsername());
- S3AFileStatus status = fs.getFileStatus(new Path("/"));
+ FileStatus status = fs.getFileStatus(new Path("/"));
assertEquals("owner in " + status, alice, status.getOwner());
assertEquals("group in " + status, alice, status.getGroup());
@@ -19,6 +19,7 @@
import org.apache.hadoop.io.IOUtils;
@@ -37,6 +38,7 @@ import java.net.URLEncoder;
import java.nio.file.AccessDeniedException;
import static org.apache.hadoop.fs.s3a.S3ATestConstants.TEST_FS_S3A_NAME;
+import static org.apache.hadoop.fs.s3a.S3ATestUtils.assumeS3GuardState;
* Tests that credentials can go into the URL. This includes a valid
@@ -63,6 +65,11 @@ public class ITestS3ACredentialsInURL extends Assert {
public void testInstantiateFromURL() throws Throwable {
+ // Skip in the case of S3Guard with DynamoDB because it cannot get
+ // credentials for its own use if they're only in S3 URLs
+ assumeS3GuardState(false, conf);
String accessKey = conf.get(Constants.ACCESS_KEY);
String secretKey = conf.get(Constants.SECRET_KEY);
String fsname = conf.getTrimmed(TEST_FS_S3A_NAME, "");
@@ -84,6 +91,7 @@ public class ITestS3ACredentialsInURL extends Assert {
conf.unset(Constants.ACCESS_KEY);
conf.unset(Constants.SECRET_KEY);
fs = S3ATestUtils.createTestFileSystem(conf);
String fsURI = fs.getUri().toString();
assertFalse("FS URI contains a @ symbol", fsURI.contains("@"));
assertFalse("FS URI contains a % symbol", fsURI.contains("%"));
@@ -119,13 +127,14 @@ public class ITestS3ACredentialsInURL extends Assert {
Assume.assumeNotNull(fsname);
URI original = new URI(fsname);
URI testURI = createUriWithEmbeddedSecrets(original, "user", "//");
conf.set(TEST_FS_S3A_NAME, testURI.toString());
fail("Expected an AccessDeniedException, got " + status);
@@ -0,0 +1,62 @@
+import org.apache.hadoop.fs.FSDataInputStream;
+import org.apache.hadoop.fs.contract.ContractTestUtils;
+import org.apache.hadoop.test.LambdaTestUtils;
+import org.junit.Test;
+import java.util.concurrent.Callable;
+ * Tests behavior of a FileNotFound error that happens after open(), i.e. on
+ * the first read.
+public class ITestS3ADelayedFNF extends AbstractS3ATestBase {
+ * See debugging documentation
+ * <a href="https://cwiki.apache.org/confluence/display/HADOOP/S3A%3A+FileNotFound+Exception+on+Read">here</a>.
+ * @throws Exception
+ public void testNotFoundFirstRead() throws Exception {
+ FileSystem fs = getFileSystem();
+ Path p = path("some-file");
+ ContractTestUtils.createFile(fs, p, false, new byte[] {20, 21, 22});
+ final FSDataInputStream in = fs.open(p);
+ assertDeleted(p, false);
+ // This should fail since we deleted after the open.
+ LambdaTestUtils.intercept(FileNotFoundException.class,
+ new Callable<Integer>() {
+ public Integer call() throws Exception {
+ return in.read();
+ });
@@ -0,0 +1,83 @@
+ * Tests which exercise treatment of empty/non-empty directories.
+public class ITestS3AEmptyDirectory extends AbstractS3ATestBase {
+ public void testDirectoryBecomesEmpty() throws Exception {
+ S3AFileSystem fs = getFileSystem();
+ // 1. set up non-empty dir
+ Path dir = path("testEmptyDir");
+ Path child = path("testEmptyDir/dir2");
+ mkdirs(child);
+ S3AFileStatus status = getS3AFileStatus(fs, dir);
+ assertEmptyDirectory(false, status);
+ // 2. Make testEmptyDir empty
+ assertDeleted(child, false);
+ status = getS3AFileStatus(fs, dir);
+ assertEmptyDirectory(true, status);
+ private static void assertEmptyDirectory(boolean isEmpty, S3AFileStatus s) {
+ String msg = "dir is empty";
+ // Should *not* be Tristate.UNKNOWN since we request a definitive value
+ // in getS3AFileStatus() below
+ Tristate expected = Tristate.fromBool(isEmpty);
+ assertEquals(msg, expected, s.isEmptyDirectory());
+ public void testDirectoryBecomesNonEmpty() throws Exception {
+ // 1. create empty dir
+ mkdirs(dir);
+ // 2. Make testEmptyDir non-empty
+ ContractTestUtils.touch(fs, path("testEmptyDir/file1"));
+ private S3AFileStatus getS3AFileStatus(S3AFileSystem fs, Path p) throws
+ return fs.innerGetFileStatus(p, true /* want isEmptyDirectory value */);
@@ -19,21 +19,23 @@
+import java.nio.file.AccessDeniedException;
import java.util.concurrent.Callable;
-import org.junit.Rule;
import org.junit.Test;
-import org.junit.rules.ExpectedException;
import org.apache.hadoop.fs.FileSystem;
import org.apache.hadoop.fs.contract.s3a.S3AContract;
+import org.apache.hadoop.io.IOUtils;
-import static org.apache.hadoop.fs.contract.ContractTestUtils.rm;
-import static org.apache.hadoop.fs.s3a.S3ATestUtils.skipIfEncryptionTestsDisabled;
+import static org.apache.hadoop.fs.s3a.S3ATestUtils.*;
import static org.apache.hadoop.test.LambdaTestUtils.intercept;
@@ -42,22 +44,39 @@ import static org.apache.hadoop.test.LambdaTestUtils.intercept;
public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
+ private static final String SERVICE_AMAZON_S3_STATUS_CODE_403
+ = "Service: Amazon S3; Status Code: 403;";
+ private static final String KEY_1
+ = "4niV/jPK5VFRHY+KNb6wtqYd4xXyMgdJ9XQJpcQUVbs=";
+ private static final String KEY_2
+ = "G61nz31Q7+zpjJWbakxfTOZW4VS0UmQWAq2YXhcTXoo=";
+ private static final String KEY_3
+ = "NTx0dUPrxoo9+LbNiT/gqf3z9jILqL6ilismFmJO50U=";
+ private static final String KEY_4
+ = "msdo3VvvZznp66Gth58a91Hxe/UpExMkwU9BHkIjfW8=";
+ private static final int TEST_FILE_LEN = 2048;
- @Rule
- public ExpectedException expectedException = ExpectedException.none();
+ * Filesystem created with a different key.
+ private FileSystem fsKeyB;
Configuration conf = super.createConfiguration();
- S3ATestUtils.disableFilesystemCaching(conf);
+ disableFilesystemCaching(conf);
conf.set(Constants.SERVER_SIDE_ENCRYPTION_ALGORITHM,
getSSEAlgorithm().getMethod());
- conf.set(Constants.SERVER_SIDE_ENCRYPTION_KEY,
- "4niV/jPK5VFRHY+KNb6wtqYd4xXyMgdJ9XQJpcQUVbs=");
+ conf.set(Constants.SERVER_SIDE_ENCRYPTION_KEY, KEY_1);
+ public void teardown() throws Exception {
+ super.teardown();
+ IOUtils.closeStream(fsKeyB);
* This will create and write to a file using encryption key A, then attempt
* to read from it again with encryption key B. This will not work as it
@@ -73,29 +92,28 @@ public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
assumeEnabled();
skipIfEncryptionTestsDisabled(getConfiguration());
- final Path[] path = new Path[1];
- intercept(java.nio.file.AccessDeniedException.class,
- "Service: Amazon S3; Status Code: 403;",
- new Callable<Void>() {
+ intercept(AccessDeniedException.class,
+ SERVICE_AMAZON_S3_STATUS_CODE_403,
+ new Callable<FileStatus>() {
- public Void call() throws Exception {
- int len = 2048;
+ public FileStatus call() throws Exception {
+ int len = TEST_FILE_LEN;
describe("Create an encrypted file of size " + len);
- String src = createFilename(len);
- path[0] = writeThenReadFile(src, len);
+ Path src = path("testCreateFileAndReadWithDifferentEncryptionKey");
+ writeThenReadFile(src, len);
//extract the test FS
- FileSystem fileSystem = createNewFileSystemWithSSECKey(
+ fsKeyB = createNewFileSystemWithSSECKey(
"kX7SdwVc/1VXJr76kfKnkQ3ONYhxianyL2+C3rPVT9s=");
- ContractTestUtils.verifyFileContents(fileSystem, path[0], data);
- throw new Exception("Fail");
+ ContractTestUtils.verifyFileContents(fsKeyB, src, data);
+ return fsKeyB.getFileStatus(src);
- * While each object has it's own key and should be distinct, this verifies
+ * While each object has its own key and should be distinct, this verifies
* that hadoop treats object keys as a filesystem path. So if a top level
* dir is encrypted with keyA, a sublevel dir cannot be accessed with a
* different keyB.
@@ -108,29 +126,23 @@ public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
public void testCreateSubdirWithDifferentKey() throws Exception {
+ assumeS3GuardState(false, getConfiguration());
"Service: Amazon S3; Status Code: 403;",
- path[0] = S3ATestUtils.createTestPath(
- new Path(createFilename("dir/"))
- );
- Path nestedDirectory = S3ATestUtils.createTestPath(
- new Path(createFilename("dir/nestedDir/"))
- FileSystem fsKeyB = createNewFileSystemWithSSECKey(
- "G61nz31Q7+zpjJWbakxfTOZW4VS0UmQWAq2YXhcTXoo=");
- getFileSystem().mkdirs(path[0]);
+ Path base = path("testCreateSubdirWithDifferentKey");
+ Path nestedDirectory = new Path(base, "nestedDir");
+ KEY_2);
+ getFileSystem().mkdirs(base);
fsKeyB.mkdirs(nestedDirectory);
- throw new Exception("Exception should be thrown.");
+ // expected to fail
+ return fsKeyB.getFileStatus(nestedDirectory);
- rm(getFileSystem(), path[0], true, false);
@@ -146,23 +158,18 @@ public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
+ new Callable<Boolean>() {
- "NTx0dUPrxoo9+LbNiT/gqf3z9jILqL6ilismFmJO50U=");
- fsKeyB.rename(path[0],
- new Path(createFilename("different-path.txt")));
+ public Boolean call() throws Exception {
+ Path src = path(createFilename(len));
+ fsKeyB = createNewFileSystemWithSSECKey(KEY_3);
+ Path dest = path(createFilename("different-path.txt"));
+ getFileSystem().mkdirs(dest.getParent());
+ return fsKeyB.rename(src, dest);
@@ -178,11 +185,11 @@ public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
- String src = createFilename("original-path.txt");
- Path path = writeThenReadFile(src, 2048);
- Path newPath = path(createFilename("different-path.txt"));
- getFileSystem().rename(path, newPath);
- byte[] data = dataset(2048, 'a', 'z');
+ Path src = path("original-path.txt");
+ writeThenReadFile(src, TEST_FILE_LEN);
+ Path newPath = path("different-path.txt");
+ getFileSystem().rename(src, newPath);
+ byte[] data = dataset(TEST_FILE_LEN, 'a', 'z');
ContractTestUtils.verifyFileContents(getFileSystem(), newPath, data);
@@ -196,32 +203,27 @@ public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
public void testListEncryptedDir() throws Exception {
- path(createFilename("/a/b/c/"))
+ final Path pathABC = path("testListEncryptedDir/a/b/c/");
+ final Path pathAB = pathABC.getParent();
+ final Path pathA = pathAB.getParent();
+ final Path nestedDirectory = createTestPath(pathABC);
assertTrue(getFileSystem().mkdirs(nestedDirectory));
- final FileSystem fsKeyB = createNewFileSystemWithSSECKey(
- "msdo3VvvZznp66Gth58a91Hxe/UpExMkwU9BHkIjfW8=");
+ fsKeyB = createNewFileSystemWithSSECKey(KEY_4);
- fsKeyB.listFiles(S3ATestUtils.createTestPath(
- path(createFilename("/a/"))
- ), true);
- path(createFilename("/a/b/"))
+ fsKeyB.listFiles(pathA, true);
+ fsKeyB.listFiles(pathAB, true);
//Until this point, no exception is thrown about access
+ new Callable<RemoteIterator<LocatedFileStatus>>() {
- ), false);
+ public RemoteIterator<LocatedFileStatus> call() throws Exception {
+ return fsKeyB.listFiles(pathABC, false);
@@ -234,25 +236,16 @@ public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
final FileSystem unencryptedFileSystem = contract.getTestFileSystem();
//unencrypted can access until the final directory
- unencryptedFileSystem.listFiles(S3ATestUtils.createTestPath(
- intercept(org.apache.hadoop.fs.s3a.AWSS3IOException.class,
- "Bad Request (Service: Amazon S3; Status Code: 400; Error" +
- " Code: 400 Bad Request;",
+ unencryptedFileSystem.listFiles(pathA, true);
+ unencryptedFileSystem.listFiles(pathAB, true);
+ AWSS3IOException ex = intercept(AWSS3IOException.class,
+ return unencryptedFileSystem.listFiles(pathABC, false);
- rm(getFileSystem(), path(createFilename("/")), true, false);
+ assertStatusCode(ex, 400);
@@ -264,35 +257,30 @@ public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
public void testListStatusEncryptedDir() throws Exception {
- assertTrue(getFileSystem().mkdirs(nestedDirectory));
+ final Path pathABC = path("testListStatusEncryptedDir/a/b/c/");
+ assertTrue(getFileSystem().mkdirs(pathABC));
- fsKeyB.listStatus(S3ATestUtils.createTestPath(
- path(createFilename("/a/"))));
- path(createFilename("/a/b/"))));
+ fsKeyB.listStatus(pathA);
+ fsKeyB.listStatus(pathAB);
+ new Callable<FileStatus[]>() {
- path(createFilename("/a/b/c/"))));
+ public FileStatus[] call() throws Exception {
+ return fsKeyB.listStatus(pathABC);
//Now try it with an unencrypted filesystem.
- Configuration conf = this.createConfiguration();
+ Configuration conf = createConfiguration();
conf.unset(Constants.SERVER_SIDE_ENCRYPTION_ALGORITHM);
conf.unset(Constants.SERVER_SIDE_ENCRYPTION_KEY);
@@ -301,22 +289,17 @@ public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
- unencryptedFileSystem.listStatus(S3ATestUtils.createTestPath(
- "Bad Request (Service: Amazon S3; Status Code: 400; Error Code: 400" +
- " Bad Request;", new Callable<Void>() {
+ unencryptedFileSystem.listStatus(pathA);
+ unencryptedFileSystem.listStatus(pathAB);
+ return unencryptedFileSystem.listStatus(pathABC);
@@ -328,34 +311,26 @@ public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
public void testListStatusEncryptedFile() throws Exception {
+ final Path pathABC = path("testListStatusEncryptedFile/a/b/c/");
- String src = createFilename("/a/b/c/fileToStat.txt");
- final Path fileToStat = writeThenReadFile(src, 2048);
+ final Path fileToStat = new Path(pathABC, "fileToStat.txt");
+ writeThenReadFile(fileToStat, TEST_FILE_LEN);
- fsKeyB.listStatus(S3ATestUtils.createTestPath(fileToStat));
+ return fsKeyB.listStatus(S3ATestUtils.createTestPath(fileToStat));
}});
* It is possible to delete directories without the proper encryption key and
* the hierarchy above it.
@@ -366,35 +341,29 @@ public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
public void testDeleteEncryptedObjectWithDifferentKey() throws Exception {
- String src = createFilename("/a/b/c/filetobedeleted.txt");
- final Path fileToDelete = writeThenReadFile(src, 2048);
- "Forbidden (Service: Amazon S3; Status Code: 403; Error Code: " +
- "403 Forbidden",
+ final Path pathABC = path("testDeleteEncryptedObjectWithDifferentKey/a/b/c/");
+ final Path fileToDelete = new Path(pathABC, "filetobedeleted.txt");
+ writeThenReadFile(fileToDelete, TEST_FILE_LEN);
- fsKeyB.delete(fileToDelete, false);
+ return fsKeyB.delete(fileToDelete, false);
- //This is possible
- fsKeyB.delete(S3ATestUtils.createTestPath(
- path(createFilename("/a/b/c/"))), true);
- path(createFilename("/a/b/"))), true);
- path(createFilename("/a/"))), true);
+ //This is possible
+ fsKeyB.delete(pathABC, true);
+ fsKeyB.delete(pathAB, true);
+ fsKeyB.delete(pathA, true);
+ assertPathDoesNotExist("expected recursive delete", fileToDelete);
private FileSystem createNewFileSystemWithSSECKey(String sseCKey) throws
@@ -412,4 +381,5 @@ public class ITestS3AEncryptionSSEC extends AbstractTestS3AEncryption {
protected S3AEncryptionMethods getSSEAlgorithm() {
return S3AEncryptionMethods.SSE_C;
@@ -18,6 +18,7 @@
@@ -32,8 +33,8 @@ import java.net.URI;
import static org.apache.hadoop.fs.contract.ContractTestUtils.*;
import static org.apache.hadoop.fs.s3a.S3ATestUtils.*;
-import static org.apache.hadoop.fs.s3a.S3ATestUtils.MetricDiff;
import static org.apache.hadoop.test.GenericTestUtils.getTestDir;
+import static org.junit.Assume.assumeFalse;
* Use metrics to assert about the cost of file status queries.
@@ -62,9 +63,11 @@ public class ITestS3AFileOperationCost extends AbstractS3ATestBase {
S3AFileSystem fs = getFileSystem();
touch(fs, simpleFile);
resetMetricDiffs();
- S3AFileStatus status = fs.getFileStatus(simpleFile);
+ FileStatus status = fs.getFileStatus(simpleFile);
assertTrue("not a file: " + status, status.isFile());
- metadataRequests.assertDiffEquals(1);
+ if (!fs.hasMetadataStore()) {
+ metadataRequests.assertDiffEquals(1);
listRequests.assertDiffEquals(0);
@@ -79,9 +82,13 @@ public class ITestS3AFileOperationCost extends AbstractS3ATestBase {
Path dir = path("empty");
fs.mkdirs(dir);
- S3AFileStatus status = fs.getFileStatus(dir);
- assertTrue("not empty: " + status, status.isEmptyDirectory());
- metadataRequests.assertDiffEquals(2);
+ S3AFileStatus status = fs.innerGetFileStatus(dir, true);
+ assertTrue("not empty: " + status,
+ status.isEmptyDirectory() == Tristate.TRUE);
+ metadataRequests.assertDiffEquals(2);
@@ -92,7 +99,7 @@ public class ITestS3AFileOperationCost extends AbstractS3ATestBase {
Path path = path("missing");
- S3AFileStatus status = fs.getFileStatus(path);
+ FileStatus status = fs.getFileStatus(path);
fail("Got a status back from a missing file path " + status);
} catch (FileNotFoundException expected) {
@@ -108,7 +115,7 @@ public class ITestS3AFileOperationCost extends AbstractS3ATestBase {
Path path = path("missingdir/missingpath");
@@ -126,16 +133,18 @@ public class ITestS3AFileOperationCost extends AbstractS3ATestBase {
Path simpleFile = new Path(dir, "simple.txt");
- if (status.isEmptyDirectory()) {
+ if (status.isEmptyDirectory() == Tristate.TRUE) {
// erroneous state
String fsState = fs.toString();
fail("FileStatus says directory isempty: " + status
+ "\n" + ContractTestUtils.ls(fs, dir)
+ "\n" + fsState);
- listRequests.assertDiffEquals(1);
+ listRequests.assertDiffEquals(1);
@Test
@@ -187,6 +196,13 @@ public class ITestS3AFileOperationCost extends AbstractS3ATestBase {
+ "In S3, rename deletes any fake directories as a part of "
+ "clean up activity");
+ // As this test uses the s3 metrics to count the number of fake directory
+ // operations, it depends on side effects happening internally. With
+ // metadata store enabled, it is brittle to change. We disable this test
+ // before the internal behavior w/ or w/o metadata store.
+ assumeFalse(fs.hasMetadataStore());
Path srcBaseDir = path("src");
mkdirs(srcBaseDir);
MetricDiff deleteRequests =
@@ -27,6 +27,9 @@ import org.apache.hadoop.conf.Configuration;
import org.apache.hadoop.fs.FileSystemContractBaseTest;
+import static org.junit.Assume.*;
+import static org.junit.Assert.*;
* Tests a live S3 system. If your keys and bucket aren't specified, all tests
* are marked as passed.
@@ -0,0 +1,100 @@
+import org.apache.hadoop.fs.contract.AbstractFSContract;
+import org.apache.hadoop.fs.contract.s3a.S3AContract;
+import static org.apache.hadoop.fs.contract.ContractTestUtils.touch;
+import static org.apache.hadoop.fs.s3a.InconsistentAmazonS3Client.*;
+ * Tests S3A behavior under forced inconsistency via {@link
+ * InconsistentAmazonS3Client}.
+ * These tests are for validating expected behavior *without* S3Guard, but
+ * may also run with S3Guard enabled. For tests that validate S3Guard's
+ * consistency features, see {@link ITestS3GuardListConsistency}.
+public class ITestS3AInconsistency extends AbstractS3ATestBase {
+ protected AbstractFSContract createContract(Configuration conf) {
+ conf.setClass(S3_CLIENT_FACTORY_IMPL, InconsistentS3ClientFactory.class,
+ S3ClientFactory.class);
+ conf.set(FAIL_INJECT_INCONSISTENCY_KEY, DEFAULT_DELAY_KEY_SUBSTRING);
+ conf.setFloat(FAIL_INJECT_INCONSISTENCY_PROBABILITY, 1.0f);
+ conf.setLong(FAIL_INJECT_INCONSISTENCY_MSEC, DEFAULT_DELAY_KEY_MSEC);
+ return new S3AContract(conf);
+ public void testGetFileStatus() throws Exception {
+ // 1. Make sure no ancestor dirs exist
+ Path dir = path("ancestor");
+ fs.delete(dir, true);
+ waitUntilDeleted(dir);
+ // 2. Create a descendant file, which implicitly creates ancestors
+ // This file has delayed visibility.
+ touch(getFileSystem(),
+ path("ancestor/file-" + DEFAULT_DELAY_KEY_SUBSTRING));
+ // 3. Assert expected behavior. If S3Guard is enabled, we should be able
+ // to get status for ancestor. If S3Guard is *not* enabled, S3A will
+ // fail to infer the existence of the ancestor since visibility of the
+ // child file is delayed, and its key prefix search will return nothing.
+ FileStatus status = fs.getFileStatus(dir);
+ if (fs.hasMetadataStore()) {
+ assertTrue("Ancestor is dir", status.isDirectory());
+ fail("getFileStatus should fail due to delayed visibility.");
+ fail("S3Guard failed to list parent of inconsistent child.");
+ LOG.info("File not found, as expected.");
+ private void waitUntilDeleted(final Path p) throws Exception {
+ LambdaTestUtils.eventually(30 * 1000, 1000,
+ new Callable<Void>() {
+ assertPathDoesNotExist("Dir should be deleted", p);
+ );
@@ -22,10 +22,17 @@ import org.apache.hadoop.fs.FSDataOutputStream;
import org.apache.hadoop.fs.FileAlreadyExistsException;
+import com.amazonaws.services.s3.model.ObjectMetadata;
+import java.io.ByteArrayInputStream;
* Tests of the S3A FileSystem which don't have a specific home and can share
@@ -55,6 +62,26 @@ public class ITestS3AMiscOperations extends AbstractS3ATestBase {
createNonRecursive(new Path(parent, "fail"));
+ public void testPutObjectDirect() throws Throwable {
+ final S3AFileSystem fs = getFileSystem();
+ ObjectMetadata metadata = fs.newObjectMetadata(-1);
+ metadata.setContentLength(-1);
+ Path path = path("putDirect");
+ final PutObjectRequest put = new PutObjectRequest(fs.getBucket(),
+ path.toUri().getPath(),
+ new ByteArrayInputStream("PUT".getBytes()),
+ metadata);
+ LambdaTestUtils.intercept(IllegalStateException.class,
+ new Callable<PutObjectResult>() {
+ public PutObjectResult call() throws Exception {
+ return fs.putObjectDirect(put);
+ assertPathDoesNotExist("put object was created", path);
private FSDataOutputStream createNonRecursive(Path path) throws IOException {
return getFileSystem().createNonRecursive(path, false, 4096,
(short) 3, (short) 4096,
@@ -0,0 +1,61 @@
+import org.apache.hadoop.fs.s3a.s3guard.DirListingMetadata;
+import org.junit.Assume;
+ * Home for testing the creation of new files and directories with S3Guard
+ * enabled.
+public class ITestS3GuardCreate extends AbstractS3ATestBase {
+ * Test that ancestor creation during S3AFileSystem#create() is properly
+ * accounted for in the MetadataStore. This should be handled by the
+ * FileSystem, and be a FS contract test, but S3A does not handle ancestors on
+ * create(), so we need to take care in the S3Guard code to do the right
+ * thing. This may change: See HADOOP-13221 for more detail.
+ public void testCreatePopulatesFileAncestors() throws Exception {
+ Assume.assumeTrue(fs.hasMetadataStore());
+ final MetadataStore ms = fs.getMetadataStore();
+ final Path parent = path("testCreatePopulatesFileAncestors");
+ fs.mkdirs(parent);
+ final Path nestedFile = new Path(parent, "dir1/dir2/file4");
+ touch(fs, nestedFile);
+ DirListingMetadata list = ms.listChildren(parent);
+ assertFalse("MetadataStore falsely reports authoritative empty list",
+ list.isEmpty() == Tristate.TRUE);
+ } finally {
+ fs.delete(parent, true);
@@ -0,0 +1,85 @@
+ * Test logic around whether or not a directory is empty, with S3Guard enabled.
+ * The fact that S3AFileStatus has an isEmptyDirectory flag in it makes caching
+ * S3AFileStatus's really tricky, as the flag can change as a side effect of
+ * changes to other paths.
+ * After S3Guard is merged to trunk, we should try to remove the
+ * isEmptyDirectory flag from S3AFileStatus, or maintain it outside
+ * of the MetadataStore.
+public class ITestS3GuardEmptyDirs extends AbstractS3ATestBase {
+ public void testEmptyDirs() throws Exception {
+ MetadataStore configuredMs = fs.getMetadataStore();
+ Path existingDir = path("existing-dir");
+ Path existingFile = path("existing-dir/existing-file");
+ // 1. Simulate files already existing in the bucket before we started our
+ // cluster. Temporarily disable the MetadataStore so it doesn't witness
+ // us creating these files.
+ fs.setMetadataStore(new NullMetadataStore());
+ assertTrue(fs.mkdirs(existingDir));
+ touch(fs, existingFile);
+ // 2. Simulate (from MetadataStore's perspective) starting our cluster and
+ // creating a file in an existing directory.
+ fs.setMetadataStore(configuredMs); // "start cluster"
+ Path newFile = path("existing-dir/new-file");
+ touch(fs, newFile);
+ S3AFileStatus status = fs.innerGetFileStatus(existingDir, true);
+ assertEquals("Should not be empty dir", Tristate.FALSE,
+ status.isEmptyDirectory());
+ // 3. Assert that removing the only file the MetadataStore witnessed
+ // being created doesn't cause it to think the directory is now empty.
+ fs.delete(newFile, false);
+ status = fs.innerGetFileStatus(existingDir, true);
+ // 4. Assert that removing the final file, that existed "before"
+ // MetadataStore started, *does* cause the directory to be marked empty.
+ fs.delete(existingFile, false);
+ assertEquals("Should be empty dir now", Tristate.TRUE,
+ configuredMs.forgetMetadata(existingFile);
+ configuredMs.forgetMetadata(existingDir);
@@ -0,0 +1,544 @@
+import org.apache.hadoop.fs.FSDataOutputStream;
+import static org.apache.hadoop.fs.contract.ContractTestUtils.writeTextFile;
+ * Test S3Guard list consistency feature by injecting delayed listObjects()
+ * visibility via {@link InconsistentAmazonS3Client}.
+ * Tests here generally:
+ * 1. Use the inconsistency injection mentioned above.
+ * 2. Only run when S3Guard is enabled.
+public class ITestS3GuardListConsistency extends AbstractS3ATestBase {
+ // Other configs would break test assumptions
+ * Helper function for other test cases: does a single rename operation and
+ * validates the aftermath.
+ * @param mkdirs Directories to create
+ * @param srcdirs Source paths for rename operation
+ * @param dstdirs Destination paths for rename operation
+ * @param yesdirs Files that must exist post-rename (e.g. srcdirs children)
+ * @param nodirs Files that must not exist post-rename (e.g. dstdirs children)
+ private void doTestRenameSequence(Path[] mkdirs, Path[] srcdirs,
+ Path[] dstdirs, Path[] yesdirs, Path[] nodirs) throws Exception {
+ if (mkdirs != null) {
+ for (Path mkdir : mkdirs) {
+ assertTrue(fs.mkdirs(mkdir));
+ clearInconsistency(fs);
+ assertTrue("srcdirs and dstdirs must have equal length",
+ srcdirs.length == dstdirs.length);
+ for (int i = 0; i < srcdirs.length; i++) {
+ assertTrue("Rename returned false: " + srcdirs[i] + " -> " + dstdirs[i],
+ fs.rename(srcdirs[i], dstdirs[i]));
+ for (Path yesdir : yesdirs) {
+ assertTrue("Path was supposed to exist: " + yesdir, fs.exists(yesdir));
+ for (Path nodir : nodirs) {
+ assertFalse("Path is not supposed to exist: " + nodir, fs.exists(nodir));
+ * Tests that after renaming a directory, the original directory and its
+ * contents are indeed missing and the corresponding new paths are visible.
+ public void testConsistentListAfterRename() throws Exception {
+ Path[] mkdirs = {
+ path("d1/f"),
+ path("d1/f" + DEFAULT_DELAY_KEY_SUBSTRING)
+ };
+ Path[] srcdirs = {path("d1")};
+ Path[] dstdirs = {path("d2")};
+ Path[] yesdirs = {path("d2"), path("d2/f"),
+ path("d2/f" + DEFAULT_DELAY_KEY_SUBSTRING)};
+ Path[] nodirs = {path("d1"), path("d1/f"),
+ path("d1/f" + DEFAULT_DELAY_KEY_SUBSTRING)};
+ doTestRenameSequence(mkdirs, srcdirs, dstdirs, yesdirs, nodirs);
+ getFileSystem().delete(path("d1"), true);
+ getFileSystem().delete(path("d2"), true);
+ * Tests a circular sequence of renames to verify that overwriting recently
+ * deleted files and reading recently created files from rename operations
+ * works as expected.
+ public void testRollingRenames() throws Exception {
+ Path[] dir0 = {path("rolling/1")};
+ Path[] dir1 = {path("rolling/2")};
+ Path[] dir2 = {path("rolling/3")};
+ // These sets have to be in reverse order compared to the movement
+ Path[] setA = {dir1[0], dir0[0]};
+ Path[] setB = {dir2[0], dir1[0]};
+ Path[] setC = {dir0[0], dir2[0]};
+ for(int i = 0; i < 2; i++) {
+ Path[] firstSet = i == 0 ? setA : null;
+ doTestRenameSequence(firstSet, setA, setB, setB, dir0);
+ doTestRenameSequence(null, setB, setC, setC, dir1);
+ doTestRenameSequence(null, setC, setA, setA, dir2);
+ assertFalse("Renaming deleted file should have failed",
+ fs.rename(dir2[0], dir1[0]));
+ assertTrue("Renaming over existing file should have succeeded",
+ fs.rename(dir1[0], dir0[0]));
+ * Tests that deleted files immediately stop manifesting in list operations
+ * even when the effect in S3 is delayed.
+ public void testConsistentListAfterDelete() throws Exception {
+ // test will fail if NullMetadataStore (the default) is configured: skip it.
+ // Any S3 keys that contain DELAY_KEY_SUBSTRING will be delayed
+ // in listObjects() results via InconsistentS3Client
+ Path inconsistentPath =
+ path("a/b/dir3-" + DEFAULT_DELAY_KEY_SUBSTRING);
+ Path[] testDirs = {path("a/b/dir1"),
+ path("a/b/dir2"),
+ inconsistentPath};
+ for (Path path : testDirs) {
+ assertTrue(fs.mkdirs(path));
+ assertTrue(fs.delete(path, false));
+ FileStatus[] paths = fs.listStatus(path("a/b/"));
+ List<Path> list = new ArrayList<>();
+ for (FileStatus fileState : paths) {
+ list.add(fileState.getPath());
+ assertFalse(list.contains(path("a/b/dir1")));
+ assertFalse(list.contains(path("a/b/dir2")));
+ // This should fail without S3Guard, and succeed with it.
+ assertFalse(list.contains(inconsistentPath));
+ * Tests that rename immediately after files in the source directory are
+ * deleted results in exactly the correct set of destination files and none
+ * of the source files.
+ public void testConsistentRenameAfterDelete() throws Exception {
+ assertTrue(fs.delete(testDirs[1], false));
+ assertTrue(fs.delete(testDirs[2], false));
+ fs.rename(path("a"), path("a3"));
+ FileStatus[] paths = fs.listStatus(path("a3/b"));
+ assertTrue(list.contains(path("a3/b/dir1")));
+ assertFalse(list.contains(path("a3/b/dir2")));
+ assertFalse(list.contains(path("a3/b/dir3-" +
+ DEFAULT_DELAY_KEY_SUBSTRING)));
+ RemoteIterator<LocatedFileStatus> old = fs.listFilesAndEmptyDirectories(
+ path("a"), true);
+ fail("Recently renamed dir should not be visible");
+ } catch(FileNotFoundException e) {
+ public void testConsistentListStatusAfterPut() throws Exception {
+ // This test will fail if NullMetadataStore (the default) is configured:
+ // skip it.
+ assertTrue(list.contains(path("a/b/dir1")));
+ assertTrue(list.contains(path("a/b/dir2")));
+ assertTrue(list.contains(inconsistentPath));
+ * Similar to {@link #testConsistentListStatusAfterPut()}, this tests that the
+ * FS listLocatedStatus() call will return consistent list.
+ public void testConsistentListLocatedStatusAfterPut() throws Exception {
+ String rootDir = "doTestConsistentListLocatedStatusAfterPut";
+ fs.mkdirs(path(rootDir));
+ final int[] numOfPaths = {0, 1, 5};
+ for (int normalPathNum : numOfPaths) {
+ for (int delayedPathNum : new int[] {0, 2}) {
+ LOG.info("Testing with normalPathNum={}, delayedPathNum={}",
+ normalPathNum, delayedPathNum);
+ doTestConsistentListLocatedStatusAfterPut(fs, rootDir, normalPathNum,
+ delayedPathNum);
+ * Helper method to implement the tests of consistent listLocatedStatus().
+ * @param fs The S3 file system from contract
+ * @param normalPathNum number paths listed directly from S3 without delaying
+ * @param delayedPathNum number paths listed with delaying
+ private void doTestConsistentListLocatedStatusAfterPut(S3AFileSystem fs,
+ String rootDir, int normalPathNum, int delayedPathNum) throws Exception {
+ final List<Path> testDirs = new ArrayList<>(normalPathNum + delayedPathNum);
+ int index = 0;
+ for (; index < normalPathNum; index++) {
+ testDirs.add(path(rootDir + "/dir-" +
+ index));
+ for (; index < normalPathNum + delayedPathNum; index++) {
+ testDirs.add(path(rootDir + "/dir-" + index +
+ DEFAULT_DELAY_KEY_SUBSTRING));
+ // delete the old test path (if any) so that when we call mkdirs() later,
+ // the to delay directories will be tracked via putObject() request.
+ fs.delete(path, true);
+ // this should return the union data from S3 and MetadataStore
+ final RemoteIterator<LocatedFileStatus> statusIterator =
+ fs.listLocatedStatus(path(rootDir + "/"));
+ for (; statusIterator.hasNext();) {
+ list.add(statusIterator.next().getPath());
+ // This should fail without S3Guard, and succeed with it because part of the
+ // children under test path are delaying visibility
+ assertTrue("listLocatedStatus should list " + path, list.contains(path));
+ * Tests that the S3AFS listFiles() call will return consistent file list.
+ public void testConsistentListFiles() throws Exception {
+ final int[] numOfPaths = {0, 2};
+ for (int dirNum : numOfPaths) {
+ for (int normalFile : numOfPaths) {
+ for (int delayedFile : new int[] {0, 1}) {
+ for (boolean recursive : new boolean[] {true, false}) {
+ doTestListFiles(fs, dirNum, normalFile, delayedFile, recursive);
+ * Helper method to implement the tests of consistent listFiles().
+ * The file structure has dirNum subdirectories, and each directory (including
+ * the test base directory itself) has normalFileNum normal files and
+ * delayedFileNum delayed files.
+ * @param dirNum number of subdirectories
+ * @param normalFileNum number files in each directory without delay to list
+ * @param delayedFileNum number files in each directory with delay to list
+ * @param recursive listFiles recursively if true
+ * @throws Exception if any unexpected error
+ private void doTestListFiles(S3AFileSystem fs, int dirNum, int normalFileNum,
+ int delayedFileNum, boolean recursive) throws Exception {
+ describe("Testing dirNum=%d, normalFile=%d, delayedFile=%d, "
+ + "recursive=%s", dirNum, normalFileNum, delayedFileNum, recursive);
+ final Path baseTestDir = path("doTestListFiles-" + dirNum + "-"
+ + normalFileNum + "-" + delayedFileNum + "-" + recursive);
+ // the to delay sub directories will be tracked via putObject() request.
+ fs.delete(baseTestDir, true);
+ // make subdirectories (if any)
+ final List<Path> testDirs = new ArrayList<>(dirNum + 1);
+ assertTrue(fs.mkdirs(baseTestDir));
+ testDirs.add(baseTestDir);
+ for (int i = 0; i < dirNum; i++) {
+ final Path subdir = path(baseTestDir + "/dir-" + i);
+ assertTrue(fs.mkdirs(subdir));
+ testDirs.add(subdir);
+ final Collection<String> fileNames
+ = new ArrayList<>(normalFileNum + delayedFileNum);
+ for (; index < normalFileNum; index++) {
+ fileNames.add("file-" + index);
+ for (; index < normalFileNum + delayedFileNum; index++) {
+ fileNames.add("file-" + index + "-" + DEFAULT_DELAY_KEY_SUBSTRING);
+ int filesAndEmptyDirectories = 0;
+ // create files under each test directory
+ for (Path dir : testDirs) {
+ for (String fileName : fileNames) {
+ writeTextFile(fs, new Path(dir, fileName), "I, " + fileName, false);
+ filesAndEmptyDirectories++;
+ final RemoteIterator<LocatedFileStatus> statusIterator
+ = fs.listFiles(baseTestDir, recursive);
+ final Collection<Path> listedFiles = new HashSet<>();
+ final FileStatus status = statusIterator.next();
+ assertTrue("FileStatus " + status + " is not a file!", status.isFile());
+ listedFiles.add(status.getPath());
+ LOG.info("S3AFileSystem::listFiles('{}', {}) -> {}",
+ baseTestDir, recursive, listedFiles);
+ // files to list are delaying visibility
+ if (!recursive) {
+ // in this case only the top level files are listed
+ assertEquals("Unexpected number of files returned by listFiles() call",
+ normalFileNum + delayedFileNum, listedFiles.size());
+ verifyFileIsListed(listedFiles, baseTestDir, fileNames);
+ filesAndEmptyDirectories,
+ listedFiles.size());
+ verifyFileIsListed(listedFiles, dir, fileNames);
+ private static void verifyFileIsListed(Collection<Path> listedFiles,
+ Path currentDir, Collection<String> fileNames) {
+ final Path file = new Path(currentDir, fileName);
+ assertTrue(file + " should have been listed", listedFiles.contains(file));
+ public void testCommitByRenameOperations() throws Throwable {
+ Path work = path("test-commit-by-rename-" + DEFAULT_DELAY_KEY_SUBSTRING);
+ Path task00 = new Path(work, "task00");
+ fs.mkdirs(task00);
+ String name = "part-00";
+ try (FSDataOutputStream out =
+ fs.create(new Path(task00, name), false)) {
+ out.writeChars("hello");
+ for (FileStatus stat : fs.listStatus(task00)) {
+ fs.rename(stat.getPath(), work);
+ List<FileStatus> files = new ArrayList<>(2);
+ for (FileStatus stat : fs.listStatus(work)) {
+ if (stat.isFile()) {
+ files.add(stat);
+ assertFalse("renamed file " + name + " not found in " + work,
+ files.isEmpty());
+ assertEquals("more files found than expected in " + work
+ + " " + ls(work), 1, files.size());
+ FileStatus status = files.get(0);
+ assertEquals("Wrong filename in " + status,
+ name, status.getPath().getName());
+ public void testInconsistentS3ClientDeletes() throws Throwable {
+ Path root = path("testInconsistentClient" + DEFAULT_DELAY_KEY_SUBSTRING);
+ for (int i = 0; i < 3; i++) {
+ fs.mkdirs(new Path(root, "dir" + i));
+ touch(fs, new Path(root, "file" + i));
+ for (int j = 0; j < 3; j++) {
+ touch(fs, new Path(new Path(root, "dir" + i), "file" + i + "-" + j));
+ AmazonS3 client = fs.getAmazonS3Client();
+ String key = fs.pathToKey(root) + "/";
+ ObjectListing preDeleteDelimited = client.listObjects(
+ fs.createListObjectsRequest(key, "/"));
+ ObjectListing preDeleteUndelimited = client.listObjects(
+ fs.createListObjectsRequest(key, null));
+ fs.delete(root, true);
+ ObjectListing postDeleteDelimited = client.listObjects(
+ ObjectListing postDeleteUndelimited = client.listObjects(
+ assertEquals("InconsistentAmazonS3Client added back objects incorrectly " +
+ "in a non-recursive listing",
+ preDeleteDelimited.getObjectSummaries().size(),
+ postDeleteDelimited.getObjectSummaries().size()
+ assertEquals("InconsistentAmazonS3Client added back prefixes incorrectly " +
+ preDeleteDelimited.getCommonPrefixes().size(),
+ postDeleteDelimited.getCommonPrefixes().size()
+ "in a recursive listing",
+ preDeleteUndelimited.getObjectSummaries().size(),
+ postDeleteUndelimited.getObjectSummaries().size()
+ preDeleteUndelimited.getCommonPrefixes().size(),
+ postDeleteUndelimited.getCommonPrefixes().size()
+ private static void clearInconsistency(S3AFileSystem fs) throws Exception {
+ AmazonS3 s3 = fs.getAmazonS3Client();
+ InconsistentAmazonS3Client ic = InconsistentAmazonS3Client.castFrom(s3);
+ ic.clearInconsistency();
@@ -0,0 +1,141 @@
+ * Test cases that validate S3Guard's behavior for writing things like
+ * directory listings back to the MetadataStore.
+public class ITestS3GuardWriteBack extends AbstractS3ATestBase {
+ * In listStatus(), when S3Guard is enabled, the full listing for a
+ * directory is "written back" to the MetadataStore before the listing is
+ * returned. Currently this "write back" behavior occurs when
+ * fs.s3a.metadatastore.authoritative is true. This test validates this
+ * behavior.
+ * @throws Exception on failure
+ public void testListStatusWriteBack() throws Exception {
+ Assume.assumeTrue(getFileSystem().hasMetadataStore());
+ Path directory = path("ListStatusWriteBack");
+ // "raw" S3AFileSystem without S3Guard
+ S3AFileSystem noS3Guard = createTestFS(directory.toUri(), true, false);
+ // Another with S3Guard and write-back disabled
+ S3AFileSystem noWriteBack = createTestFS(directory.toUri(), false, false);
+ // Another S3Guard and write-back enabled
+ S3AFileSystem yesWriteBack = createTestFS(directory.toUri(), false, true);
+ // delete the existing directory (in case of last test failure)
+ noS3Guard.delete(directory, true);
+ // Create a directory on S3 only
+ noS3Guard.mkdirs(new Path(directory, "OnS3"));
+ // Create a directory on both S3 and metadata store
+ Path p = new Path(directory, "OnS3AndMS");
+ assertPathDoesntExist(noWriteBack, p);
+ noWriteBack.mkdirs(p);
+ FileStatus[] fsResults;
+ DirListingMetadata mdResults;
+ // FS should return both even though S3Guard is not writing back to MS
+ fsResults = noWriteBack.listStatus(directory);
+ assertEquals("Filesystem enabled S3Guard without write back should have "
+ + "both /OnS3 and /OnS3AndMS: " + Arrays.toString(fsResults),
+ 2, fsResults.length);
+ // Metadata store without write-back should still only contain /OnS3AndMS,
+ // because newly discovered /OnS3 is not written back to metadata store
+ mdResults = noWriteBack.getMetadataStore().listChildren(directory);
+ assertEquals("Metadata store without write back should still only know "
+ + "about /OnS3AndMS, but it has: " + mdResults,
+ 1, mdResults.numEntries());
+ // FS should return both (and will write it back)
+ fsResults = yesWriteBack.listStatus(directory);
+ assertEquals("Filesystem enabled S3Guard with write back should have "
+ + " both /OnS3 and /OnS3AndMS: " + Arrays.toString(fsResults),
+ // Metadata store with write-back should contain both because the newly
+ // discovered /OnS3 should have been written back to metadata store
+ mdResults = yesWriteBack.getMetadataStore().listChildren(directory);
+ assertEquals("Unexpected number of results from metadata store. "
+ + "Should have /OnS3 and /OnS3AndMS: " + mdResults,
+ 2, mdResults.numEntries());
+ // If we don't clean this up, the next test run will fail because it will
+ // have recorded /OnS3 being deleted even after it's written to noS3Guard.
+ getFileSystem().getMetadataStore().forgetMetadata(
+ new Path(directory, "OnS3"));
+ /** Create a separate S3AFileSystem instance for testing. */
+ private S3AFileSystem createTestFS(URI fsURI, boolean disableS3Guard,
+ boolean authoritativeMeta) throws IOException {
+ // Create a FileSystem that is S3-backed only
+ conf = createConfiguration();
+ S3ATestUtils.disableFilesystemCaching(conf);
+ if (disableS3Guard) {
+ conf.set(Constants.S3_METADATA_STORE_IMPL,
+ Constants.S3GUARD_METASTORE_NULL);
+ S3ATestUtils.maybeEnableS3Guard(conf);
+ conf.setBoolean(Constants.METADATASTORE_AUTHORITATIVE, authoritativeMeta);
+ FileSystem fs = FileSystem.get(fsURI, conf);
+ return asS3AFS(fs);
+ private static S3AFileSystem asS3AFS(FileSystem fs) {
+ assertTrue("Not a S3AFileSystem: " + fs, fs instanceof S3AFileSystem);
+ return (S3AFileSystem)fs;
+ private static void assertPathDoesntExist(FileSystem fs, Path p)
+ FileStatus s = fs.getFileStatus(p);
+ fail("Path should not exist: " + p);
@@ -23,6 +23,7 @@ import static org.mockito.Mockito.*;
+import com.amazonaws.services.s3.model.Region;
* An {@link S3ClientFactory} that returns Mockito mocks of the {@link AmazonS3}
@@ -35,6 +36,8 @@ public class MockS3ClientFactory implements S3ClientFactory {
String bucket = name.getHost();
AmazonS3 s3 = mock(AmazonS3.class);
when(s3.doesBucketExist(bucket)).thenReturn(true);
+ when(s3.getBucketLocation(anyString()))
+ .thenReturn(Region.US_West.toString());
return s3;
@@ -134,6 +134,18 @@ public interface S3ATestConstants {
String TEST_STS_ENABLED = "test.fs.s3a.sts.enabled";
String TEST_STS_ENDPOINT = "test.fs.s3a.sts.endpoint";
+ * Various S3Guard tests.
+ String TEST_S3GUARD_PREFIX = "fs.s3a.s3guard.test";
+ String TEST_S3GUARD_ENABLED = TEST_S3GUARD_PREFIX + ".enabled";
+ String TEST_S3GUARD_AUTHORITATIVE = TEST_S3GUARD_PREFIX + ".authoritative";
+ String TEST_S3GUARD_IMPLEMENTATION = TEST_S3GUARD_PREFIX + ".implementation";
+ String TEST_S3GUARD_IMPLEMENTATION_LOCAL = "local";
+ String TEST_S3GUARD_IMPLEMENTATION_DYNAMO = "dynamo";
+ String TEST_S3GUARD_IMPLEMENTATION_DYNAMODBLOCAL = "dynamodblocal";
+ String TEST_S3GUARD_IMPLEMENTATION_NONE = "none";
* Timeout in Milliseconds for standard tests: {@value}.
@@ -22,7 +22,14 @@ import org.apache.commons.lang.StringUtils;
import org.apache.hadoop.fs.FSDataOutputStream;
import org.apache.hadoop.fs.FileContext;
+import org.apache.hadoop.fs.permission.FsPermission;
+import org.apache.hadoop.fs.s3a.s3guard.DynamoDBClientFactory;
+import org.apache.hadoop.fs.s3a.s3guard.DynamoDBLocalClientFactory;
+import org.apache.hadoop.fs.s3a.s3guard.S3Guard;
+import org.hamcrest.core.Is;
import org.junit.Assert;
import org.junit.Assume;
import org.junit.internal.AssumptionViolatedException;
@@ -31,11 +38,13 @@ import org.slf4j.LoggerFactory;
import static org.apache.hadoop.fs.contract.ContractTestUtils.skip;
import static org.apache.hadoop.fs.s3a.S3ATestConstants.*;
+import static org.apache.hadoop.fs.s3a.S3AUtils.propagateBucketOptions;
import static org.junit.Assert.*;
@@ -51,6 +60,15 @@ public final class S3ATestUtils {
public static final String UNSET_PROPERTY = "unset";
+ * Get S3A FS name.
+ * @param conf configuration.
+ * @return S3A fs name.
+ public static String getFsName(Configuration conf) {
+ return conf.getTrimmed(TEST_FS_S3A_NAME, "");
* Create the test filesystem.
@@ -97,6 +115,8 @@ public final class S3ATestUtils {
throw new AssumptionViolatedException(
"No test filesystem in " + TEST_FS_S3A_NAME);
S3AFileSystem fs1 = new S3AFileSystem();
//enable purging in tests
if (purge) {
@@ -137,6 +157,8 @@ public final class S3ATestUtils {
throw new AssumptionViolatedException("No test filesystem in "
+ TEST_FS_S3A_NAME);
FileContext fc = FileContext.getFileContext(testURI, conf);
return fc;
@@ -301,12 +323,95 @@ public final class S3ATestUtils {
* @return a path
public static Path createTestPath(Path defVal) {
- String testUniqueForkId = System.getProperty(
- S3ATestConstants.TEST_UNIQUE_FORK_ID);
+ String testUniqueForkId =
+ System.getProperty(S3ATestConstants.TEST_UNIQUE_FORK_ID);
return testUniqueForkId == null ? defVal :
new Path("/" + testUniqueForkId, "test");
+ * Test assumption that S3Guard is/is not enabled.
+ * @param shouldBeEnabled should S3Guard be enabled?
+ * @param originalConf configuration to check
+ * @throws URISyntaxException
+ public static void assumeS3GuardState(boolean shouldBeEnabled,
+ Configuration originalConf) throws URISyntaxException {
+ boolean isEnabled = getTestPropertyBool(originalConf, TEST_S3GUARD_ENABLED,
+ originalConf.getBoolean(TEST_S3GUARD_ENABLED, false));
+ Assume.assumeThat("Unexpected S3Guard test state:"
+ + " shouldBeEnabled=" + shouldBeEnabled
+ + " and isEnabled=" + isEnabled,
+ shouldBeEnabled, Is.is(isEnabled));
+ final String fsname = originalConf.getTrimmed(TEST_FS_S3A_NAME);
+ Assume.assumeNotNull(fsname);
+ final String bucket = new URI(fsname).getHost();
+ final Configuration conf = propagateBucketOptions(originalConf, bucket);
+ boolean usingNullImpl = S3GUARD_METASTORE_NULL.equals(
+ conf.getTrimmed(S3_METADATA_STORE_IMPL, S3GUARD_METASTORE_NULL));
+ + " but usingNullImpl=" + usingNullImpl,
+ shouldBeEnabled, Is.is(!usingNullImpl));
+ * Conditionally set the S3Guard options from test properties.
+ public static void maybeEnableS3Guard(Configuration conf) {
+ if (getTestPropertyBool(conf, TEST_S3GUARD_ENABLED,
+ conf.getBoolean(TEST_S3GUARD_ENABLED, false))) {
+ // S3Guard is enabled.
+ boolean authoritative = getTestPropertyBool(conf,
+ TEST_S3GUARD_AUTHORITATIVE,
+ conf.getBoolean(TEST_S3GUARD_AUTHORITATIVE, true));
+ String impl = getTestProperty(conf, TEST_S3GUARD_IMPLEMENTATION,
+ conf.get(TEST_S3GUARD_IMPLEMENTATION,
+ TEST_S3GUARD_IMPLEMENTATION_LOCAL));
+ String implClass = "";
+ switch (impl) {
+ case TEST_S3GUARD_IMPLEMENTATION_LOCAL:
+ implClass = S3GUARD_METASTORE_LOCAL;
+ case TEST_S3GUARD_IMPLEMENTATION_DYNAMODBLOCAL:
+ conf.setClass(S3Guard.S3GUARD_DDB_CLIENT_FACTORY_IMPL,
+ DynamoDBLocalClientFactory.class, DynamoDBClientFactory.class);
+ case TEST_S3GUARD_IMPLEMENTATION_DYNAMO:
+ implClass = S3GUARD_METASTORE_DYNAMO;
+ case TEST_S3GUARD_IMPLEMENTATION_NONE:
+ implClass = S3GUARD_METASTORE_NULL;
+ fail("Unknown s3guard back end: \"" + impl + "\"");
+ LOG.debug("Enabling S3Guard, authoritative={}, implementation={}",
+ authoritative, implClass);
+ conf.setBoolean(METADATASTORE_AUTHORITATIVE, authoritative);
+ conf.set(S3_METADATA_STORE_IMPL, implClass);
+ * Is there a MetadataStore configured for s3a with authoritative enabled?
+ * @param conf Configuration to test.
+ * @return true iff there is a MetadataStore configured, and it is
+ * configured allow authoritative results. This can result in reducing
+ * round trips to S3 service for cached results, which may affect FS/FC
+ * statistics.
+ public static boolean isMetadataStoreAuthoritative(Configuration conf) {
+ return Constants.DEFAULT_METADATASTORE_AUTHORITATIVE;
+ return conf.getBoolean(
+ Constants.METADATASTORE_AUTHORITATIVE,
+ Constants.DEFAULT_METADATASTORE_AUTHORITATIVE);
* Reset all metrics in a list.
* @param metrics metrics to reset
@@ -503,6 +608,94 @@ public final class S3ATestUtils {
private S3ATestUtils() {
+ * Verify the core size, block size and timestamp values of a file.
+ * @param status status entry to check
+ * @param size file size
+ * @param blockSize block size
+ * @param modTime modified time
+ public static void verifyFileStatus(FileStatus status, long size,
+ long blockSize, long modTime) {
+ verifyFileStatus(status, size, 0, modTime, 0, blockSize, null, null, null);
+ * Verify the status entry of a file matches that expected.
+ * @param replication replication factor (may be 0)
+ * @param accessTime access time (may be 0)
+ * @param owner owner (may be null)
+ * @param group user group (may be null)
+ * @param permission permission (may be null)
+ public static void verifyFileStatus(FileStatus status,
+ long size,
+ int replication,
+ long modTime,
+ long accessTime,
+ long blockSize,
+ String owner,
+ String group,
+ FsPermission permission) {
+ String details = status.toString();
+ assertFalse("Not a dir: " + details, status.isDirectory());
+ assertEquals("Mod time: " + details, modTime, status.getModificationTime());
+ assertEquals("File size: " + details, size, status.getLen());
+ assertEquals("Block size: " + details, blockSize, status.getBlockSize());
+ if (replication > 0) {
+ assertEquals("Replication value: " + details, replication,
+ status.getReplication());
+ if (accessTime != 0) {
+ assertEquals("Access time: " + details, accessTime,
+ status.getAccessTime());
+ if (owner != null) {
+ assertEquals("Owner: " + details, owner, status.getOwner());
+ if (group != null) {
+ assertEquals("Group: " + details, group, status.getGroup());
+ if (permission != null) {
+ assertEquals("Permission: " + details, permission,
+ status.getPermission());
+ * Verify the status entry of a directory matches that expected.
+ * @param replication replication factor
+ * @param accessTime access time
+ * @param owner owner
+ * @param group user group
+ * @param permission permission.
+ public static void verifyDirStatus(FileStatus status,
+ assertTrue("Is a dir: " + details, status.isDirectory());
+ assertEquals("zero length: " + details, 0, status.getLen());
+ assertEquals("Access time: " + details, accessTime, status.getAccessTime());
+ assertEquals("Permission: " + details, permission, status.getPermission());
* Set a bucket specific property to a particular value.
* If the generic key passed in has an {@code fs.s3a. prefix},
@@ -0,0 +1,118 @@
+import org.junit.Assert;
+import static org.apache.hadoop.fs.s3a.Listing.ACCEPT_ALL;
+import static org.apache.hadoop.fs.s3a.Listing.ProvidedFileStatusIterator;
+ * Place for the S3A listing classes; keeps all the small classes under control.
+public class TestListing extends AbstractS3AMockTest {
+ private static class MockRemoteIterator<FileStatus> implements
+ private Iterator<FileStatus> iterator;
+ MockRemoteIterator(Collection<FileStatus> source) {
+ iterator = source.iterator();
+ return iterator.hasNext();
+ return iterator.next();
+ private FileStatus blankFileStatus(Path path) {
+ return new FileStatus(0, true, 0, 0, 0, path);
+ public void testTombstoneReconcilingIterator() throws Exception {
+ Path parent = new Path("/parent");
+ Path liveChild = new Path(parent, "/liveChild");
+ Path deletedChild = new Path(parent, "/deletedChild");
+ Path[] allFiles = {parent, liveChild, deletedChild};
+ Path[] liveFiles = {parent, liveChild};
+ Listing listing = new Listing(fs);
+ Collection<FileStatus> statuses = new ArrayList<>();
+ statuses.add(blankFileStatus(parent));
+ statuses.add(blankFileStatus(liveChild));
+ statuses.add(blankFileStatus(deletedChild));
+ tombstones.add(deletedChild);
+ RemoteIterator<FileStatus> sourceIterator = new MockRemoteIterator(
+ statuses);
+ RemoteIterator<LocatedFileStatus> locatedIterator =
+ listing.createLocatedFileStatusIterator(sourceIterator);
+ RemoteIterator<LocatedFileStatus> reconcilingIterator =
+ listing.createTombstoneReconcilingIterator(locatedIterator, tombstones);
+ Set<Path> expectedPaths = new HashSet<>();
+ expectedPaths.add(parent);
+ expectedPaths.add(liveChild);
+ Set<Path> actualPaths = new HashSet<>();
+ while (reconcilingIterator.hasNext()) {
+ actualPaths.add(reconcilingIterator.next().getPath());
+ Assert.assertTrue(actualPaths.equals(expectedPaths));
+ public void testProvidedFileStatusIteratorEnd() throws Exception {
+ FileStatus[] statuses = {
+ new FileStatus(100, false, 1, 8192, 0, new Path("s3a://blah/blah"))
+ ProvidedFileStatusIterator it = new ProvidedFileStatusIterator(statuses,
+ ACCEPT_ALL, new Listing.AcceptAllButS3nDirs());
+ Assert.assertTrue("hasNext() should return true first time", it.hasNext());
+ Assert.assertNotNull("first element should not be null", it.next());
+ Assert.assertFalse("hasNext() should now be false", it.hasNext());
+ it.next();
+ Assert.fail("next() should have thrown exception");
+ } catch (NoSuchElementException e) {
+ // Correct behavior. Any other exceptions are propagated as failure.
@@ -39,7 +39,9 @@ public class ITestS3AFileContextStatistics extends FCStatisticsBaseTest {
@After
public void tearDown() throws Exception {
- fc.delete(fileContextTestHelper.getTestRootPath(fc, "test"), true);
+ if (fc != null) {
+ fc.delete(fileContextTestHelper.getTestRootPath(fc, "test"), true);
@@ -16,19 +16,29 @@ package org.apache.hadoop.fs.s3a.fileContext;
import org.apache.hadoop.fs.FileContextURIBase;
import org.junit.Ignore;
+import static org.apache.hadoop.fs.s3a.S3ATestUtils.assume;
+import static org.apache.hadoop.fs.s3a.S3ATestUtils.createTestFileSystem;
* S3a implementation of FileContextURIBase.
public class ITestS3AFileContextURI extends FileContextURIBase {
+ private boolean hasMetadataStore;
@Before
public void setUp() throws IOException, Exception {
- Configuration conf = new Configuration();
+ conf = new Configuration();
+ try(S3AFileSystem s3aFS = createTestFileSystem(conf)) {
+ hasMetadataStore = s3aFS.hasMetadataStore();
fc1 = S3ATestUtils.createTestFileContext(conf);
fc2 = S3ATestUtils.createTestFileContext(conf); //different object, same FS
super.setUp();
@@ -41,4 +51,11 @@ public class ITestS3AFileContextURI extends FileContextURIBase {
// (the statistics tested with this method are not relevant for an S3FS)
+ public void testModificationTime() throws IOException {
+ // skip modtime tests as there may be some inconsistency during creation
+ assume("modification time tests are skipped", !hasMetadataStore);
+ super.testModificationTime();
@@ -0,0 +1,33 @@
+ * Test specification for MetadataStore contract tests. Supplies configuration
+ * and MetadataStore instance.
+public abstract class AbstractMSContract {
+ public abstract FileSystem getFileSystem() throws IOException;
+ public abstract MetadataStore getMetadataStore() throws IOException;
@@ -0,0 +1,161 @@
+import org.apache.hadoop.fs.s3a.AbstractS3ATestBase;
+import org.apache.hadoop.fs.s3a.S3ATestUtils;
+import static org.apache.hadoop.fs.s3a.s3guard.S3GuardTool.SUCCESS;
+ * Common functionality for S3GuardTool test cases.
+public abstract class AbstractS3GuardToolTestBase extends AbstractS3ATestBase {
+ protected static final String OWNER = "hdfs";
+ private MetadataStore ms;
+ protected static void expectResult(int expected,
+ String message,
+ S3GuardTool tool,
+ String... args) throws Exception {
+ assertEquals(message, expected, tool.run(args));
+ protected static void expectSuccess(
+ assertEquals(message, SUCCESS, tool.run(args));
+ protected MetadataStore getMetadataStore() {
+ return ms;
+ protected abstract MetadataStore newMetadataStore();
+ public void setup() throws Exception {
+ super.setup();
+ S3ATestUtils.assumeS3GuardState(true, getConfiguration());
+ ms = newMetadataStore();
+ ms.initialize(getFileSystem());
+ IOUtils.cleanupWithLogger(LOG, ms);
+ protected void mkdirs(Path path, boolean onS3, boolean onMetadataStore)
+ if (onS3) {
+ getFileSystem().mkdirs(path);
+ if (onMetadataStore) {
+ S3AFileStatus status = new S3AFileStatus(true, path, OWNER);
+ protected static void putFile(MetadataStore ms, S3AFileStatus f)
+ assertNotNull(f);
+ ms.put(new PathMetadata(f));
+ S3AFileStatus dir = new S3AFileStatus(false, parent, f.getOwner());
+ ms.put(new PathMetadata(dir));
+ * Create file either on S3 or in metadata store.
+ * @param path the file path.
+ * @param onS3 set to true to create the file on S3.
+ * @param onMetadataStore set to true to create the file on the
+ * @throws IOException IO problem
+ protected void createFile(Path path, boolean onS3, boolean onMetadataStore)
+ ContractTestUtils.touch(getFileSystem(), path);
+ S3AFileStatus status = new S3AFileStatus(100L, System.currentTimeMillis(),
+ getFileSystem().qualify(path), 512L, "hdfs");
+ putFile(ms, status);
+ private void testPruneCommand(Configuration cmdConf, String...args)
+ Path parent = path("prune-cli");
+ getFileSystem().mkdirs(parent);
+ S3GuardTool.Prune cmd = new S3GuardTool.Prune(cmdConf);
+ cmd.setMetadataStore(ms);
+ createFile(new Path(parent, "stale"), true, true);
+ Thread.sleep(TimeUnit.SECONDS.toMillis(2));
+ createFile(new Path(parent, "fresh"), true, true);
+ assertEquals(2, ms.listChildren(parent).getListing().size());
+ expectSuccess("Prune command did not exit successfully - see output", cmd,
+ args);
+ assertEquals(1, ms.listChildren(parent).getListing().size());
+ getFileSystem().delete(parent, true);
+ ms.prune(Long.MAX_VALUE);
+ public void testPruneCommandCLI() throws Exception {
+ String testPath = path("testPruneCommandCLI").toString();
+ testPruneCommand(getFileSystem().getConf(),
+ "prune", "-seconds", "1", testPath);
+ public void testPruneCommandConf() throws Exception {
+ getConfiguration().setLong(Constants.S3GUARD_CLI_PRUNE_AGE,
+ TimeUnit.SECONDS.toMillis(1));
+ String testPath = path("testPruneCommandConf").toString();
+ testPruneCommand(getConfiguration(), "prune", testPath);
@@ -0,0 +1,157 @@
+import java.io.File;
+import com.amazonaws.client.builder.AwsClientBuilder;
+import com.amazonaws.services.dynamodbv2.local.main.ServerRunner;
+import com.amazonaws.services.dynamodbv2.local.server.DynamoDBProxyServer;
+import org.apache.hadoop.net.ServerSocketUtil;
+import static org.apache.hadoop.fs.s3a.s3guard.DynamoDBClientFactory.DefaultDynamoDBClientFactory.getRegion;
+ * A DynamoDBClientFactory implementation that creates AmazonDynamoDB clients
+ * against an in-memory DynamoDBLocal server instance.
+ * You won't be charged bills for issuing any DynamoDB requests. However, the
+ * DynamoDBLocal is considered a simulator of the DynamoDB web service, so it
+ * may be stale or different. For example, the throttling is not yet supported
+ * in DynamoDBLocal. This is for testing purpose only.
+ * To use this for creating DynamoDB client in tests:
+ * <ol>
+ * <li>
+ * As all DynamoDBClientFactory implementations, this should be configured.
+ * </li>
+ * The singleton DynamoDBLocal server instance is started automatically when
+ * creating the AmazonDynamoDB client for the first time. It still merits to
+ * launch the server before all the tests and fail fast if error happens.
+ * The server can be stopped explicitly, which is not actually needed in
+ * tests as JVM termination will do that.
+ * </ol>
+ * @see DefaultDynamoDBClientFactory
+public class DynamoDBLocalClientFactory extends Configured
+ /** The DynamoDBLocal dynamoDBLocalServer instance for testing. */
+ private static DynamoDBProxyServer dynamoDBLocalServer;
+ private static String ddbEndpoint;
+ private static final String SYSPROP_SQLITE_LIB = "sqlite4java.library.path";
+ startSingletonServer();
+ // fail fast in case of service errors
+ awsConf.setMaxErrorRetry(3);
+ LOG.info("Creating DynamoDBLocal client using endpoint {} in region {}",
+ ddbEndpoint, region);
+ .withEndpointConfiguration(
+ new AwsClientBuilder.EndpointConfiguration(ddbEndpoint, region))
+ * Start a singleton in-memory DynamoDBLocal server if not started yet.
+ * @throws IOException if any error occurs
+ public synchronized static void startSingletonServer() throws IOException {
+ if (dynamoDBLocalServer != null) {
+ // Set this property if it has not been set elsewhere
+ if (StringUtils.isEmpty(System.getProperty(SYSPROP_SQLITE_LIB))) {
+ String projectBuildDir = System.getProperty("project.build.directory");
+ if (StringUtils.isEmpty(projectBuildDir)) {
+ projectBuildDir = "target";
+ // sqlite4java lib should have been copied to $projectBuildDir/native-libs
+ System.setProperty(SYSPROP_SQLITE_LIB,
+ projectBuildDir + File.separator + "native-libs");
+ LOG.info("Setting {} -> {}",
+ SYSPROP_SQLITE_LIB, System.getProperty(SYSPROP_SQLITE_LIB));
+ // Start an in-memory local DynamoDB instance
+ final String port = String.valueOf(ServerSocketUtil.getPort(0, 100));
+ ddbEndpoint = "http://localhost:" + port;
+ dynamoDBLocalServer = ServerRunner.createServerFromCommandLineArgs(
+ new String[]{"-inMemory", "-port", port});
+ dynamoDBLocalServer.start();
+ LOG.info("DynamoDBLocal singleton server was started at {}", ddbEndpoint);
+ } catch (Exception t) {
+ String msg = "Error starting DynamoDBLocal server at " + ddbEndpoint
+ + " " + t;
+ LOG.error(msg, t);
+ throw new IOException(msg, t);
+ * Stop the in-memory DynamoDBLocal server if it is started.
+ public synchronized static void stopSingletonServer() throws IOException {
+ LOG.info("Shutting down the in-memory DynamoDBLocal server");
+ dynamoDBLocalServer.stop();
+ } catch (Throwable t) {
+ String msg = "Error stopping DynamoDBLocal server at " + ddbEndpoint;
@@ -0,0 +1,160 @@
+import java.util.Random;
+import java.util.concurrent.ExecutorService;
+import java.util.concurrent.Executors;
+import java.util.concurrent.Future;
+import java.util.concurrent.ThreadFactory;
+import java.util.concurrent.ThreadPoolExecutor;
+import java.util.concurrent.atomic.AtomicInteger;
+import org.junit.Rule;
+import org.junit.rules.Timeout;
+ * Tests concurrent operations on S3Guard.
+public class ITestS3GuardConcurrentOps extends AbstractS3ATestBase {
+ @Rule
+ public final Timeout timeout = new Timeout(5 * 60 * 1000);
+ private void failIfTableExists(DynamoDB db, String tableName) {
+ boolean tableExists = true;
+ Table table = db.getTable(tableName);
+ table.describe();
+ } catch (ResourceNotFoundException e) {
+ tableExists = false;
+ if (tableExists) {
+ fail("Table already exists: " + tableName);
+ private void deleteTable(DynamoDB db, String tableName) throws
+ InterruptedException {
+ table.waitForActive();
+ LOG.warn("Failed to delete {}, as it was not found", tableName, e);
+ public void testConcurrentTableCreations() throws Exception {
+ final Configuration conf = getConfiguration();
+ Assume.assumeTrue("Test only applies when DynamoDB is used for S3Guard",
+ conf.get(Constants.S3_METADATA_STORE_IMPL).equals(
+ Constants.S3GUARD_METASTORE_DYNAMO));
+ DynamoDBMetadataStore ms = new DynamoDBMetadataStore();
+ DynamoDB db = ms.getDynamoDB();
+ String tableName = "testConcurrentTableCreations" + new Random().nextInt();
+ conf.setBoolean(Constants.S3GUARD_DDB_TABLE_CREATE_KEY, true);
+ conf.set(Constants.S3GUARD_DDB_TABLE_NAME_KEY, tableName);
+ // no region set, so pick it up from the test bucket
+ conf.set(S3GUARD_DDB_REGION_KEY, getFileSystem().getBucketLocation());
+ int concurrentOps = 16;
+ int iterations = 4;
+ failIfTableExists(db, tableName);
+ for (int i = 0; i < iterations; i++) {
+ ExecutorService executor = Executors.newFixedThreadPool(
+ concurrentOps, new ThreadFactory() {
+ private AtomicInteger count = new AtomicInteger(0);
+ public Thread newThread(Runnable r) {
+ return new Thread(r,
+ "testConcurrentTableCreations" + count.getAndIncrement());
+ ((ThreadPoolExecutor) executor).prestartAllCoreThreads();
+ Future<Exception>[] futures = new Future[concurrentOps];
+ for (int f = 0; f < concurrentOps; f++) {
+ final int index = f;
+ futures[f] = executor.submit(new Callable<Exception>() {
+ public Exception call() throws Exception {
+ ContractTestUtils.NanoTimer timer =
+ new ContractTestUtils.NanoTimer();
+ Exception result = null;
+ try (DynamoDBMetadataStore store = new DynamoDBMetadataStore()) {
+ store.initialize(conf);
+ LOG.error(e.getClass() + ": " + e.getMessage());
+ result = e;
+ timer.end("Parallel DynamoDB client creation %d", index);
+ LOG.info("Parallel DynamoDB client creation {} ran from {} to {}",
+ index, timer.getStartTime(), timer.getEndTime());
+ List<Exception> exceptions = new ArrayList<>(concurrentOps);
+ Exception outcome = futures[f].get();
+ if (outcome != null) {
+ exceptions.add(outcome);
+ deleteTable(db, tableName);
+ int exceptionsThrown = exceptions.size();
+ if (exceptionsThrown > 0) {
+ // at least one exception was thrown. Fail the test & nest the first
+ // exception caught
+ throw new AssertionError(exceptionsThrown + "/" + concurrentOps +
+ " threads threw exceptions while initializing on iteration " + i,
+ exceptions.get(0));
@@ -0,0 +1,134 @@
+import org.apache.hadoop.fs.s3a.s3guard.S3GuardTool.Destroy;
+import org.apache.hadoop.fs.s3a.s3guard.S3GuardTool.Init;
+ * Test S3Guard related CLI commands against DynamoDB.
+public class ITestS3GuardToolDynamoDB extends AbstractS3GuardToolTestBase {
+ protected MetadataStore newMetadataStore() {
+ return new DynamoDBMetadataStore();
+ // Check the existence of a given DynamoDB table.
+ private static boolean exist(DynamoDB dynamoDB, String tableName) {
+ assertNotNull(dynamoDB);
+ assertNotNull(tableName);
+ assertFalse("empty table name", tableName.isEmpty());
+ Table table = dynamoDB.getTable(tableName);
+ public void testInvalidRegion() throws Exception {
+ final String testTableName = "testInvalidRegion" + new Random().nextInt();
+ final String testRegion = "invalidRegion";
+ // Initialize MetadataStore
+ final Init initCmd = new Init(getFileSystem().getConf());
+ LambdaTestUtils.intercept(IOException.class,
+ new Callable<String>() {
+ public String call() throws Exception {
+ int res = initCmd.run(new String[]{
+ "init",
+ "-region", testRegion,
+ "-meta", "dynamodb://" + testTableName
+ return "Use of invalid region did not fail, returning " + res
+ + "- table may have been " +
+ "created and not cleaned up: " + testTableName;
+ public void testDynamoDBInitDestroyCycle() throws Exception {
+ String testTableName = "testDynamoDBInitDestroy" + new Random().nextInt();
+ String testS3Url = path(testTableName).toString();
+ DynamoDB db = null;
+ Init initCmd = new Init(fs.getConf());
+ expectSuccess("Init command did not exit successfully - see output",
+ initCmd,
+ "init", "-meta", "dynamodb://" + testTableName, testS3Url);
+ // Verify it exists
+ MetadataStore ms = getMetadataStore();
+ assertTrue("metadata store should be DynamoDBMetadataStore",
+ ms instanceof DynamoDBMetadataStore);
+ DynamoDBMetadataStore dynamoMs = (DynamoDBMetadataStore) ms;
+ db = dynamoMs.getDynamoDB();
+ assertTrue(String.format("%s does not exist", testTableName),
+ exist(db, testTableName));
+ // Destroy MetadataStore
+ Destroy destroyCmd = new Destroy(fs.getConf());
+ expectSuccess("Destroy command did not exit successfully - see output",
+ destroyCmd,
+ "destroy", "-meta", "dynamodb://" + testTableName, testS3Url);
+ // Verify it does not exist
+ assertFalse(String.format("%s still exists", testTableName),
+ // delete again and expect success again
+ throw new AssertionError(
+ String.format("DynamoDB table %s does not exist", testTableName),
+ e);
+ LOG.warn("Table may have not been cleaned up: " +
+ testTableName);
+ if (db != null) {
+ Table table = db.getTable(testTableName);
+ if (table != null) {
+ } catch (ResourceNotFoundException e) { /* Ignore */ }
@@ -0,0 +1,149 @@
+import java.io.BufferedReader;
+import java.io.ByteArrayOutputStream;
+import java.io.InputStreamReader;
+import org.apache.hadoop.fs.s3a.s3guard.S3GuardTool.Diff;
+ * Test S3Guard related CLI commands against a LocalMetadataStore.
+public class ITestS3GuardToolLocal extends AbstractS3GuardToolTestBase {
+ return new LocalMetadataStore();
+ public void testImportCommand() throws Exception {
+ Path parent = path("test-import");
+ Path dir = new Path(parent, "a");
+ fs.mkdirs(dir);
+ Path emptyDir = new Path(parent, "emptyDir");
+ fs.mkdirs(emptyDir);
+ for (int i = 0; i < 10; i++) {
+ String child = String.format("file-%d", i);
+ try (FSDataOutputStream out = fs.create(new Path(dir, child))) {
+ out.write(1);
+ S3GuardTool.Import cmd = new S3GuardTool.Import(fs.getConf());
+ cmd.setStore(ms);
+ expectSuccess("Import command did not exit successfully - see output",
+ cmd,
+ "import", parent.toString());
+ DirListingMetadata children =
+ ms.listChildren(dir);
+ assertEquals("Unexpected number of paths imported", 10, children
+ .getListing().size());
+ assertEquals("Expected 2 items: empty directory and a parent directory", 2,
+ ms.listChildren(parent).getListing().size());
+ // assertTrue(children.isAuthoritative());
+ public void testDiffCommand() throws IOException {
+ Set<Path> filesOnS3 = new HashSet<>(); // files on S3.
+ Set<Path> filesOnMS = new HashSet<>(); // files on metadata store.
+ Path testPath = path("test-diff");
+ mkdirs(testPath, true, true);
+ Path msOnlyPath = new Path(testPath, "ms_only");
+ mkdirs(msOnlyPath, false, true);
+ filesOnMS.add(msOnlyPath);
+ for (int i = 0; i < 5; i++) {
+ Path file = new Path(msOnlyPath, String.format("file-%d", i));
+ createFile(file, false, true);
+ filesOnMS.add(file);
+ Path s3OnlyPath = new Path(testPath, "s3_only");
+ mkdirs(s3OnlyPath, true, false);
+ filesOnS3.add(s3OnlyPath);
+ Path file = new Path(s3OnlyPath, String.format("file-%d", i));
+ createFile(file, true, false);
+ filesOnS3.add(file);
+ ByteArrayOutputStream buf = new ByteArrayOutputStream();
+ PrintStream out = new PrintStream(buf);
+ Diff cmd = new Diff(fs.getConf());
+ assertEquals("Diff command did not exit successfully - see output", SUCCESS,
+ cmd.run(new String[]{"diff", "-meta", "local://metadata",
+ testPath.toString()}, out));
+ out.close();
+ Set<Path> actualOnS3 = new HashSet<>();
+ Set<Path> actualOnMS = new HashSet<>();
+ boolean duplicates = false;
+ try (BufferedReader reader =
+ new BufferedReader(new InputStreamReader(
+ new ByteArrayInputStream(buf.toByteArray())))) {
+ String line;
+ while ((line = reader.readLine()) != null) {
+ String[] fields = line.split("\\s");
+ assertEquals("[" + line + "] does not have enough fields",
+ 4, fields.length);
+ String where = fields[0];
+ Path path = new Path(fields[3]);
+ if (Diff.S3_PREFIX.equals(where)) {
+ duplicates = duplicates || actualOnS3.contains(path);
+ actualOnS3.add(path);
+ } else if (Diff.MS_PREFIX.equals(where)) {
+ duplicates = duplicates || actualOnMS.contains(path);
+ actualOnMS.add(path);
+ fail("Unknown prefix: " + where);
+ String actualOut = out.toString();
+ assertEquals("Mismatched metadata store outputs: " + actualOut,
+ filesOnMS, actualOnMS);
+ assertEquals("Mismatched s3 outputs: " + actualOut, filesOnS3, actualOnS3);
+ assertFalse("Diff contained duplicates", duplicates);
@@ -0,0 +1,887 @@
+import com.google.common.collect.Sets;
+import org.junit.After;
+import org.junit.Before;
+ * Main test class for MetadataStore implementations.
+ * Implementations should each create a test by subclassing this and
+ * overriding {@link #createContract()}.
+ * If your implementation may return missing results for recently set paths,
+ * override {@link MetadataStoreTestBase#allowMissing()}.
+public abstract class MetadataStoreTestBase extends Assert {
+ LoggerFactory.getLogger(MetadataStoreTestBase.class);
+ /** Some dummy values for sanity-checking FileStatus contents. */
+ static final long BLOCK_SIZE = 32 * 1024 * 1024;
+ static final int REPLICATION = 1;
+ static final FsPermission PERMISSION = new FsPermission((short)0755);
+ static final String OWNER = "bob";
+ static final String GROUP = "uncles";
+ private final long accessTime = System.currentTimeMillis();
+ private final long modTime = accessTime - 5000;
+ * Each test should override this. Will use a new Configuration instance.
+ * @return Contract which specifies the MetadataStore under test plus config.
+ public abstract AbstractMSContract createContract() throws IOException;
+ * Each test should override this.
+ * @param conf Base configuration instance to use.
+ public abstract AbstractMSContract createContract(Configuration conf)
+ * Tests assume that implementations will return recently set results. If
+ * your implementation does not always hold onto metadata (e.g. LRU or
+ * time-based expiry) you can override this to return false.
+ * @return true if the test should succeed when null results are returned
+ * from the MetadataStore under test.
+ public boolean allowMissing() {
+ * Pruning is an optional feature for metadata store implementations.
+ * Tests will only check that functionality if it is expected to work.
+ * @return true if the test should expect pruning to work.
+ public boolean supportsPruning() {
+ /** The MetadataStore contract used to test against. */
+ private AbstractMSContract contract;
+ * @return reference to the test contract.
+ protected AbstractMSContract getContract() {
+ return contract;
+ @Before
+ public void setUp() throws Exception {
+ LOG.debug("== Setup. ==");
+ contract = createContract();
+ ms = contract.getMetadataStore();
+ assertNotNull("null MetadataStore", ms);
+ assertNotNull("null FileSystem", contract.getFileSystem());
+ ms.initialize(contract.getFileSystem());
+ @After
+ public void tearDown() throws Exception {
+ LOG.debug("== Tear down. ==");
+ if (ms != null) {
+ ms.destroy();
+ LOG.warn("Failed to destroy tables in teardown", e);
+ IOUtils.closeStream(ms);
+ ms = null;
+ * Helper function for verifying DescendantsIterator and
+ * MetadataStoreListFilesIterator behavior.
+ * @param createNodes List of paths to create
+ * @param checkNodes List of paths that the iterator should return
+ private void doTestDescendantsIterator(
+ Class implementation, String[] createNodes,
+ String[] checkNodes) throws Exception {
+ // we set up the example file system tree in metadata store
+ for (String pathStr : createNodes) {
+ final FileStatus status = pathStr.contains("file")
+ ? basicFileStatus(strToPath(pathStr), 100, false)
+ : basicFileStatus(strToPath(pathStr), 0, true);
+ final PathMetadata rootMeta = new PathMetadata(makeDirStatus("/"));
+ RemoteIterator<FileStatus> iterator;
+ if (implementation == DescendantsIterator.class) {
+ iterator = new DescendantsIterator(ms, rootMeta);
+ } else if (implementation == MetadataStoreListFilesIterator.class) {
+ iterator = new MetadataStoreListFilesIterator(ms, rootMeta, false);
+ throw new UnsupportedOperationException("Unrecognized class");
+ final Set<String> actual = new HashSet<>();
+ while (iterator.hasNext()) {
+ final Path p = iterator.next().getPath();
+ actual.add(Path.getPathWithoutSchemeAndAuthority(p).toString());
+ LOG.info("We got {} by iterating DescendantsIterator", actual);
+ if (!allowMissing()) {
+ assertEquals(Sets.newHashSet(checkNodes), actual);
+ * Test that we can get the whole sub-tree by iterating DescendantsIterator.
+ * The tree is similar to or same as the example in code comment.
+ public void testDescendantsIterator() throws Exception {
+ final String[] tree = new String[] {
+ "/dir1",
+ "/dir1/dir2",
+ "/dir1/dir3",
+ "/dir1/dir2/file1",
+ "/dir1/dir2/file2",
+ "/dir1/dir3/dir4",
+ "/dir1/dir3/dir5",
+ "/dir1/dir3/dir4/file3",
+ "/dir1/dir3/dir5/file4",
+ "/dir1/dir3/dir6"
+ doTestDescendantsIterator(DescendantsIterator.class,
+ tree, tree);
+ * Test that we can get the correct subset of the tree with
+ * MetadataStoreListFilesIterator.
+ public void testMetadataStoreListFilesIterator() throws Exception {
+ final String[] wholeTree = new String[] {
+ final String[] leafNodes = new String[] {
+ "/dir1/dir3/dir5/file4"
+ doTestDescendantsIterator(MetadataStoreListFilesIterator.class, wholeTree,
+ leafNodes);
+ public void testPutNew() throws Exception {
+ /* create three dirs /da1, /da2, /da3 */
+ createNewDirs("/da1", "/da2", "/da3");
+ /* It is caller's responsibility to set up ancestor entries beyond the
+ * containing directory. We only track direct children of the directory.
+ * Thus this will not affect entry for /da1.
+ ms.put(new PathMetadata(makeFileStatus("/da1/db1/fc1", 100)));
+ assertEmptyDirs("/da2", "/da3");
+ assertDirectorySize("/da1/db1", 1);
+ /* Check contents of dir status. */
+ PathMetadata dirMeta = ms.get(strToPath("/da1"));
+ if (!allowMissing() || dirMeta != null) {
+ verifyDirStatus(dirMeta.getFileStatus());
+ /* This already exists, and should silently replace it. */
+ ms.put(new PathMetadata(makeDirStatus("/da1/db1")));
+ /* If we had putNew(), and used it above, this would be empty again. */
+ assertDirectorySize("/da1", 1);
+ /* Ensure new files update correct parent dirs. */
+ ms.put(new PathMetadata(makeFileStatus("/da1/db1/fc2", 200)));
+ assertDirectorySize("/da1/db1", 2);
+ PathMetadata meta = ms.get(strToPath("/da1/db1/fc2"));
+ if (!allowMissing() || meta != null) {
+ assertNotNull("Get file after put new.", meta);
+ verifyFileStatus(meta.getFileStatus(), 200);
+ public void testPutOverwrite() throws Exception {
+ final String filePath = "/a1/b1/c1/some_file";
+ final String dirPath = "/a1/b1/c1/d1";
+ ms.put(new PathMetadata(makeFileStatus(filePath, 100)));
+ ms.put(new PathMetadata(makeDirStatus(dirPath)));
+ PathMetadata meta = ms.get(strToPath(filePath));
+ verifyFileStatus(meta.getFileStatus(), 100);
+ ms.put(new PathMetadata(basicFileStatus(strToPath(filePath), 9999, false)));
+ meta = ms.get(strToPath(filePath));
+ verifyFileStatus(meta.getFileStatus(), 9999);
+ public void testRootDirPutNew() throws Exception {
+ Path rootPath = strToPath("/");
+ ms.put(new PathMetadata(makeFileStatus("/file1", 100)));
+ DirListingMetadata dir = ms.listChildren(rootPath);
+ if (!allowMissing() || dir != null) {
+ assertNotNull("Root dir cached", dir);
+ assertFalse("Root not fully cached", dir.isAuthoritative());
+ assertNotNull("have root dir file listing", dir.getListing());
+ assertEquals("One file in root dir", 1, dir.getListing().size());
+ assertEquals("file1 in root dir", strToPath("/file1"),
+ dir.getListing().iterator().next().getFileStatus().getPath());
+ public void testDelete() throws Exception {
+ setUpDeleteTest();
+ ms.delete(strToPath("/ADirectory1/db1/file2"));
+ /* Ensure delete happened. */
+ assertDirectorySize("/ADirectory1/db1", 1);
+ PathMetadata meta = ms.get(strToPath("/ADirectory1/db1/file2"));
+ assertTrue("File deleted", meta == null || meta.isDeleted());
+ public void testDeleteSubtree() throws Exception {
+ deleteSubtreeHelper("");
+ public void testDeleteSubtreeHostPath() throws Exception {
+ deleteSubtreeHelper(contract.getFileSystem().getUri().toString());
+ private void deleteSubtreeHelper(String pathPrefix) throws Exception {
+ String p = pathPrefix;
+ setUpDeleteTest(p);
+ createNewDirs(p + "/ADirectory1/db1/dc1", p + "/ADirectory1/db1/dc1/dd1");
+ ms.put(new PathMetadata(
+ makeFileStatus(p + "/ADirectory1/db1/dc1/dd1/deepFile", 100)));
+ assertCached(p + "/ADirectory1/db1");
+ ms.deleteSubtree(strToPath(p + "/ADirectory1/db1/"));
+ assertEmptyDirectory(p + "/ADirectory1");
+ assertDeleted(p + "/ADirectory1/db1");
+ assertDeleted(p + "/ADirectory1/file1");
+ assertDeleted(p + "/ADirectory1/file2");
+ assertDeleted(p + "/ADirectory1/db1/dc1/dd1/deepFile");
+ assertEmptyDirectory(p + "/ADirectory2");
+ /*
+ * Some implementations might not support this. It was useful to test
+ * correctness of the LocalMetadataStore implementation, but feel free to
+ * override this to be a no-op.
+ public void testDeleteRecursiveRoot() throws Exception {
+ ms.deleteSubtree(strToPath("/"));
+ assertDeleted("/ADirectory1");
+ assertDeleted("/ADirectory2");
+ assertDeleted("/ADirectory2/db1");
+ assertDeleted("/ADirectory2/db1/file1");
+ assertDeleted("/ADirectory2/db1/file2");
+ public void testDeleteNonExisting() throws Exception {
+ // Path doesn't exist, but should silently succeed
+ ms.delete(strToPath("/bobs/your/uncle"));
+ // Ditto.
+ ms.deleteSubtree(strToPath("/internets"));
+ private void setUpDeleteTest() throws IOException {
+ setUpDeleteTest("");
+ private void setUpDeleteTest(String prefix) throws IOException {
+ createNewDirs(prefix + "/ADirectory1", prefix + "/ADirectory2",
+ prefix + "/ADirectory1/db1");
+ ms.put(new PathMetadata(makeFileStatus(prefix + "/ADirectory1/db1/file1",
+ 100)));
+ ms.put(new PathMetadata(makeFileStatus(prefix + "/ADirectory1/db1/file2",
+ PathMetadata meta = ms.get(strToPath(prefix + "/ADirectory1/db1/file2"));
+ assertNotNull("Found test file", meta);
+ assertDirectorySize(prefix + "/ADirectory1/db1", 2);
+ public void testGet() throws Exception {
+ assertNotNull("Get found file", meta);
+ if (!(ms instanceof NullMetadataStore)) {
+ ms.delete(strToPath(filePath));
+ assertTrue("Tombstone not left for deleted file", meta.isDeleted());
+ meta = ms.get(strToPath(dirPath));
+ assertNotNull("Get found file (dir)", meta);
+ assertTrue("Found dir", meta.getFileStatus().isDirectory());
+ meta = ms.get(strToPath("/bollocks"));
+ assertNull("Don't get non-existent file", meta);
+ public void testGetEmptyDir() throws Exception {
+ // Creates /a1/b1/c1/d1 as an empty dir
+ setupListStatus();
+ // 1. Tell MetadataStore (MS) that there are zero children
+ putListStatusFiles(dirPath, true /* authoritative */
+ /* zero children */);
+ // 2. Request a file status for dir, including whether or not the dir
+ // is empty.
+ PathMetadata meta = ms.get(strToPath(dirPath), true);
+ // 3. Check that either (a) the MS doesn't track whether or not it is
+ // empty (which is allowed), or (b) the MS knows the dir is empty.
+ assertNotNull("Get should find meta for dir", meta);
+ assertNotEquals("Dir is empty or unknown", Tristate.FALSE,
+ meta.isEmptyDirectory());
+ public void testGetNonEmptyDir() throws Exception {
+ final String dirPath = "/a1/b1/c1";
+ // Creates /a1/b1/c1 as an non-empty dir
+ // Request a file status for dir, including whether or not the dir
+ // MetadataStore knows /a1/b1/c1 has at least one child. It is valid
+ // for it to answer either (a) UNKNOWN: the MS doesn't track whether
+ // or not the dir is empty, or (b) the MS knows the dir is non-empty.
+ assertNotEquals("Dir is non-empty or unknown", Tristate.TRUE,
+ public void testGetDirUnknownIfEmpty() throws Exception {
+ // 1. Create /a1/b1/c1/d1 as an empty dir, but do not tell MetadataStore
+ // (MS) whether or not it has any children.
+ // 3. Assert MS reports isEmptyDir as UNKONWN: We haven't told MS
+ // whether or not the directory has any children.
+ assertEquals("Dir empty is unknown", Tristate.UNKNOWN,
+ public void testListChildren() throws Exception {
+ DirListingMetadata dirMeta;
+ dirMeta = ms.listChildren(strToPath("/"));
+ assertNotNull(dirMeta);
+ /* Cache has no way of knowing it has all entries for root unless we
+ * specifically tell it via put() with
+ * DirListingMetadata.isAuthoritative = true */
+ assertFalse("Root dir is not cached, or partially cached",
+ dirMeta.isAuthoritative());
+ assertListingsEqual(dirMeta.getListing(), "/a1", "/a2");
+ dirMeta = ms.listChildren(strToPath("/a1"));
+ dirMeta = dirMeta.withoutTombstones();
+ assertListingsEqual(dirMeta.getListing(), "/a1/b1", "/a1/b2");
+ // TODO HADOOP-14756 instrument MetadataStore for asserting & testing
+ dirMeta = ms.listChildren(strToPath("/a1/b1"));
+ assertListingsEqual(dirMeta.getListing(), "/a1/b1/file1", "/a1/b1/file2",
+ "/a1/b1/c1");
+ public void testDirListingRoot() throws Exception {
+ commonTestPutListStatus("/");
+ public void testPutDirListing() throws Exception {
+ commonTestPutListStatus("/a");
+ public void testInvalidListChildren() throws Exception {
+ assertNull("missing path returns null",
+ ms.listChildren(strToPath("/a1/b1x")));
+ public void testMove() throws Exception {
+ // Create test dir structure
+ createNewDirs("/a1", "/a2", "/a3");
+ createNewDirs("/a1/b1", "/a1/b2");
+ putListStatusFiles("/a1/b1", false, "/a1/b1/file1", "/a1/b1/file2");
+ // Assert root listing as expected
+ Collection<PathMetadata> entries;
+ DirListingMetadata dirMeta = ms.listChildren(strToPath("/"));
+ assertNotNull("Listing root", dirMeta);
+ entries = dirMeta.getListing();
+ assertListingsEqual(entries, "/a1", "/a2", "/a3");
+ // Assert src listing as expected
+ assertNotNull("Listing /a1/b1", dirMeta);
+ assertListingsEqual(entries, "/a1/b1/file1", "/a1/b1/file2");
+ // Do the move(): rename(/a1/b1, /b1)
+ Collection<Path> srcPaths = Arrays.asList(strToPath("/a1/b1"),
+ strToPath("/a1/b1/file1"), strToPath("/a1/b1/file2"));
+ ArrayList<PathMetadata> destMetas = new ArrayList<>();
+ destMetas.add(new PathMetadata(makeDirStatus("/b1")));
+ destMetas.add(new PathMetadata(makeFileStatus("/b1/file1", 100)));
+ destMetas.add(new PathMetadata(makeFileStatus("/b1/file2", 100)));
+ ms.move(srcPaths, destMetas);
+ // Assert src is no longer there
+ assertNotNull("Listing /a1", dirMeta);
+ entries = dirMeta.withoutTombstones().getListing();
+ assertListingsEqual(entries, "/a1/b2");
+ PathMetadata meta = ms.get(strToPath("/a1/b1/file1"));
+ assertTrue("Src path deleted", meta == null || meta.isDeleted());
+ // Assert dest looks right
+ meta = ms.get(strToPath("/b1/file1"));
+ assertNotNull("dest file not null", meta);
+ dirMeta = ms.listChildren(strToPath("/b1"));
+ assertNotNull("dest listing not null", dirMeta);
+ assertListingsEqual(entries, "/b1/file1", "/b1/file2");
+ * Test that the MetadataStore differentiates between the same path in two
+ * different buckets.
+ public void testMultiBucketPaths() throws Exception {
+ String p1 = "s3a://bucket-a/path1";
+ String p2 = "s3a://bucket-b/path2";
+ // Make sure we start out empty
+ PathMetadata meta = ms.get(new Path(p1));
+ assertNull("Path should not be present yet.", meta);
+ meta = ms.get(new Path(p2));
+ assertNull("Path2 should not be present yet.", meta);
+ // Put p1, assert p2 doesn't match
+ ms.put(new PathMetadata(makeFileStatus(p1, 100)));
+ assertNull("Path 2 should not match path 1.", meta);
+ // Make sure delete is correct as well
+ ms.delete(new Path(p2));
+ meta = ms.get(new Path(p1));
+ assertNotNull("Path should not have been deleted", meta);
+ ms.delete(new Path(p1));
+ public void testPruneFiles() throws Exception {
+ Assume.assumeTrue(supportsPruning());
+ createNewDirs("/pruneFiles");
+ long oldTime = getTime();
+ ms.put(new PathMetadata(makeFileStatus("/pruneFiles/old", 1, oldTime,
+ oldTime)));
+ DirListingMetadata ls2 = ms.listChildren(strToPath("/pruneFiles"));
+ assertListingsEqual(ls2.getListing(), "/pruneFiles/old");
+ // It's possible for the Local implementation to get from /pruneFiles/old's
+ // modification time to here in under 1ms, causing it to not get pruned
+ Thread.sleep(1);
+ long cutoff = System.currentTimeMillis();
+ long newTime = getTime();
+ ms.put(new PathMetadata(makeFileStatus("/pruneFiles/new", 1, newTime,
+ newTime)));
+ DirListingMetadata ls;
+ ls = ms.listChildren(strToPath("/pruneFiles"));
+ assertListingsEqual(ls.getListing(), "/pruneFiles/new",
+ "/pruneFiles/old");
+ ms.prune(cutoff);
+ if (allowMissing()) {
+ assertDeleted("/pruneFiles/old");
+ assertListingsEqual(ls.getListing(), "/pruneFiles/new");
+ public void testPruneDirs() throws Exception {
+ // We only test that files, not dirs, are removed during prune.
+ // We specifically allow directories to remain, as it is more robust
+ // for DynamoDBMetadataStore's prune() implementation: If a
+ // file was created in a directory while it was being pruned, it would
+ // violate the invariant that all ancestors of a file exist in the table.
+ createNewDirs("/pruneDirs/dir");
+ ms.put(new PathMetadata(makeFileStatus("/pruneDirs/dir/file",
+ 1, oldTime, oldTime)));
+ // It's possible for the Local implementation to get from the old
+ long cutoff = getTime();
+ assertDeleted("/pruneDirs/dir/file");
+ public void testPruneUnsetsAuthoritative() throws Exception {
+ String rootDir = "/unpruned-root-dir";
+ String grandparentDir = rootDir + "/pruned-grandparent-dir";
+ String parentDir = grandparentDir + "/pruned-parent-dir";
+ String staleFile = parentDir + "/stale-file";
+ String freshFile = rootDir + "/fresh-file";
+ String[] directories = {rootDir, grandparentDir, parentDir};
+ createNewDirs(rootDir, grandparentDir, parentDir);
+ long time = System.currentTimeMillis();
+ new FileStatus(0, false, 0, 0, time - 1, strToPath(staleFile)),
+ Tristate.FALSE, false));
+ new FileStatus(0, false, 0, 0, time + 1, strToPath(freshFile)),
+ ms.prune(time);
+ DirListingMetadata listing;
+ for (String directory : directories) {
+ Path path = strToPath(directory);
+ if (ms.get(path) != null) {
+ listing = ms.listChildren(path);
+ assertFalse(listing.isAuthoritative());
+ * Helper functions.
+ /** Modifies paths input array and returns it. */
+ private String[] buildPathStrings(String parent, String... paths)
+ for (int i = 0; i < paths.length; i++) {
+ Path p = new Path(strToPath(parent), paths[i]);
+ paths[i] = p.toString();
+ return paths;
+ private void commonTestPutListStatus(final String parent) throws IOException {
+ putListStatusFiles(parent, true, buildPathStrings(parent, "file1", "file2",
+ "file3"));
+ DirListingMetadata dirMeta = ms.listChildren(strToPath(parent));
+ assertNotNull("list after putListStatus", dirMeta);
+ Collection<PathMetadata> entries = dirMeta.getListing();
+ assertNotNull("listStatus has entries", entries);
+ assertListingsEqual(entries,
+ buildPathStrings(parent, "file1", "file2", "file3"));
+ private void setupListStatus() throws IOException {
+ createNewDirs("/a1", "/a2", "/a1/b1", "/a1/b2", "/a1/b1/c1",
+ "/a1/b1/c1/d1");
+ ms.put(new PathMetadata(makeFileStatus("/a1/b1/file1", 100)));
+ ms.put(new PathMetadata(makeFileStatus("/a1/b1/file2", 100)));
+ private void assertListingsEqual(Collection<PathMetadata> listing,
+ String ...pathStrs) throws IOException {
+ Set<Path> a = new HashSet<>();
+ for (PathMetadata meta : listing) {
+ a.add(meta.getFileStatus().getPath());
+ Set<Path> b = new HashSet<>();
+ for (String ps : pathStrs) {
+ b.add(strToPath(ps));
+ assertEquals("Same set of files", b, a);
+ private void putListStatusFiles(String dirPath, boolean authoritative,
+ String... filenames) throws IOException {
+ ArrayList<PathMetadata> metas = new ArrayList<>(filenames .length);
+ for (String filename : filenames) {
+ metas.add(new PathMetadata(makeFileStatus(filename, 100)));
+ new DirListingMetadata(strToPath(dirPath), metas, authoritative);
+ private void createNewDirs(String... dirs)
+ for (String pathStr : dirs) {
+ ms.put(new PathMetadata(makeDirStatus(pathStr)));
+ private void assertDirectorySize(String pathStr, int size)
+ DirListingMetadata dirMeta = ms.listChildren(strToPath(pathStr));
+ assertNotNull("Directory " + pathStr + " in cache", dirMeta);
+ assertEquals("Number of entries in dir " + pathStr, size,
+ nonDeleted(dirMeta.getListing()).size());
+ /** @return only file statuses which are *not* marked deleted. */
+ private Collection<PathMetadata> nonDeleted(
+ Collection<PathMetadata> statuses) {
+ Collection<PathMetadata> currentStatuses = new ArrayList<>();
+ for (PathMetadata status : statuses) {
+ if (!status.isDeleted()) {
+ currentStatuses.add(status);
+ return currentStatuses;
+ private void assertDeleted(String pathStr) throws IOException {
+ Path path = strToPath(pathStr);
+ PathMetadata meta = ms.get(path);
+ boolean cached = meta != null && !meta.isDeleted();
+ assertFalse(pathStr + " should not be cached.", cached);
+ protected void assertCached(String pathStr) throws IOException {
+ assertTrue(pathStr + " should be cached.", cached);
+ * Convenience to create a fully qualified Path from string.
+ Path strToPath(String p) throws IOException {
+ final Path path = new Path(p);
+ assert path.isAbsolute();
+ return path.makeQualified(contract.getFileSystem().getUri(), null);
+ private void assertEmptyDirectory(String pathStr) throws IOException {
+ assertDirectorySize(pathStr, 0);
+ private void assertEmptyDirs(String ...dirs) throws IOException {
+ assertEmptyDirectory(pathStr);
+ FileStatus basicFileStatus(Path path, int size, boolean isDir) throws
+ return basicFileStatus(path, size, isDir, modTime, accessTime);
+ FileStatus basicFileStatus(Path path, int size, boolean isDir,
+ long newModTime, long newAccessTime) throws IOException {
+ return new FileStatus(size, isDir, REPLICATION, BLOCK_SIZE, newModTime,
+ newAccessTime, PERMISSION, OWNER, GROUP, path);
+ private FileStatus makeFileStatus(String pathStr, int size) throws
+ return makeFileStatus(pathStr, size, modTime, accessTime);
+ private FileStatus makeFileStatus(String pathStr, int size, long newModTime,
+ long newAccessTime) throws IOException {
+ return basicFileStatus(strToPath(pathStr), size, false,
+ newModTime, newAccessTime);
+ void verifyFileStatus(FileStatus status, long size) {
+ S3ATestUtils.verifyFileStatus(status, size, BLOCK_SIZE, modTime);
+ private FileStatus makeDirStatus(String pathStr) throws IOException {
+ return basicFileStatus(strToPath(pathStr), 0, true, modTime, accessTime);
+ * Verify the directory file status. Subclass may verify additional fields.
+ void verifyDirStatus(FileStatus status) {
+ assertTrue("Is a dir", status.isDirectory());
+ assertEquals("zero length", 0, status.getLen());
+ long getModTime() {
+ return modTime;
+ long getAccessTime() {
+ return accessTime;
+ protected static long getTime() {
+ return System.currentTimeMillis();
@@ -0,0 +1,303 @@
+import org.junit.rules.ExpectedException;
+import static org.hamcrest.CoreMatchers.notNullValue;
+ * Unit tests of {@link DirListingMetadata}.
+public class TestDirListingMetadata {
+ private static final String TEST_OWNER = "hadoop";
+ public ExpectedException exception = ExpectedException.none();
+ public void testNullPath() {
+ exception.expect(NullPointerException.class);
+ exception.expectMessage(notNullValue(String.class));
+ new DirListingMetadata(null, null, false);
+ public void testNullListing() {
+ Path path = new Path("/path");
+ DirListingMetadata meta = new DirListingMetadata(path, null, false);
+ assertEquals(path, meta.getPath());
+ assertNotNull(meta.getListing());
+ assertTrue(meta.getListing().isEmpty());
+ assertFalse(meta.isAuthoritative());
+ public void testEmptyListing() {
+ DirListingMetadata meta = new DirListingMetadata(path,
+ new ArrayList<PathMetadata>(0),
+ public void testListing() {
+ PathMetadata pathMeta1 = new PathMetadata(
+ new S3AFileStatus(true, new Path(path, "dir1"), TEST_OWNER));
+ PathMetadata pathMeta2 = new PathMetadata(
+ new S3AFileStatus(true, new Path(path, "dir2"), TEST_OWNER));
+ PathMetadata pathMeta3 = new PathMetadata(
+ new S3AFileStatus(123, 456, new Path(path, "file1"), 8192, TEST_OWNER));
+ List<PathMetadata> listing = Arrays.asList(pathMeta1, pathMeta2, pathMeta3);
+ DirListingMetadata meta = new DirListingMetadata(path, listing, false);
+ assertFalse(meta.getListing().isEmpty());
+ assertTrue(meta.getListing().contains(pathMeta1));
+ assertTrue(meta.getListing().contains(pathMeta2));
+ assertTrue(meta.getListing().contains(pathMeta3));
+ public void testListingUnmodifiable() {
+ DirListingMetadata meta = makeTwoDirsOneFile(path);
+ exception.expect(UnsupportedOperationException.class);
+ meta.getListing().clear();
+ public void testAuthoritative() {
+ DirListingMetadata meta = new DirListingMetadata(path, null, true);
+ assertTrue(meta.isAuthoritative());
+ public void testSetAuthoritative() {
+ meta.setAuthoritative(true);
+ public void testGet() {
+ assertEquals(pathMeta1, meta.get(pathMeta1.getFileStatus().getPath()));
+ assertEquals(pathMeta2, meta.get(pathMeta2.getFileStatus().getPath()));
+ assertEquals(pathMeta3, meta.get(pathMeta3.getFileStatus().getPath()));
+ assertNull(meta.get(new Path(path, "notfound")));
+ public void testGetNull() {
+ meta.get(null);
+ public void testGetRoot() {
+ exception.expect(IllegalArgumentException.class);
+ meta.get(new Path("/"));
+ public void testGetNotChild() {
+ meta.get(new Path("/different/ancestor"));
+ public void testPut() {
+ PathMetadata pathMeta4 = new PathMetadata(
+ new S3AFileStatus(true, new Path(path, "dir3"), TEST_OWNER));
+ meta.put(pathMeta4.getFileStatus());
+ assertTrue(meta.getListing().contains(pathMeta4));
+ assertEquals(pathMeta4, meta.get(pathMeta4.getFileStatus().getPath()));
+ public void testPutNull() {
+ meta.put(null);
+ public void testPutNullPath() {
+ meta.put(new S3AFileStatus(true, null, TEST_OWNER));
+ public void testPutRoot() {
+ meta.put(new S3AFileStatus(true, new Path("/"), TEST_OWNER));
+ public void testPutNotChild() {
+ meta.put(new S3AFileStatus(true, new Path("/different/ancestor"),
+ TEST_OWNER));
+ public void testRemove() {
+ meta.remove(pathMeta1.getFileStatus().getPath());
+ assertFalse(meta.getListing().contains(pathMeta1));
+ assertNull(meta.get(pathMeta1.getFileStatus().getPath()));
+ public void testRemoveNull() {
+ meta.remove(null);
+ public void testRemoveRoot() {
+ meta.remove(new Path("/"));
+ public void testRemoveNotChild() {
+ meta.remove(new Path("/different/ancestor"));
+ * Create DirListingMetadata with two dirs and one file living in directory
+ * 'parent'
+ private static DirListingMetadata makeTwoDirsOneFile(Path parent) {
+ new S3AFileStatus(true, new Path(parent, "dir1"), TEST_OWNER));
+ new S3AFileStatus(true, new Path(parent, "dir2"), TEST_OWNER));
+ new S3AFileStatus(123, 456, new Path(parent, "file1"), 8192,
+ return new DirListingMetadata(parent, listing, false);
@@ -0,0 +1,594 @@
+import com.amazonaws.services.dynamodbv2.model.TableDescription;
+import com.google.common.collect.Lists;
+import org.apache.commons.collections.CollectionUtils;
+import org.junit.AfterClass;
+import org.junit.BeforeClass;
+import org.apache.hadoop.fs.CommonConfigurationKeysPublic;
+import org.apache.hadoop.fs.s3a.MockS3ClientFactory;
+import org.apache.hadoop.fs.s3a.S3ClientFactory;
+import static org.apache.hadoop.fs.s3a.s3guard.DynamoDBMetadataStore.*;
+import static org.apache.hadoop.test.LambdaTestUtils.*;
+ * Test that {@link DynamoDBMetadataStore} implements {@link MetadataStore}.
+ * In this unit test, we use an in-memory DynamoDBLocal server instead of real
+ * AWS DynamoDB. An {@link S3AFileSystem} object is created and shared for
+ * initializing {@link DynamoDBMetadataStore} objects. There are no real S3
+ * request issued as the underlying AWS S3Client is mocked. You won't be
+ * charged bills for AWS S3 or DynamoDB when you run this test.
+ * According to the base class, every test case will have independent contract
+ * to create a new {@link DynamoDBMetadataStore} instance and initializes it.
+ * A table will be created for each test by the test contract, and will be
+ * destroyed after the test case finishes.
+public class TestDynamoDBMetadataStore extends MetadataStoreTestBase {
+ LoggerFactory.getLogger(TestDynamoDBMetadataStore.class);
+ private static final String BUCKET = "TestDynamoDBMetadataStore";
+ private static final String S3URI =
+ URI.create(FS_S3A + "://" + BUCKET + "/").toString();
+ public static final PrimaryKey
+ VERSION_MARKER_PRIMARY_KEY = createVersionMarkerPrimaryKey(
+ DynamoDBMetadataStore.VERSION_MARKER);
+ /** The DynamoDB instance that can issue requests directly to server. */
+ private static DynamoDB dynamoDB;
+ public final Timeout timeout = new Timeout(60 * 1000);
+ * Start the in-memory DynamoDBLocal server and initializes s3 file system.
+ @BeforeClass
+ public static void setUpBeforeClass() throws Exception {
+ DynamoDBLocalClientFactory.startSingletonServer();
+ dynamoDB = new DynamoDBMSContract().getMetadataStore().getDynamoDB();
+ } catch (AmazonServiceException e) {
+ final String msg = "Cannot initialize a DynamoDBMetadataStore instance "
+ + "against the local DynamoDB server. Perhaps the DynamoDBLocal "
+ + "server is not configured correctly. ";
+ LOG.error(msg, e);
+ // fail fast if the DynamoDBLocal server can not work
+ @AfterClass
+ public static void tearDownAfterClass() throws Exception {
+ DynamoDBLocalClientFactory.stopSingletonServer();
+ * Each contract has its own S3AFileSystem and DynamoDBMetadataStore objects.
+ private static class DynamoDBMSContract extends AbstractMSContract {
+ private final S3AFileSystem s3afs;
+ private final DynamoDBMetadataStore ms = new DynamoDBMetadataStore();
+ DynamoDBMSContract() throws IOException {
+ this(new Configuration());
+ DynamoDBMSContract(Configuration conf) throws IOException {
+ // using mocked S3 clients
+ conf.setClass(S3_CLIENT_FACTORY_IMPL, MockS3ClientFactory.class,
+ conf.set(CommonConfigurationKeysPublic.FS_DEFAULT_NAME_KEY, S3URI);
+ // setting config for creating a DynamoDBClient against local server
+ conf.set(ACCESS_KEY, "dummy-access-key");
+ conf.set(SECRET_KEY, "dummy-secret-key");
+ // always create new file system object for a test contract
+ s3afs = (S3AFileSystem) FileSystem.newInstance(conf);
+ ms.initialize(s3afs);
+ public S3AFileSystem getFileSystem() {
+ return s3afs;
+ public DynamoDBMetadataStore getMetadataStore() {
+ public DynamoDBMSContract createContract() throws IOException {
+ return new DynamoDBMSContract();
+ public DynamoDBMSContract createContract(Configuration conf) throws
+ return new DynamoDBMSContract(conf);
+ FileStatus basicFileStatus(Path path, int size, boolean isDir)
+ String owner = UserGroupInformation.getCurrentUser().getShortUserName();
+ return isDir
+ ? new S3AFileStatus(true, path, owner)
+ : new S3AFileStatus(size, getModTime(), path, BLOCK_SIZE, owner);
+ private DynamoDBMetadataStore getDynamoMetadataStore() throws IOException {
+ return (DynamoDBMetadataStore) getContract().getMetadataStore();
+ private S3AFileSystem getFileSystem() throws IOException {
+ return (S3AFileSystem) getContract().getFileSystem();
+ * This tests that after initialize() using an S3AFileSystem object, the
+ * instance should have been initialized successfully, and tables are ACTIVE.
+ public void testInitialize() throws IOException {
+ final String tableName = "testInitializeWithFileSystem";
+ final S3AFileSystem s3afs = getFileSystem();
+ final Configuration conf = s3afs.getConf();
+ conf.set(S3GUARD_DDB_TABLE_NAME_KEY, tableName);
+ try (DynamoDBMetadataStore ddbms = new DynamoDBMetadataStore()) {
+ ddbms.initialize(s3afs);
+ verifyTableInitialized(tableName);
+ assertNotNull(ddbms.getTable());
+ assertEquals(tableName, ddbms.getTable().getTableName());
+ String expectedRegion = conf.get(S3GUARD_DDB_REGION_KEY,
+ s3afs.getBucketLocation(tableName));
+ assertEquals("DynamoDB table should be in configured region or the same" +
+ " region as S3 bucket",
+ expectedRegion,
+ ddbms.getRegion());
+ * This tests that after initialize() using a Configuration object, the
+ public void testInitializeWithConfiguration() throws IOException {
+ final String tableName = "testInitializeWithConfiguration";
+ final Configuration conf = getFileSystem().getConf();
+ conf.unset(S3GUARD_DDB_TABLE_NAME_KEY);
+ String savedRegion = conf.get(S3GUARD_DDB_REGION_KEY,
+ getFileSystem().getBucketLocation());
+ conf.unset(S3GUARD_DDB_REGION_KEY);
+ ddbms.initialize(conf);
+ fail("Should have failed because the table name is not set!");
+ } catch (IllegalArgumentException ignored) {
+ // config table name
+ fail("Should have failed because as the region is not set!");
+ // config region
+ conf.set(S3GUARD_DDB_REGION_KEY, savedRegion);
+ assertEquals("Unexpected key schema found!",
+ keySchema(),
+ ddbms.getTable().describe().getKeySchema());
+ * Test that for a large batch write request, the limit is handled correctly.
+ public void testBatchWrite() throws IOException {
+ final int[] numMetasToDeleteOrPut = {
+ -1, // null
+ 0, // empty collection
+ 1, // one path
+ S3GUARD_DDB_BATCH_WRITE_REQUEST_LIMIT, // exact limit of a batch request
+ S3GUARD_DDB_BATCH_WRITE_REQUEST_LIMIT + 1 // limit + 1
+ for (int numOldMetas : numMetasToDeleteOrPut) {
+ for (int numNewMetas : numMetasToDeleteOrPut) {
+ doTestBatchWrite(numOldMetas, numNewMetas);
+ private void doTestBatchWrite(int numDelete, int numPut) throws IOException {
+ final String root = S3URI + "/testBatchWrite_" + numDelete + '_' + numPut;
+ final Path oldDir = new Path(root, "oldDir");
+ final Path newDir = new Path(root, "newDir");
+ LOG.info("doTestBatchWrite: oldDir={}, newDir={}", oldDir, newDir);
+ DynamoDBMetadataStore ms = getDynamoMetadataStore();
+ ms.put(new PathMetadata(basicFileStatus(oldDir, 0, true)));
+ ms.put(new PathMetadata(basicFileStatus(newDir, 0, true)));
+ final List<PathMetadata> oldMetas =
+ numDelete < 0 ? null : new ArrayList<PathMetadata>(numDelete);
+ for (int i = 0; i < numDelete; i++) {
+ oldMetas.add(new PathMetadata(
+ basicFileStatus(new Path(oldDir, "child" + i), i, true)));
+ final List<PathMetadata> newMetas =
+ numPut < 0 ? null : new ArrayList<PathMetadata>(numPut);
+ for (int i = 0; i < numPut; i++) {
+ newMetas.add(new PathMetadata(
+ basicFileStatus(new Path(newDir, "child" + i), i, false)));
+ Collection<Path> pathsToDelete = null;
+ if (oldMetas != null) {
+ // put all metadata of old paths and verify
+ ms.put(new DirListingMetadata(oldDir, oldMetas, false));
+ assertEquals(0, ms.listChildren(newDir).withoutTombstones().numEntries());
+ assertTrue(CollectionUtils.isEqualCollection(oldMetas,
+ ms.listChildren(oldDir).getListing()));
+ pathsToDelete = new ArrayList<>(oldMetas.size());
+ for (PathMetadata meta : oldMetas) {
+ pathsToDelete.add(meta.getFileStatus().getPath());
+ // move the old paths to new paths and verify
+ ms.move(pathsToDelete, newMetas);
+ assertEquals(0, ms.listChildren(oldDir).withoutTombstones().numEntries());
+ if (newMetas != null) {
+ assertTrue(CollectionUtils.isEqualCollection(newMetas,
+ ms.listChildren(newDir).getListing()));
+ public void testInitExistingTable() throws IOException {
+ final DynamoDBMetadataStore ddbms = getDynamoMetadataStore();
+ final String tableName = ddbms.getTable().getTableName();
+ // create existing table
+ ddbms.initTable();
+ * Test the low level version check code.
+ public void testItemVersionCompatibility() throws Throwable {
+ verifyVersionCompatibility("table",
+ createVersionMarker(VERSION_MARKER, VERSION, 0));
+ * Test that a version marker entry without the version number field
+ * is rejected as incompatible with a meaningful error message.
+ public void testItemLacksVersion() throws Throwable {
+ intercept(IOException.class, E_NOT_VERSION_MARKER,
+ new VoidCallable() {
+ public void call() throws Exception {
+ new Item().withPrimaryKey(
+ createVersionMarkerPrimaryKey(VERSION_MARKER)));
+ * Delete the version marker and verify that table init fails.
+ public void testTableVersionRequired() throws Exception {
+ Configuration conf = getFileSystem().getConf();
+ int maxRetries = conf.getInt(S3GUARD_DDB_MAX_RETRIES,
+ conf.setInt(S3GUARD_DDB_MAX_RETRIES, 3);
+ final DynamoDBMetadataStore ddbms = createContract(conf).getMetadataStore();
+ String tableName = conf.get(S3GUARD_DDB_TABLE_NAME_KEY, BUCKET);
+ Table table = verifyTableInitialized(tableName);
+ table.deleteItem(VERSION_MARKER_PRIMARY_KEY);
+ intercept(IOException.class, E_NO_VERSION_MARKER,
+ conf.setInt(S3GUARD_DDB_MAX_RETRIES, maxRetries);
+ * Set the version value to a different number and verify that
+ * table init fails.
+ public void testTableVersionMismatch() throws Exception {
+ final DynamoDBMetadataStore ddbms = createContract().getMetadataStore();
+ String tableName = getFileSystem().getConf()
+ .get(S3GUARD_DDB_TABLE_NAME_KEY, BUCKET);
+ Item v200 = createVersionMarker(VERSION_MARKER, 200, 0);
+ table.putItem(v200);
+ intercept(IOException.class, E_INCOMPATIBLE_VERSION,
+ * Test that initTable fails with IOException when table does not exist and
+ * table auto-creation is disabled.
+ public void testFailNonexistentTable() throws IOException {
+ final String tableName = "testFailNonexistentTable";
+ conf.unset(S3GUARD_DDB_TABLE_CREATE_KEY);
+ fail("Should have failed as table does not exist and table auto-creation"
+ + " is disabled");
+ } catch (IOException ignored) {
+ * Test cases about root directory as it is not in the DynamoDB table.
+ public void testRootDirectory() throws IOException {
+ Path rootPath = new Path(S3URI);
+ verifyRootDirectory(ddbms.get(rootPath), true);
+ ddbms.put(new PathMetadata(new S3AFileStatus(true,
+ new Path(rootPath, "foo"),
+ UserGroupInformation.getCurrentUser().getShortUserName())));
+ verifyRootDirectory(ddbms.get(new Path(S3URI)), false);
+ private void verifyRootDirectory(PathMetadata rootMeta, boolean isEmpty) {
+ assertNotNull(rootMeta);
+ final FileStatus status = rootMeta.getFileStatus();
+ assertNotNull(status);
+ assertTrue(status.isDirectory());
+ // UNKNOWN is always a valid option, but true / false should not contradict
+ if (isEmpty) {
+ assertNotSame("Should not be marked non-empty",
+ Tristate.FALSE,
+ rootMeta.isEmptyDirectory());
+ assertNotSame("Should not be marked empty",
+ Tristate.TRUE,
+ * Test that when moving nested paths, all its ancestors up to destination
+ * root will also be created.
+ * Here is the directory tree before move:
+ * testMovePopulateAncestors
+ * ├── a
+ * │ └── b
+ * │ └── src
+ * │ ├── dir1
+ * │ │ └── dir2
+ * │ └── file1.txt
+ * └── c
+ * └── d
+ * └── dest
+ *</pre>
+ * As part of rename(a/b/src, d/c/dest), S3A will enumerate the subtree at
+ * a/b/src. This test verifies that after the move, the new subtree at
+ * 'dest' is reachable from the root (i.e. c/ and c/d exist in the table.
+ * DynamoDBMetadataStore depends on this property to do recursive delete
+ * without a full table scan.
+ public void testMovePopulatesAncestors() throws IOException {
+ final String testRoot = "/testMovePopulatesAncestors";
+ final String srcRoot = testRoot + "/a/b/src";
+ final String destRoot = testRoot + "/c/d/e/dest";
+ final Path nestedPath1 = strToPath(srcRoot + "/file1.txt");
+ ddbms.put(new PathMetadata(basicFileStatus(nestedPath1, 1024, false)));
+ final Path nestedPath2 = strToPath(srcRoot + "/dir1/dir2");
+ ddbms.put(new PathMetadata(basicFileStatus(nestedPath2, 0, true)));
+ // We don't put the destRoot path here, since put() would create ancestor
+ // entries, and we want to ensure that move() does it, instead.
+ // Build enumeration of src / dest paths and do the move()
+ final Collection<Path> fullSourcePaths = Lists.newArrayList(
+ strToPath(srcRoot),
+ strToPath(srcRoot + "/dir1"),
+ strToPath(srcRoot + "/dir1/dir2"),
+ strToPath(srcRoot + "/file1.txt")
+ final Collection<PathMetadata> pathsToCreate = Lists.newArrayList(
+ new PathMetadata(basicFileStatus(strToPath(destRoot),
+ 0, true)),
+ new PathMetadata(basicFileStatus(strToPath(destRoot + "/dir1"),
+ new PathMetadata(basicFileStatus(strToPath(destRoot + "/dir1/dir2"),
+ new PathMetadata(basicFileStatus(strToPath(destRoot + "/file1.txt"),
+ 1024, false))
+ ddbms.move(fullSourcePaths, pathsToCreate);
+ // assert that all the ancestors should have been populated automatically
+ assertCached(testRoot + "/c");
+ assertCached(testRoot + "/c/d");
+ assertCached(testRoot + "/c/d/e");
+ assertCached(destRoot /* /c/d/e/dest */);
+ // Also check moved files while we're at it
+ assertCached(destRoot + "/dir1");
+ assertCached(destRoot + "/dir1/dir2");
+ assertCached(destRoot + "/file1.txt");
+ public void testProvisionTable() throws IOException {
+ final ProvisionedThroughputDescription oldProvision =
+ dynamoDB.getTable(tableName).describe().getProvisionedThroughput();
+ ddbms.provisionTable(oldProvision.getReadCapacityUnits() * 2,
+ oldProvision.getWriteCapacityUnits() * 2);
+ final ProvisionedThroughputDescription newProvision =
+ LOG.info("Old provision = {}, new provision = {}",
+ oldProvision, newProvision);
+ assertEquals(oldProvision.getReadCapacityUnits() * 2,
+ newProvision.getReadCapacityUnits().longValue());
+ assertEquals(oldProvision.getWriteCapacityUnits() * 2,
+ newProvision.getWriteCapacityUnits().longValue());
+ public void testDeleteTable() throws IOException {
+ final String tableName = "testDeleteTable";
+ // we can list the empty table
+ ddbms.listChildren(new Path(S3URI));
+ ddbms.destroy();
+ verifyTableNotExist(tableName);
+ // delete table once more; be ResourceNotFoundException swallowed silently
+ // we can no longer list the destroyed table
+ fail("Should have failed after the table is destroyed!");
+ * This validates the table is created and ACTIVE in DynamoDB.
+ * This should not rely on the {@link DynamoDBMetadataStore} implementation.
+ * Return the table
+ private static Table verifyTableInitialized(String tableName) {
+ final Table table = dynamoDB.getTable(tableName);
+ final TableDescription td = table.describe();
+ assertEquals(tableName, td.getTableName());
+ assertEquals("ACTIVE", td.getTableStatus());
+ * This validates the table is not found in DynamoDB.
+ private static void verifyTableNotExist(String tableName) {
+ fail("Expecting ResourceNotFoundException for table '" + tableName + "'");
+ } catch (ResourceNotFoundException ignored) {
@@ -0,0 +1,140 @@
+ * MetadataStore unit test for {@link LocalMetadataStore}.
+public class TestLocalMetadataStore extends MetadataStoreTestBase {
+ private static final String MAX_ENTRIES_STR = "16";
+ private final static class LocalMSContract extends AbstractMSContract {
+ private LocalMSContract() throws IOException {
+ private LocalMSContract(Configuration config) throws IOException {
+ config.set(LocalMetadataStore.CONF_MAX_RECORDS, MAX_ENTRIES_STR);
+ fs = FileSystem.getLocal(config);
+ public FileSystem getFileSystem() {
+ return fs;
+ public MetadataStore getMetadataStore() throws IOException {
+ LocalMetadataStore lms = new LocalMetadataStore();
+ return lms;
+ public AbstractMSContract createContract() throws IOException {
+ return new LocalMSContract();
+ public AbstractMSContract createContract(Configuration conf) throws
+ return new LocalMSContract(conf);
+ public void testClearByAncestor() {
+ Map<Path, PathMetadata> map = new HashMap<>();
+ // 1. Test paths without scheme/host
+ assertClearResult(map, "", "/", 0);
+ assertClearResult(map, "", "/dirA/dirB", 2);
+ assertClearResult(map, "", "/invalid", 5);
+ // 2. Test paths w/ scheme/host
+ String p = "s3a://fake-bucket-name";
+ assertClearResult(map, p, "/", 0);
+ assertClearResult(map, p, "/dirA/dirB", 2);
+ assertClearResult(map, p, "/invalid", 5);
+ private static void populateMap(Map<Path, PathMetadata> map,
+ String prefix) {
+ populateEntry(map, new Path(prefix + "/dirA/dirB/"));
+ populateEntry(map, new Path(prefix + "/dirA/dirB/dirC"));
+ populateEntry(map, new Path(prefix + "/dirA/dirB/dirC/file1"));
+ populateEntry(map, new Path(prefix + "/dirA/dirB/dirC/file2"));
+ populateEntry(map, new Path(prefix + "/dirA/file1"));
+ private static void populateEntry(Map<Path, PathMetadata> map,
+ Path path) {
+ map.put(path, new PathMetadata(new FileStatus(0, true, 0, 0, 0, path)));
+ private static int sizeOfMap(Map<Path, PathMetadata> map) {
+ for (PathMetadata meta : map.values()) {
+ count++;
+ return count;
+ private static void assertClearResult(Map <Path, PathMetadata> map,
+ String prefixStr, String pathStr, int leftoverSize) {
+ populateMap(map, prefixStr);
+ LocalMetadataStore.deleteHashByAncestor(new Path(prefixStr + pathStr), map,
+ true);
+ assertEquals(String.format("Map should have %d entries", leftoverSize),
+ leftoverSize, sizeOfMap(map));
+ map.clear();
+ protected void verifyFileStatus(FileStatus status, long size) {
+ S3ATestUtils.verifyFileStatus(status, size, REPLICATION, getModTime(),
+ getAccessTime(),
+ BLOCK_SIZE, OWNER, GROUP, PERMISSION);
+ protected void verifyDirStatus(FileStatus status) {
+ S3ATestUtils.verifyDirStatus(status, REPLICATION, getModTime(),
+ getAccessTime(), OWNER, GROUP, PERMISSION);
@@ -0,0 +1,58 @@
+ * Run MetadataStore unit tests on the NullMetadataStore implementation.
+public class TestNullMetadataStore extends MetadataStoreTestBase {
+ private static class NullMSContract extends AbstractMSContract {
+ public FileSystem getFileSystem() throws IOException {
+ Configuration config = new Configuration();
+ return FileSystem.getLocal(config);
+ return new NullMetadataStore();
+ /** This MetadataStore always says "I don't know, ask the backing store". */
+ public AbstractMSContract createContract() {
+ return new NullMSContract();
+ public AbstractMSContract createContract(Configuration conf) {
+ return createContract();
@@ -0,0 +1,238 @@
+import static com.amazonaws.services.dynamodbv2.model.KeyType.HASH;
+import static com.amazonaws.services.dynamodbv2.model.KeyType.RANGE;
+import static com.amazonaws.services.dynamodbv2.model.ScalarAttributeType.S;
+import static org.hamcrest.CoreMatchers.anyOf;
+import static org.hamcrest.CoreMatchers.is;
+import static org.apache.hadoop.fs.s3a.s3guard.DynamoDBMetadataStore.VERSION_MARKER;
+import static org.apache.hadoop.fs.s3a.s3guard.DynamoDBMetadataStore.VERSION;
+ * Test the PathMetadataDynamoDBTranslation is able to translate between domain
+ * model objects and DynamoDB items.
+public class TestPathMetadataDynamoDBTranslation extends Assert {
+ private static final Path TEST_DIR_PATH = new Path("s3a://test-bucket/myDir");
+ private static final Item TEST_DIR_ITEM = new Item();
+ private static PathMetadata testDirPathMetadata;
+ private static final long TEST_FILE_LENGTH = 100;
+ private static final long TEST_MOD_TIME = 9999;
+ private static final long TEST_BLOCK_SIZE = 128;
+ private static final Path TEST_FILE_PATH = new Path(TEST_DIR_PATH, "myFile");
+ private static final Item TEST_FILE_ITEM = new Item();
+ private static PathMetadata testFilePathMetadata;
+ public static void setUpBeforeClass() throws IOException {
+ String username = UserGroupInformation.getCurrentUser().getShortUserName();
+ testDirPathMetadata =
+ new PathMetadata(new S3AFileStatus(false, TEST_DIR_PATH, username));
+ TEST_DIR_ITEM
+ .withPrimaryKey(PARENT, "/test-bucket", CHILD, TEST_DIR_PATH.getName())
+ .withBoolean(IS_DIR, true);
+ testFilePathMetadata = new PathMetadata(
+ new S3AFileStatus(TEST_FILE_LENGTH, TEST_MOD_TIME, TEST_FILE_PATH,
+ TEST_BLOCK_SIZE, username));
+ TEST_FILE_ITEM
+ .withPrimaryKey(PARENT, pathToParentKey(TEST_FILE_PATH.getParent()),
+ CHILD, TEST_FILE_PATH.getName())
+ .withBoolean(IS_DIR, false)
+ .withLong(FILE_LENGTH, TEST_FILE_LENGTH)
+ .withLong(MOD_TIME, TEST_MOD_TIME)
+ .withLong(BLOCK_SIZE, TEST_BLOCK_SIZE);
+ * It should not take long time as it doesn't involve remote server operation.
+ public final Timeout timeout = new Timeout(30 * 1000);
+ public void testKeySchema() {
+ final Collection<KeySchemaElement> keySchema =
+ PathMetadataDynamoDBTranslation.keySchema();
+ assertNotNull(keySchema);
+ assertEquals("There should be HASH and RANGE key in key schema",
+ 2, keySchema.size());
+ for (KeySchemaElement element : keySchema) {
+ assertThat(element.getAttributeName(), anyOf(is(PARENT), is(CHILD)));
+ assertThat(element.getKeyType(),
+ anyOf(is(HASH.toString()), is(RANGE.toString())));
+ public void testAttributeDefinitions() {
+ final Collection<AttributeDefinition> attrs =
+ PathMetadataDynamoDBTranslation.attributeDefinitions();
+ assertNotNull(attrs);
+ assertEquals("There should be HASH and RANGE attributes", 2, attrs.size());
+ for (AttributeDefinition definition : attrs) {
+ assertThat(definition.getAttributeName(), anyOf(is(PARENT), is(CHILD)));
+ assertEquals(S.toString(), definition.getAttributeType());
+ public void testItemToPathMetadata() throws IOException {
+ final String user =
+ UserGroupInformation.getCurrentUser().getShortUserName();
+ assertNull(itemToPathMetadata(null, user));
+ verify(TEST_DIR_ITEM, itemToPathMetadata(TEST_DIR_ITEM, user));
+ verify(TEST_FILE_ITEM, itemToPathMetadata(TEST_FILE_ITEM, user));
+ * Verify that the Item and PathMetadata objects hold the same information.
+ private static void verify(Item item, PathMetadata meta) {
+ assertNotNull(meta);
+ final Path path = status.getPath();
+ assertEquals(item.get(PARENT), pathToParentKey(path.getParent()));
+ assertEquals(item.get(CHILD), path.getName());
+ assertEquals(isDir, status.isDirectory());
+ assertEquals(len, status.getLen());
+ long bSize = item.hasAttribute(BLOCK_SIZE) ? item.getLong(BLOCK_SIZE) : 0;
+ assertEquals(bSize, status.getBlockSize());
+ * S3AFileStatue#getModificationTime() reports the current time, so the
+ * following assertion is failing.
+ * long modTime = item.hasAttribute(MOD_TIME) ? item.getLong(MOD_TIME) : 0;
+ * assertEquals(modTime, status.getModificationTime());
+ public void testPathMetadataToItem() {
+ verify(pathMetadataToItem(testDirPathMetadata), testDirPathMetadata);
+ verify(pathMetadataToItem(testFilePathMetadata),
+ testFilePathMetadata);
+ public void testPathToParentKeyAttribute() {
+ doTestPathToParentKeyAttribute(TEST_DIR_PATH);
+ doTestPathToParentKeyAttribute(TEST_FILE_PATH);
+ private static void doTestPathToParentKeyAttribute(Path path) {
+ final KeyAttribute attr = pathToParentKeyAttribute(path);
+ assertNotNull(attr);
+ assertEquals(PARENT, attr.getName());
+ // this path is expected as parent filed
+ assertEquals(pathToParentKey(path), attr.getValue());
+ private static String pathToParentKey(Path p) {
+ Preconditions.checkArgument(p.isUriPathAbsolute());
+ URI parentUri = p.toUri();
+ String bucket = parentUri.getHost();
+ Preconditions.checkNotNull(bucket);
+ String s = "/" + bucket + parentUri.getPath();
+ // strip trailing slash
+ if (s.endsWith("/")) {
+ s = s.substring(0, s.length()-1);
+ return s;
+ public void testPathToKey() throws Exception {
+ LambdaTestUtils.intercept(IllegalArgumentException.class,
+ new Callable<PrimaryKey>() {
+ public PrimaryKey call() throws Exception {
+ return pathToKey(new Path("/"));
+ doTestPathToKey(TEST_DIR_PATH);
+ doTestPathToKey(TEST_FILE_PATH);
+ private static void doTestPathToKey(Path path) {
+ final PrimaryKey key = pathToKey(path);
+ assertNotNull(key);
+ assertEquals("There should be both HASH and RANGE keys",
+ 2, key.getComponents().size());
+ for (KeyAttribute keyAttribute : key.getComponents()) {
+ assertThat(keyAttribute.getName(), anyOf(is(PARENT), is(CHILD)));
+ if (PARENT.equals(keyAttribute.getName())) {
+ assertEquals(pathToParentKey(path.getParent()),
+ keyAttribute.getValue());
+ assertEquals(path.getName(), keyAttribute.getValue());
+ public void testVersionRoundTrip() throws Throwable {
+ final Item marker = createVersionMarker(VERSION_MARKER, VERSION, 0);
+ assertEquals("Extracted version from " + marker,
+ VERSION, extractVersionFromMarker(marker));
+ public void testVersionMarkerNotStatusIllegalPath() throws Throwable {
+ assertNull("Path metadata fromfrom " + marker,
+ itemToPathMetadata(marker, "alice"));
@@ -0,0 +1,93 @@
+ * Tests for the {@link S3Guard} utility class.
+public class TestS3Guard extends Assert {
+ * Basic test to ensure results from S3 and MetadataStore are merged
+ * correctly.
+ public void testDirListingUnion() throws Exception {
+ MetadataStore ms = new LocalMetadataStore();
+ Path dirPath = new Path("s3a://bucket/dir");
+ // Two files in metadata store listing
+ PathMetadata m1 = makePathMeta("s3a://bucket/dir/ms-file1", false);
+ PathMetadata m2 = makePathMeta("s3a://bucket/dir/ms-file2", false);
+ DirListingMetadata dirMeta = new DirListingMetadata(dirPath,
+ Arrays.asList(m1, m2), false);
+ // Two other files in s3
+ List<FileStatus> s3Listing = Arrays.asList(
+ makeFileStatus("s3a://bucket/dir/s3-file3", false),
+ makeFileStatus("s3a://bucket/dir/s3-file4", false)
+ FileStatus[] result = S3Guard.dirListingUnion(ms, dirPath, s3Listing,
+ dirMeta, false);
+ assertEquals("listing length", 4, result.length);
+ assertContainsPath(result, "s3a://bucket/dir/ms-file1");
+ assertContainsPath(result, "s3a://bucket/dir/ms-file2");
+ assertContainsPath(result, "s3a://bucket/dir/s3-file3");
+ assertContainsPath(result, "s3a://bucket/dir/s3-file4");
+ void assertContainsPath(FileStatus[] statuses, String pathStr) {
+ assertTrue("listing doesn't contain " + pathStr,
+ containsPath(statuses, pathStr));
+ boolean containsPath(FileStatus[] statuses, String pathStr) {
+ for (FileStatus s : statuses) {
+ if (s.getPath().toString().equals(pathStr)) {
+ private PathMetadata makePathMeta(String pathStr, boolean isDir) {
+ return new PathMetadata(makeFileStatus(pathStr, isDir));
+ private FileStatus makeFileStatus(String pathStr, boolean isDir) {
+ Path p = new Path(pathStr);
+ return new FileStatus(0, true, 1, 1, System.currentTimeMillis(), p);
+ return new FileStatus(100, false, 1, 1, System.currentTimeMillis(), p);
@@ -0,0 +1,250 @@
+package org.apache.hadoop.fs.s3a.scale;
+import org.apache.hadoop.fs.s3a.s3guard.PathMetadata;
+import static org.apache.hadoop.fs.contract.ContractTestUtils.NanoTimer;
+ * Test the performance of a MetadataStore. Useful for load testing.
+ * Could be separated from S3A code, but we're using the S3A scale test
+ * framework for convenience.
+public abstract class AbstractITestS3AMetadataStoreScale extends
+ S3AScaleTestBase {
+ private static final Logger LOG = LoggerFactory.getLogger(
+ AbstractITestS3AMetadataStoreScale.class);
+ /** Some dummy values for FileStatus contents. */
+ static final long SIZE = BLOCK_SIZE * 2;
+ static final long ACCESS_TIME = System.currentTimeMillis();
+ static final Path BUCKET_ROOT = new Path("s3a://fake-bucket/");
+ * Subclasses should override this to provide the MetadataStore they which
+ * to test.
+ * @return MetadataStore to test against
+ public abstract MetadataStore createMetadataStore() throws IOException;
+ public void testPut() throws Throwable {
+ describe("Test workload of put() operations");
+ // As described in hadoop-aws site docs, count parameter is used for
+ // width and depth of directory tree
+ int width = getConf().getInt(KEY_DIRECTORY_COUNT, DEFAULT_DIRECTORY_COUNT);
+ int depth = width;
+ List<PathMetadata> paths = new ArrayList<>();
+ createDirTree(BUCKET_ROOT, depth, width, paths);
+ long count = 1; // Some value in case we throw an exception below
+ try (MetadataStore ms = createMetadataStore()) {
+ count = populateMetadataStore(paths, ms);
+ clearMetadataStore(ms, count);
+ public void testMoves() throws Throwable {
+ describe("Test workload of batched move() operations");
+ long operations = getConf().getLong(KEY_OPERATION_COUNT,
+ DEFAULT_OPERATION_COUNT);
+ List<PathMetadata> origMetas = new ArrayList<>();
+ createDirTree(BUCKET_ROOT, depth, width, origMetas);
+ // Pre-compute source and destination paths for move() loop below
+ List<Path> origPaths = metasToPaths(origMetas);
+ List<PathMetadata> movedMetas = moveMetas(origMetas, BUCKET_ROOT,
+ new Path(BUCKET_ROOT, "moved-here"));
+ List<Path> movedPaths = metasToPaths(movedMetas);
+ // Setup
+ count = populateMetadataStore(origMetas, ms);
+ // Main loop: move things back and forth
+ describe("Running move workload");
+ NanoTimer moveTimer = new NanoTimer();
+ LOG.info("Running {} moves of {} paths each", operations,
+ origMetas.size());
+ for (int i = 0; i < operations; i++) {
+ Collection<Path> toDelete;
+ Collection<PathMetadata> toCreate;
+ if (i % 2 == 0) {
+ toDelete = origPaths;
+ toCreate = movedMetas;
+ toDelete = movedPaths;
+ toCreate = origMetas;
+ ms.move(toDelete, toCreate);
+ moveTimer.end();
+ printTiming(LOG, "move", moveTimer, operations);
+ // Cleanup
+ * Create a copy of given list of PathMetadatas with the paths moved from
+ * src to dest.
+ private List<PathMetadata> moveMetas(List<PathMetadata> metas, Path src,
+ Path dest) throws IOException {
+ List<PathMetadata> moved = new ArrayList<>(metas.size());
+ for (PathMetadata srcMeta : metas) {
+ S3AFileStatus status = copyStatus((S3AFileStatus)srcMeta.getFileStatus());
+ status.setPath(movePath(status.getPath(), src, dest));
+ moved.add(new PathMetadata(status));
+ return moved;
+ private Path movePath(Path p, Path src, Path dest) {
+ String srcStr = src.toUri().getPath();
+ String pathStr = p.toUri().getPath();
+ // Strip off src dir
+ pathStr = pathStr.substring(srcStr.length());
+ // Prepend new dest
+ return new Path(dest, pathStr);
+ private S3AFileStatus copyStatus(S3AFileStatus status) {
+ return new S3AFileStatus(status.isEmptyDirectory(), status.getPath(),
+ status.getOwner());
+ return new S3AFileStatus(status.getLen(), status.getModificationTime(),
+ status.getPath(), status.getBlockSize(), status.getOwner());
+ /** @return number of PathMetadatas put() into MetadataStore */
+ private long populateMetadataStore(Collection<PathMetadata> paths,
+ MetadataStore ms) throws IOException {
+ long count = 0;
+ NanoTimer putTimer = new NanoTimer();
+ describe("Inserting into MetadataStore");
+ for (PathMetadata p : paths) {
+ ms.put(p);
+ putTimer.end();
+ printTiming(LOG, "put", putTimer, count);
+ private void clearMetadataStore(MetadataStore ms, long count)
+ describe("Recursive deletion");
+ NanoTimer deleteTimer = new NanoTimer();
+ ms.deleteSubtree(BUCKET_ROOT);
+ deleteTimer.end();
+ printTiming(LOG, "delete", deleteTimer, count);
+ private static void printTiming(Logger log, String op, NanoTimer timer,
+ long count) {
+ double msec = (double)timer.duration() / 1000;
+ double msecPerOp = msec / count;
+ log.info(String.format("Elapsed %.2f msec. %.3f msec / %s (%d ops)", msec,
+ msecPerOp, op, count));
+ private static S3AFileStatus makeFileStatus(Path path) throws IOException {
+ return new S3AFileStatus(SIZE, ACCESS_TIME, path, BLOCK_SIZE, OWNER);
+ private static S3AFileStatus makeDirStatus(Path p) throws IOException {
+ return new S3AFileStatus(false, p, OWNER);
+ private List<Path> metasToPaths(List<PathMetadata> metas) {
+ List<Path> paths = new ArrayList<>(metas.size());
+ paths.add(meta.getFileStatus().getPath());
+ * Recursively create a directory tree.
+ * @param parent Parent dir of the paths to create.
+ * @param depth How many more levels deep past parent to create.
+ * @param width Number of files (and directories, if depth > 0) per directory.
+ * @param paths List to add generated paths to.
+ private static void createDirTree(Path parent, int depth, int width,
+ Collection<PathMetadata> paths) throws IOException {
+ // Create files
+ for (int i = 0; i < width; i++) {
+ Path p = new Path(parent, String.format("file-%d", i));
+ PathMetadata meta = new PathMetadata(makeFileStatus(p));
+ paths.add(meta);
+ if (depth == 0) {
+ // Create directories if there is depth remaining
+ Path dir = new Path(parent, String.format("dir-%d", i));
+ PathMetadata meta = new PathMetadata(makeDirStatus(dir));
+ createDirTree(dir, depth-1, width, paths);
@@ -25,6 +25,7 @@ import java.util.concurrent.atomic.AtomicLong;
import com.amazonaws.event.ProgressEvent;
import com.amazonaws.event.ProgressEventType;
import com.amazonaws.event.ProgressListener;
import org.junit.FixMethodOrder;
import org.junit.runners.MethodSorters;
@@ -34,11 +35,9 @@ import org.slf4j.LoggerFactory;
import org.apache.hadoop.fs.FSDataInputStream;
-import org.apache.hadoop.fs.FileStatus;
import org.apache.hadoop.fs.StorageStatistics;
-import org.apache.hadoop.fs.s3a.S3AFileStatus;
import org.apache.hadoop.fs.s3a.S3AFileSystem;
import org.apache.hadoop.fs.s3a.S3AInstrumentation;
import org.apache.hadoop.fs.s3a.Statistic;
@@ -222,7 +221,7 @@ public abstract class AbstractSTestS3AHugeFiles extends S3AScaleTestBase {
assertEquals("active put requests in \n" + fs,
0, gaugeValue(putRequestsActive));
ContractTestUtils.assertPathExists(fs, "Huge file", hugefile);
- S3AFileStatus status = fs.getFileStatus(hugefile);
+ FileStatus status = fs.getFileStatus(hugefile);
ContractTestUtils.assertIsFile(hugefile, status);
assertEquals("File size in " + status, filesize, status.getLen());
if (progress != null) {
@@ -324,7 +323,7 @@ public abstract class AbstractSTestS3AHugeFiles extends S3AScaleTestBase {
String filetype = encrypted ? "encrypted file" : "file";
describe("Positioned reads of %s %s", filetype, hugefile);
long filesize = status.getLen();
int ops = 0;
final int bufferSize = 8192;
@@ -364,7 +363,7 @@ public abstract class AbstractSTestS3AHugeFiles extends S3AScaleTestBase {
assumeHugeFileExists();
describe("Reading %s", hugefile);
long blocks = filesize / uploadBlockSize;
byte[] data = new byte[uploadBlockSize];
@@ -390,7 +389,7 @@ public abstract class AbstractSTestS3AHugeFiles extends S3AScaleTestBase {
describe("renaming %s to %s", hugefile, hugefileRenamed);
fs.delete(hugefileRenamed, false);
ContractTestUtils.NanoTimer timer = new ContractTestUtils.NanoTimer();
@@ -401,7 +400,7 @@ public abstract class AbstractSTestS3AHugeFiles extends S3AScaleTestBase {
toHuman(timer.nanosPerOperation(mb)));
bandwidth(timer, filesize);
logFSState();
- S3AFileStatus destFileStatus = fs.getFileStatus(hugefileRenamed);
+ FileStatus destFileStatus = fs.getFileStatus(hugefileRenamed);
assertEquals(filesize, destFileStatus.getLen());
// rename back
@@ -0,0 +1,48 @@
+import org.apache.hadoop.fs.s3a.s3guard.DynamoDBMetadataStore;
+ * Scale test for DynamoDBMetadataStore.
+public class ITestDynamoDBMetadataStoreScale
+ extends AbstractITestS3AMetadataStoreScale {
+ public MetadataStore createMetadataStore() throws IOException {
+ String ddbTable = conf.get(S3GUARD_DDB_TABLE_NAME_KEY);
+ assumeNotNull("DynamoDB table is configured", ddbTable);
+ String ddbEndpoint = conf.get(S3GUARD_DDB_REGION_KEY);
+ assumeNotNull("DynamoDB endpoint is configured", ddbEndpoint);
+ ms.initialize(getFileSystem().getConf());
@@ -0,0 +1,37 @@
+import org.apache.hadoop.fs.s3a.s3guard.LocalMetadataStore;
+ * Scale test for LocalMetadataStore.
+public class ITestLocalMetadataStoreScale
@@ -107,7 +107,7 @@ public class ITestS3AConcurrentOps extends S3AScaleTestBase {
private S3AFileSystem getNormalFileSystem() throws Exception {
S3AFileSystem s3a = new S3AFileSystem();
+ Configuration conf = createScaleConfiguration();
URI rootURI = new URI(conf.get(TEST_FS_S3A_NAME));
s3a.initialize(rootURI, conf);
return s3a;
@@ -115,6 +115,7 @@ public class ITestS3AConcurrentOps extends S3AScaleTestBase {
public void teardown() throws Exception {
if (auxFs != null) {
auxFs.delete(testRoot, true);
@@ -0,0 +1,86 @@
+import java.io.OutputStream;
+import static org.apache.hadoop.fs.contract.ContractTestUtils.*;
+ * Tests for create(): performance and/or load testing.
+public class ITestS3ACreatePerformance extends S3AScaleTestBase {
+ ITestS3ADirectoryPerformance.class);
+ private Path basePath;
+ private int basePathDepth;
+ private static final int PATH_DEPTH = 10;
+ basePath = getTestPath();
+ basePathDepth = basePath.depth();
+ * Test rate at which we can create deeply-nested files from a single thread.
+ public void testDeepSequentialCreate() throws Exception {
+ long numOperations = getOperationCount();
+ NanoTimer timer = new NanoTimer();
+ for (int i = 0; i < numOperations; i++) {
+ Path p = getPathIteration(i, PATH_DEPTH);
+ OutputStream out = fs.create(p);
+ out.write(40); // one byte file with some value 40
+ timer.end("Time to create %d files of depth %d", getOperationCount(),
+ PATH_DEPTH);
+ LOG.info("Time per create: {} msec",
+ timer.nanosPerOperation(numOperations) / 1000);
+ /* Get a unique path of depth totalDepth for given test iteration. */
+ private Path getPathIteration(long iter, int totalDepth) throws Exception {
+ assertTrue("Test path too long, increase PATH_DEPTH in test.",
+ totalDepth > basePathDepth);
+ int neededDirs = totalDepth - basePathDepth - 1;
+ for (int i = 0; i < neededDirs; i++) {
+ sb.append("iter-").append(iter);
+ sb.append("-dir-").append(i);
+ sb.append("/");
+ sb.append("file").append(iter);
+ return new Path(basePath, sb.toString());
@@ -113,14 +113,15 @@ public class ITestS3ADirectoryPerformance extends S3AScaleTestBase {
listContinueRequests,
listStatusCalls,
getFileStatusCalls);
- assertEquals(listRequests.toString(), 2, listRequests.diff());
+ assertEquals(listRequests.toString(), 2, listRequests.diff());
reset(metadataRequests,
listRequests,
describe("deletion");
// deletion at the end of the run
@@ -20,10 +20,10 @@ package org.apache.hadoop.fs.s3a.scale;
import org.apache.hadoop.fs.s3a.S3AInputPolicy;
import org.apache.hadoop.fs.s3a.S3AInputStream;
@@ -56,7 +56,7 @@ public class ITestS3AInputStreamPerformance extends S3AScaleTestBase {
private S3AFileSystem s3aFS;
private Path testData;
- private S3AFileStatus testDataStatus;
+ private FileStatus testDataStatus;
private FSDataInputStream in;
private S3AInstrumentation.InputStreamStatistics streamStatistics;
public static final int BLOCK_SIZE = 32 * 1024;
@@ -126,7 +126,7 @@ public class S3AScaleTestBase extends AbstractS3ATestBase {
* @return a configuration with which to create FS instances
protected Configuration createScaleConfiguration() {
- return new Configuration();
+ return super.createConfiguration();
protected Path getTestPath() {
@@ -36,6 +36,25 @@
<description>The endpoint for s3a://landsat-pds URLs</description>
+ <!-- Make sure S3Guard is disabled for read-only bucket tests. -->
+ managed by s3guard</description>
+ <!-- Convenience definitions. -->
<!--
This is the default endpoint, which can be used to interact
with any v2 region.
@@ -110,6 +129,13 @@
<value>${central.endpoint}</value>
+ <!-- Scale integration tests may time out on slower connections
+ you can reduce the operation count like so to mitigate this.
+ -->
<!-- Turn security off for tests by default -->
@@ -19,5 +19,16 @@ log4j.appender.stdout.layout.ConversionPattern=%d{ISO8601} [%t] %-5p %c{2} (%F:%
log4j.logger.org.apache.hadoop.util.NativeCodeLoader=ERROR
-# for debugging low level S3a operations, uncomment this line
-# log4j.logger.org.apache.hadoop.fs.s3a=DEBUG
+# for debugging low level S3a operations, uncomment these lines
+#log4j.logger.org.apache.hadoop.fs.s3a=DEBUG
+#log4j.logger.org.apache.hadoop.fs.s3a.s3guard=DEBUG
+#log4j.logger.com.amazonaws.services.dynamodbv2.AmazonDynamoDB=DEBUG
+#log4j.logger.com.amazonaws.request=DEBUG